adrian/imposter
1
0
Fork 0
Code Issues Pull Requests Actions Packages Projects Releases Wiki Activity

first commit

Browse Source
This commit is contained in:
adrian
2025-12-04 21:21:30 +01:00
commit 3dd6b3ff36
2124 changed files with 338827 additions and 0 deletions
Download Patch File Download Diff File Expand all files Collapse all files

22
node_modules/socket.io/LICENSE generated vendored Normal file
View File

@ -0,0 +1,22 @@
(The MIT License)
Copyright (c) 2014-present Guillermo Rauch and Socket.IO contributors
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

273
node_modules/socket.io/Readme.md generated vendored Normal file
View File

@ -0,0 +1,273 @@
# socket.io
[![Run on Repl.it](https://repl.it/badge/github/socketio/socket.io)](https://replit.com/@socketio/socketio-minimal-example)
[![Backers on Open Collective](https://opencollective.com/socketio/backers/badge.svg)](#backers) [![Sponsors on Open Collective](https://opencollective.com/socketio/sponsors/badge.svg)](#sponsors)
[![Build Status](https://github.com/socketio/socket.io/workflows/CI/badge.svg)](https://github.com/socketio/socket.io/actions)
[![NPM version](https://badge.fury.io/js/socket.io.svg)](https://www.npmjs.com/package/socket.io)
![Downloads](https://img.shields.io/npm/dm/socket.io.svg?style=flat)
[![](https://slackin-socketio.now.sh/badge.svg)](https://slackin-socketio.now.sh)
## Features
Socket.IO enables real-time bidirectional event-based communication. It consists of:
- a Node.js server (this repository)
- a [Javascript client library](https://github.com/socketio/socket.io-client) for the browser (or a Node.js client)
Some implementations in other languages are also available:
- [Java](https://github.com/socketio/socket.io-client-java)
- [C++](https://github.com/socketio/socket.io-client-cpp)
- [Swift](https://github.com/socketio/socket.io-client-swift)
- [Dart](https://github.com/rikulo/socket.io-client-dart)
- [Python](https://github.com/miguelgrinberg/python-socketio)
- [.NET](https://github.com/doghappy/socket.io-client-csharp)
- [Rust](https://github.com/1c3t3a/rust-socketio)
- [PHP](https://github.com/ElephantIO/elephant.io)
Its main features are:
#### Reliability
Connections are established even in the presence of:
- proxies and load balancers.
- personal firewall and antivirus software.
For this purpose, it relies on [Engine.IO](https://github.com/socketio/engine.io), which first establishes a long-polling connection, then tries to upgrade to better transports that are "tested" on the side, like WebSocket. Please see the [Goals](https://github.com/socketio/engine.io#goals) section for more information.
#### Auto-reconnection support
Unless instructed otherwise a disconnected client will try to reconnect forever, until the server is available again. Please see the available reconnection options [here](https://socket.io/docs/v3/client-api/#new-Manager-url-options).
#### Disconnection detection
A heartbeat mechanism is implemented at the Engine.IO level, allowing both the server and the client to know when the other one is not responding anymore.
That functionality is achieved with timers set on both the server and the client, with timeout values (the `pingInterval` and `pingTimeout` parameters) shared during the connection handshake. Those timers require any subsequent client calls to be directed to the same server, hence the `sticky-session` requirement when using multiples nodes.
#### Binary support
Any serializable data structures can be emitted, including:
- [ArrayBuffer](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/ArrayBuffer) and [Blob](https://developer.mozilla.org/en-US/docs/Web/API/Blob) in the browser
- [ArrayBuffer](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/ArrayBuffer) and [Buffer](https://nodejs.org/api/buffer.html) in Node.js
#### Simple and convenient API
Sample code:
```js
io.on('connection', socket => {
socket.emit('request', /* … */); // emit an event to the socket
io.emit('broadcast', /* … */); // emit an event to all connected sockets
socket.on('reply', () => { /* … */ }); // listen to the event
});
```
#### Cross-browser
Browser support is tested in Sauce Labs:
[![Sauce Test Status](https://saucelabs.com/browser-matrix/socket.svg)](https://saucelabs.com/u/socket)
#### Multiplexing support
In order to create separation of concerns within your application (for example per module, or based on permissions), Socket.IO allows you to create several `Namespaces`, which will act as separate communication channels but will share the same underlying connection.
#### Room support
Within each `Namespace`, you can define arbitrary channels, called `Rooms`, that sockets can join and leave. You can then broadcast to any given room, reaching every socket that has joined it.
This is a useful feature to send notifications to a group of users, or to a given user connected on several devices for example.
**Note:** Socket.IO is not a WebSocket implementation. Although Socket.IO indeed uses WebSocket as a transport when possible, it adds some metadata to each packet: the packet type, the namespace and the ack id when a message acknowledgement is needed. That is why a WebSocket client will not be able to successfully connect to a Socket.IO server, and a Socket.IO client will not be able to connect to a WebSocket server (like `ws://echo.websocket.org`) either. Please see the protocol specification [here](https://github.com/socketio/socket.io-protocol).
## Installation
```bash
// with npm
npm install socket.io
// with yarn
yarn add socket.io
```
## How to use
The following example attaches socket.io to a plain Node.JS
HTTP server listening on port `3000`.
```js
const server = require('http').createServer();
const io = require('socket.io')(server);
io.on('connection', client => {
client.on('event', data => { /* … */ });
client.on('disconnect', () => { /* … */ });
});
server.listen(3000);
```
### Standalone
```js
const io = require('socket.io')();
io.on('connection', client => { ... });
io.listen(3000);
```
### Module syntax
```js
import { Server } from "socket.io";
const io = new Server(server);
io.listen(3000);
```
### In conjunction with Express
Starting with **3.0**, express applications have become request handler
functions that you pass to `http` or `http` `Server` instances. You need
to pass the `Server` to `socket.io`, not the express application
function. Also make sure to call `.listen` on the `server`, not the `app`.
```js
const app = require('express')();
const server = require('http').createServer(app);
const io = require('socket.io')(server);
io.on('connection', () => { /* … */ });
server.listen(3000);
```
### In conjunction with Koa
Like Express.JS, Koa works by exposing an application as a request
handler function, but only by calling the `callback` method.
```js
const app = require('koa')();
const server = require('http').createServer(app.callback());
const io = require('socket.io')(server);
io.on('connection', () => { /* … */ });
server.listen(3000);
```
### In conjunction with Fastify
To integrate Socket.io in your Fastify application you just need to
register `fastify-socket.io` plugin. It will create a `decorator`
called `io`.
```js
const app = require('fastify')();
app.register(require('fastify-socket.io'));
app.ready().then(() => {
app.io.on('connection', () => { /* … */ });
})
app.listen(3000);
```
## Documentation
Please see the documentation [here](https://socket.io/docs/).
The source code of the website can be found [here](https://github.com/socketio/socket.io-website). Contributions are welcome!
## Debug / logging
Socket.IO is powered by [debug](https://github.com/visionmedia/debug).
In order to see all the debug output, run your app with the environment variable
`DEBUG` including the desired scope.
To see the output from all of Socket.IO's debugging scopes you can use:
```
DEBUG=socket.io* node myapp
```
## Testing
```
npm test
```
This runs the `gulp` task `test`. By default the test will be run with the source code in `lib` directory.
Set the environmental variable `TEST_VERSION` to `compat` to test the transpiled es5-compat version of the code.
The `gulp` task `test` will always transpile the source code into es5 and export to `dist` first before running the test.
## Backers
Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/socketio#backer)]
<a href="https://opencollective.com/socketio/backer/0/website" target="_blank"><img src="https://opencollective.com/socketio/backer/0/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/1/website" target="_blank"><img src="https://opencollective.com/socketio/backer/1/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/2/website" target="_blank"><img src="https://opencollective.com/socketio/backer/2/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/3/website" target="_blank"><img src="https://opencollective.com/socketio/backer/3/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/4/website" target="_blank"><img src="https://opencollective.com/socketio/backer/4/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/5/website" target="_blank"><img src="https://opencollective.com/socketio/backer/5/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/6/website" target="_blank"><img src="https://opencollective.com/socketio/backer/6/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/7/website" target="_blank"><img src="https://opencollective.com/socketio/backer/7/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/8/website" target="_blank"><img src="https://opencollective.com/socketio/backer/8/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/9/website" target="_blank"><img src="https://opencollective.com/socketio/backer/9/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/10/website" target="_blank"><img src="https://opencollective.com/socketio/backer/10/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/11/website" target="_blank"><img src="https://opencollective.com/socketio/backer/11/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/12/website" target="_blank"><img src="https://opencollective.com/socketio/backer/12/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/13/website" target="_blank"><img src="https://opencollective.com/socketio/backer/13/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/14/website" target="_blank"><img src="https://opencollective.com/socketio/backer/14/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/15/website" target="_blank"><img src="https://opencollective.com/socketio/backer/15/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/16/website" target="_blank"><img src="https://opencollective.com/socketio/backer/16/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/17/website" target="_blank"><img src="https://opencollective.com/socketio/backer/17/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/18/website" target="_blank"><img src="https://opencollective.com/socketio/backer/18/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/19/website" target="_blank"><img src="https://opencollective.com/socketio/backer/19/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/20/website" target="_blank"><img src="https://opencollective.com/socketio/backer/20/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/21/website" target="_blank"><img src="https://opencollective.com/socketio/backer/21/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/22/website" target="_blank"><img src="https://opencollective.com/socketio/backer/22/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/23/website" target="_blank"><img src="https://opencollective.com/socketio/backer/23/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/24/website" target="_blank"><img src="https://opencollective.com/socketio/backer/24/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/25/website" target="_blank"><img src="https://opencollective.com/socketio/backer/25/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/26/website" target="_blank"><img src="https://opencollective.com/socketio/backer/26/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/27/website" target="_blank"><img src="https://opencollective.com/socketio/backer/27/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/28/website" target="_blank"><img src="https://opencollective.com/socketio/backer/28/avatar.svg"></a>
<a href="https://opencollective.com/socketio/backer/29/website" target="_blank"><img src="https://opencollective.com/socketio/backer/29/avatar.svg"></a>
## Sponsors
Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/socketio#sponsor)]
<a href="https://opencollective.com/socketio/sponsor/0/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/0/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/1/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/1/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/2/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/2/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/3/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/3/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/4/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/4/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/5/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/5/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/6/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/6/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/7/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/7/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/8/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/8/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/9/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/9/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/10/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/10/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/11/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/11/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/12/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/12/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/13/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/13/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/14/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/14/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/15/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/15/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/16/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/16/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/17/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/17/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/18/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/18/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/19/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/19/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/20/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/20/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/21/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/21/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/22/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/22/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/23/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/23/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/24/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/24/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/25/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/25/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/26/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/26/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/27/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/27/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/28/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/28/avatar.svg"></a>
<a href="https://opencollective.com/socketio/sponsor/29/website" target="_blank"><img src="https://opencollective.com/socketio/sponsor/29/avatar.svg"></a>
## License
[MIT](LICENSE)

7
node_modules/socket.io/client-dist/socket.io.esm.min.js generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

1
node_modules/socket.io/client-dist/socket.io.esm.min.js.map generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

4908
node_modules/socket.io/client-dist/socket.io.js generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

1
node_modules/socket.io/client-dist/socket.io.js.map generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

7
node_modules/socket.io/client-dist/socket.io.min.js generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

1
node_modules/socket.io/client-dist/socket.io.min.js.map generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

7
node_modules/socket.io/client-dist/socket.io.msgpack.min.js generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

1
node_modules/socket.io/client-dist/socket.io.msgpack.min.js.map generated vendored Normal file
View File

File diff suppressed because one or more lines are too long

283
node_modules/socket.io/dist/broadcast-operator.d.ts generated vendored Normal file
View File

@ -0,0 +1,283 @@
import type { BroadcastFlags, Room, SocketId } from "socket.io-adapter";
import { Handshake } from "./socket-types";
import type { Adapter } from "socket.io-adapter";
import type { EventParams, EventNames, EventsMap, TypedEventBroadcaster, DecorateAcknowledgements, AllButLast, Last, FirstNonErrorArg, EventNamesWithError } from "./typed-events";
export declare class BroadcastOperator<EmitEvents extends EventsMap, SocketData> implements TypedEventBroadcaster<EmitEvents> {
private readonly adapter;
private readonly rooms;
private readonly exceptRooms;
private readonly flags;
constructor(adapter: Adapter, rooms?: Set<Room>, exceptRooms?: Set<Room>, flags?: BroadcastFlags & {
expectSingleResponse?: boolean;
});
/**
* Targets a room when emitting.
*
* @example
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* io.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room: Room | Room[]): BroadcastOperator<EmitEvents, SocketData>;
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* // disconnect all clients in the "room-101" room
* io.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room: Room | Room[]): BroadcastOperator<EmitEvents, SocketData>;
/**
* Excludes a room when emitting.
*
* @example
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* io.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* io.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room: Room | Room[]): BroadcastOperator<EmitEvents, SocketData>;
/**
* Sets the compress flag.
*
* @example
* io.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return a new BroadcastOperator instance
*/
compress(compress: boolean): BroadcastOperator<EmitEvents, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.volatile.emit("hello"); // the clients may or may not receive it
*
* @return a new BroadcastOperator instance
*/
get volatile(): BroadcastOperator<EmitEvents, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* // the “foo” event will be broadcast to all connected clients on this node
* io.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local(): BroadcastOperator<EmitEvents, SocketData>;
/**
* Adds a timeout in milliseconds for the next operation
*
* @example
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout: number): BroadcastOperator<DecorateAcknowledgements<EmitEvents>, SocketData>;
/**
* Emits to all clients.
*
* @example
* // the “foo” event will be broadcast to all connected clients
* io.emit("foo", "bar");
*
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an acknowledgement expected from all connected clients
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @return Always true
*/
emit<Ev extends EventNames<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
/**
* Emits an event and waits for an acknowledgement from all clients.
*
* @example
* try {
* const responses = await io.timeout(1000).emitWithAck("some-event");
* console.log(responses); // one response per client
* } catch (e) {
* // some clients did not acknowledge the event in the given delay
* }
*
* @return a Promise that will be fulfilled when all clients have acknowledged the event
*/
emitWithAck<Ev extends EventNamesWithError<EmitEvents>>(ev: Ev, ...args: AllButLast<EventParams<EmitEvents, Ev>>): Promise<FirstNonErrorArg<Last<EventParams<EmitEvents, Ev>>>>;
/**
* Gets a list of clients.
*
* @deprecated this method will be removed in the next major release, please use {@link Server#serverSideEmit} or
* {@link fetchSockets} instead.
*/
allSockets(): Promise<Set<SocketId>>;
/**
* Returns the matching socket instances. This method works across a cluster of several Socket.IO servers.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // return all Socket instances
* const sockets = await io.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await io.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets(): Promise<RemoteSocket<EmitEvents, SocketData>[]>;
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
*
* // make all socket instances join the "room1" room
* io.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* io.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room: Room | Room[]): void;
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances leave the "room1" room
* io.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* io.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room: Room | Room[]): void;
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* io.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* io.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close?: boolean): void;
}
/**
* Format of the data when the Socket instance exists on another Socket.IO server
*/
interface SocketDetails<SocketData> {
id: SocketId;
handshake: Handshake;
rooms: Room[];
data: SocketData;
}
/**
* Expose of subset of the attributes and methods of the Socket class
*/
export declare class RemoteSocket<EmitEvents extends EventsMap, SocketData> implements TypedEventBroadcaster<EmitEvents> {
readonly id: SocketId;
readonly handshake: Handshake;
readonly rooms: Set<Room>;
readonly data: SocketData;
private readonly operator;
constructor(adapter: Adapter, details: SocketDetails<SocketData>);
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* const sockets = await io.fetchSockets();
*
* for (const socket of sockets) {
* if (someCondition) {
* socket.timeout(1000).emit("some-event", (err) => {
* if (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
* }
* }
*
* // note: if possible, using a room instead of looping over all sockets is preferable
* io.timeout(1000).to(someConditionRoom).emit("some-event", (err, responses) => {
* // ...
* });
*
* @param timeout
*/
timeout(timeout: number): BroadcastOperator<DecorateAcknowledgements<EmitEvents>, SocketData>;
emit<Ev extends EventNames<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
/**
* Joins a room.
*
* @param {String|Array} room - room or array of rooms
*/
join(room: Room | Room[]): void;
/**
* Leaves a room.
*
* @param {String} room
*/
leave(room: Room): void;
/**
* Disconnects this client.
*
* @param {Boolean} close - if `true`, closes the underlying connection
* @return {Socket} self
*/
disconnect(close?: boolean): this;
}
export {};

436
node_modules/socket.io/dist/broadcast-operator.js generated vendored Normal file
View File

@ -0,0 +1,436 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.RemoteSocket = exports.BroadcastOperator = void 0;
const socket_types_1 = require("./socket-types");
const socket_io_parser_1 = require("socket.io-parser");
class BroadcastOperator {
constructor(adapter, rooms = new Set(), exceptRooms = new Set(), flags = {}) {
this.adapter = adapter;
this.rooms = rooms;
this.exceptRooms = exceptRooms;
this.flags = flags;
}
/**
* Targets a room when emitting.
*
* @example
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* io.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room) {
const rooms = new Set(this.rooms);
if (Array.isArray(room)) {
room.forEach((r) => rooms.add(r));
}
else {
rooms.add(room);
}
return new BroadcastOperator(this.adapter, rooms, this.exceptRooms, this.flags);
}
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* // disconnect all clients in the "room-101" room
* io.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room) {
return this.to(room);
}
/**
* Excludes a room when emitting.
*
* @example
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* io.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* io.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room) {
const exceptRooms = new Set(this.exceptRooms);
if (Array.isArray(room)) {
room.forEach((r) => exceptRooms.add(r));
}
else {
exceptRooms.add(room);
}
return new BroadcastOperator(this.adapter, this.rooms, exceptRooms, this.flags);
}
/**
* Sets the compress flag.
*
* @example
* io.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return a new BroadcastOperator instance
*/
compress(compress) {
const flags = Object.assign({}, this.flags, { compress });
return new BroadcastOperator(this.adapter, this.rooms, this.exceptRooms, flags);
}
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.volatile.emit("hello"); // the clients may or may not receive it
*
* @return a new BroadcastOperator instance
*/
get volatile() {
const flags = Object.assign({}, this.flags, { volatile: true });
return new BroadcastOperator(this.adapter, this.rooms, this.exceptRooms, flags);
}
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* // the “foo” event will be broadcast to all connected clients on this node
* io.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local() {
const flags = Object.assign({}, this.flags, { local: true });
return new BroadcastOperator(this.adapter, this.rooms, this.exceptRooms, flags);
}
/**
* Adds a timeout in milliseconds for the next operation
*
* @example
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout) {
const flags = Object.assign({}, this.flags, { timeout });
return new BroadcastOperator(this.adapter, this.rooms, this.exceptRooms, flags);
}
/**
* Emits to all clients.
*
* @example
* // the “foo” event will be broadcast to all connected clients
* io.emit("foo", "bar");
*
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an acknowledgement expected from all connected clients
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @return Always true
*/
emit(ev, ...args) {
if (socket_types_1.RESERVED_EVENTS.has(ev)) {
throw new Error(`"${String(ev)}" is a reserved event name`);
}
// set up packet object
const data = [ev, ...args];
const packet = {
type: socket_io_parser_1.PacketType.EVENT,
data: data,
};
const withAck = typeof data[data.length - 1] === "function";
if (!withAck) {
this.adapter.broadcast(packet, {
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
});
return true;
}
const ack = data.pop();
let timedOut = false;
let responses = [];
const timer = setTimeout(() => {
timedOut = true;
ack.apply(this, [
new Error("operation has timed out"),
this.flags.expectSingleResponse ? null : responses,
]);
}, this.flags.timeout);
let expectedServerCount = -1;
let actualServerCount = 0;
let expectedClientCount = 0;
const checkCompleteness = () => {
if (!timedOut &&
expectedServerCount === actualServerCount &&
responses.length === expectedClientCount) {
clearTimeout(timer);
ack.apply(this, [
null,
this.flags.expectSingleResponse ? responses[0] : responses,
]);
}
};
this.adapter.broadcastWithAck(packet, {
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
}, (clientCount) => {
// each Socket.IO server in the cluster sends the number of clients that were notified
expectedClientCount += clientCount;
actualServerCount++;
checkCompleteness();
}, (clientResponse) => {
// each client sends an acknowledgement
responses.push(clientResponse);
checkCompleteness();
});
this.adapter.serverCount().then((serverCount) => {
expectedServerCount = serverCount;
checkCompleteness();
});
return true;
}
/**
* Emits an event and waits for an acknowledgement from all clients.
*
* @example
* try {
* const responses = await io.timeout(1000).emitWithAck("some-event");
* console.log(responses); // one response per client
* } catch (e) {
* // some clients did not acknowledge the event in the given delay
* }
*
* @return a Promise that will be fulfilled when all clients have acknowledged the event
*/
emitWithAck(ev, ...args) {
return new Promise((resolve, reject) => {
args.push((err, responses) => {
if (err) {
err.responses = responses;
return reject(err);
}
else {
return resolve(responses);
}
});
this.emit(ev, ...args);
});
}
/**
* Gets a list of clients.
*
* @deprecated this method will be removed in the next major release, please use {@link Server#serverSideEmit} or
* {@link fetchSockets} instead.
*/
allSockets() {
if (!this.adapter) {
throw new Error("No adapter for this namespace, are you trying to get the list of clients of a dynamic namespace?");
}
return this.adapter.sockets(this.rooms);
}
/**
* Returns the matching socket instances. This method works across a cluster of several Socket.IO servers.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // return all Socket instances
* const sockets = await io.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await io.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets() {
return this.adapter
.fetchSockets({
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
})
.then((sockets) => {
return sockets.map((socket) => {
if (socket.server) {
return socket; // local instance
}
else {
return new RemoteSocket(this.adapter, socket);
}
});
});
}
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
*
* // make all socket instances join the "room1" room
* io.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* io.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room) {
this.adapter.addSockets({
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
}, Array.isArray(room) ? room : [room]);
}
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances leave the "room1" room
* io.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* io.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room) {
this.adapter.delSockets({
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
}, Array.isArray(room) ? room : [room]);
}
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* io.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* io.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close = false) {
this.adapter.disconnectSockets({
rooms: this.rooms,
except: this.exceptRooms,
flags: this.flags,
}, close);
}
}
exports.BroadcastOperator = BroadcastOperator;
/**
* Expose of subset of the attributes and methods of the Socket class
*/
class RemoteSocket {
constructor(adapter, details) {
this.id = details.id;
this.handshake = details.handshake;
this.rooms = new Set(details.rooms);
this.data = details.data;
this.operator = new BroadcastOperator(adapter, new Set([this.id]), new Set(), {
expectSingleResponse: true, // so that remoteSocket.emit() with acknowledgement behaves like socket.emit()
});
}
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* const sockets = await io.fetchSockets();
*
* for (const socket of sockets) {
* if (someCondition) {
* socket.timeout(1000).emit("some-event", (err) => {
* if (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
* }
* }
*
* // note: if possible, using a room instead of looping over all sockets is preferable
* io.timeout(1000).to(someConditionRoom).emit("some-event", (err, responses) => {
* // ...
* });
*
* @param timeout
*/
timeout(timeout) {
return this.operator.timeout(timeout);
}
emit(ev, ...args) {
return this.operator.emit(ev, ...args);
}
/**
* Joins a room.
*
* @param {String|Array} room - room or array of rooms
*/
join(room) {
return this.operator.socketsJoin(room);
}
/**
* Leaves a room.
*
* @param {String} room
*/
leave(room) {
return this.operator.socketsLeave(room);
}
/**
* Disconnects this client.
*
* @param {Boolean} close - if `true`, closes the underlying connection
* @return {Socket} self
*/
disconnect(close = false) {
this.operator.disconnectSockets(close);
return this;
}
}
exports.RemoteSocket = RemoteSocket;

119
node_modules/socket.io/dist/client.d.ts generated vendored Normal file
View File

@ -0,0 +1,119 @@
import { Packet } from "socket.io-parser";
import type { IncomingMessage } from "http";
import type { Server } from "./index";
import type { EventsMap } from "./typed-events";
import type { Socket } from "./socket";
import type { Socket as RawSocket } from "engine.io";
interface WriteOptions {
compress?: boolean;
volatile?: boolean;
preEncoded?: boolean;
wsPreEncoded?: string;
}
export declare class Client<ListenEvents extends EventsMap, EmitEvents extends EventsMap, ServerSideEvents extends EventsMap, SocketData = any> {
readonly conn: RawSocket;
private readonly id;
private readonly server;
private readonly encoder;
private readonly decoder;
private sockets;
private nsps;
private connectTimeout?;
/**
* Client constructor.
*
* @param server instance
* @param conn
* @package
*/
constructor(server: Server<ListenEvents, EmitEvents, ServerSideEvents, SocketData>, conn: any);
/**
* @return the reference to the request that originated the Engine.IO connection
*
* @public
*/
get request(): IncomingMessage;
/**
* Sets up event listeners.
*
* @private
*/
private setup;
/**
* Connects a client to a namespace.
*
* @param {String} name - the namespace
* @param {Object} auth - the auth parameters
* @private
*/
private connect;
/**
* Connects a client to a namespace.
*
* @param name - the namespace
* @param {Object} auth - the auth parameters
*
* @private
*/
private doConnect;
/**
* Disconnects from all namespaces and closes transport.
*
* @private
*/
_disconnect(): void;
/**
* Removes a socket. Called by each `Socket`.
*
* @private
*/
_remove(socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>): void;
/**
* Closes the underlying connection.
*
* @private
*/
private close;
/**
* Writes a packet to the transport.
*
* @param {Object} packet object
* @param {Object} opts
* @private
*/
_packet(packet: Packet | any[], opts?: WriteOptions): void;
private writeToEngine;
/**
* Called with incoming transport data.
*
* @private
*/
private ondata;
/**
* Called when parser fully decodes a packet.
*
* @private
*/
private ondecoded;
/**
* Handles an error.
*
* @param {Object} err object
* @private
*/
private onerror;
/**
* Called upon transport close.
*
* @param reason
* @param description
* @private
*/
private onclose;
/**
* Cleans up event listeners.
* @private
*/
private destroy;
}
export {};

268
node_modules/socket.io/dist/client.js generated vendored Normal file
View File

@ -0,0 +1,268 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.Client = void 0;
const socket_io_parser_1 = require("socket.io-parser");
const debugModule = require("debug");
const url = require("url");
const debug = debugModule("socket.io:client");
class Client {
/**
* Client constructor.
*
* @param server instance
* @param conn
* @package
*/
constructor(server, conn) {
this.sockets = new Map();
this.nsps = new Map();
this.server = server;
this.conn = conn;
this.encoder = server.encoder;
this.decoder = new server._parser.Decoder();
this.id = conn.id;
this.setup();
}
/**
* @return the reference to the request that originated the Engine.IO connection
*
* @public
*/
get request() {
return this.conn.request;
}
/**
* Sets up event listeners.
*
* @private
*/
setup() {
this.onclose = this.onclose.bind(this);
this.ondata = this.ondata.bind(this);
this.onerror = this.onerror.bind(this);
this.ondecoded = this.ondecoded.bind(this);
// @ts-ignore
this.decoder.on("decoded", this.ondecoded);
this.conn.on("data", this.ondata);
this.conn.on("error", this.onerror);
this.conn.on("close", this.onclose);
this.connectTimeout = setTimeout(() => {
if (this.nsps.size === 0) {
debug("no namespace joined yet, close the client");
this.close();
}
else {
debug("the client has already joined a namespace, nothing to do");
}
}, this.server._connectTimeout);
}
/**
* Connects a client to a namespace.
*
* @param {String} name - the namespace
* @param {Object} auth - the auth parameters
* @private
*/
connect(name, auth = {}) {
if (this.server._nsps.has(name)) {
debug("connecting to namespace %s", name);
return this.doConnect(name, auth);
}
this.server._checkNamespace(name, auth, (dynamicNspName) => {
if (dynamicNspName) {
this.doConnect(name, auth);
}
else {
debug("creation of namespace %s was denied", name);
this._packet({
type: socket_io_parser_1.PacketType.CONNECT_ERROR,
nsp: name,
data: {
message: "Invalid namespace",
},
});
}
});
}
/**
* Connects a client to a namespace.
*
* @param name - the namespace
* @param {Object} auth - the auth parameters
*
* @private
*/
doConnect(name, auth) {
const nsp = this.server.of(name);
nsp._add(this, auth, (socket) => {
this.sockets.set(socket.id, socket);
this.nsps.set(nsp.name, socket);
if (this.connectTimeout) {
clearTimeout(this.connectTimeout);
this.connectTimeout = undefined;
}
});
}
/**
* Disconnects from all namespaces and closes transport.
*
* @private
*/
_disconnect() {
for (const socket of this.sockets.values()) {
socket.disconnect();
}
this.sockets.clear();
this.close();
}
/**
* Removes a socket. Called by each `Socket`.
*
* @private
*/
_remove(socket) {
if (this.sockets.has(socket.id)) {
const nsp = this.sockets.get(socket.id).nsp.name;
this.sockets.delete(socket.id);
this.nsps.delete(nsp);
}
else {
debug("ignoring remove for %s", socket.id);
}
}
/**
* Closes the underlying connection.
*
* @private
*/
close() {
if ("open" === this.conn.readyState) {
debug("forcing transport close");
this.conn.close();
this.onclose("forced server close");
}
}
/**
* Writes a packet to the transport.
*
* @param {Object} packet object
* @param {Object} opts
* @private
*/
_packet(packet, opts = {}) {
if (this.conn.readyState !== "open") {
debug("ignoring packet write %j", packet);
return;
}
const encodedPackets = opts.preEncoded
? packet // previous versions of the adapter incorrectly used socket.packet() instead of writeToEngine()
: this.encoder.encode(packet);
this.writeToEngine(encodedPackets, opts);
}
writeToEngine(encodedPackets, opts) {
if (opts.volatile && !this.conn.transport.writable) {
debug("volatile packet is discarded since the transport is not currently writable");
return;
}
const packets = Array.isArray(encodedPackets)
? encodedPackets
: [encodedPackets];
for (const encodedPacket of packets) {
this.conn.write(encodedPacket, opts);
}
}
/**
* Called with incoming transport data.
*
* @private
*/
ondata(data) {
// try/catch is needed for protocol violations (GH-1880)
try {
this.decoder.add(data);
}
catch (e) {
debug("invalid packet format");
this.onerror(e);
}
}
/**
* Called when parser fully decodes a packet.
*
* @private
*/
ondecoded(packet) {
let namespace;
let authPayload;
if (this.conn.protocol === 3) {
const parsed = url.parse(packet.nsp, true);
namespace = parsed.pathname;
authPayload = parsed.query;
}
else {
namespace = packet.nsp;
authPayload = packet.data;
}
const socket = this.nsps.get(namespace);
if (!socket && packet.type === socket_io_parser_1.PacketType.CONNECT) {
this.connect(namespace, authPayload);
}
else if (socket &&
packet.type !== socket_io_parser_1.PacketType.CONNECT &&
packet.type !== socket_io_parser_1.PacketType.CONNECT_ERROR) {
process.nextTick(function () {
socket._onpacket(packet);
});
}
else {
debug("invalid state (packet type: %s)", packet.type);
this.close();
}
}
/**
* Handles an error.
*
* @param {Object} err object
* @private
*/
onerror(err) {
for (const socket of this.sockets.values()) {
socket._onerror(err);
}
this.conn.close();
}
/**
* Called upon transport close.
*
* @param reason
* @param description
* @private
*/
onclose(reason, description) {
debug("client close with reason %s", reason);
// ignore a potential subsequent `close` event
this.destroy();
// `nsps` and `sockets` are cleaned up seamlessly
for (const socket of this.sockets.values()) {
socket._onclose(reason, description);
}
this.sockets.clear();
this.decoder.destroy(); // clean up decoder
}
/**
* Cleans up event listeners.
* @private
*/
destroy() {
this.conn.removeListener("data", this.ondata);
this.conn.removeListener("error", this.onerror);
this.conn.removeListener("close", this.onclose);
// @ts-ignore
this.decoder.removeListener("decoded", this.ondecoded);
if (this.connectTimeout) {
clearTimeout(this.connectTimeout);
this.connectTimeout = undefined;
}
}
}
exports.Client = Client;

593
node_modules/socket.io/dist/index.d.ts generated vendored Normal file
View File

@ -0,0 +1,593 @@
import http = require("http");
import type { Server as HTTPSServer } from "https";
import type { Http2SecureServer, Http2Server } from "http2";
import { Server as Engine } from "engine.io";
import type { ServerOptions as EngineOptions, AttachOptions } from "engine.io";
import { ExtendedError, Namespace, ServerReservedEventsMap } from "./namespace";
import { Adapter, Room, SocketId } from "socket.io-adapter";
import * as parser from "socket.io-parser";
import type { Encoder } from "socket.io-parser";
import { Socket } from "./socket";
import { DisconnectReason } from "./socket-types";
import type { BroadcastOperator, RemoteSocket } from "./broadcast-operator";
import { EventsMap, DefaultEventsMap, EventParams, StrictEventEmitter, EventNames, DecorateAcknowledgementsWithTimeoutAndMultipleResponses, AllButLast, Last, RemoveAcknowledgements, EventNamesWithAck, FirstNonErrorArg } from "./typed-events";
type ParentNspNameMatchFn = (name: string, auth: {
[key: string]: any;
}, fn: (err: Error | null, success: boolean) => void) => void;
type AdapterConstructor = typeof Adapter | ((nsp: Namespace) => Adapter);
type TServerInstance = http.Server | HTTPSServer | Http2SecureServer | Http2Server;
interface ServerOptions extends EngineOptions, AttachOptions {
/**
* name of the path to capture
* @default "/socket.io"
*/
path: string;
/**
* whether to serve the client files
* @default true
*/
serveClient: boolean;
/**
* the adapter to use
* @default the in-memory adapter (https://github.com/socketio/socket.io-adapter)
*/
adapter: AdapterConstructor;
/**
* the parser to use
* @default the default parser (https://github.com/socketio/socket.io-parser)
*/
parser: any;
/**
* how many ms before a client without namespace is closed
* @default 45000
*/
connectTimeout: number;
/**
* Whether to enable the recovery of connection state when a client temporarily disconnects.
*
* The connection state includes the missed packets, the rooms the socket was in and the `data` attribute.
*/
connectionStateRecovery: {
/**
* The backup duration of the sessions and the packets.
*
* @default 120000 (2 minutes)
*/
maxDisconnectionDuration?: number;
/**
* Whether to skip middlewares upon successful connection state recovery.
*
* @default true
*/
skipMiddlewares?: boolean;
};
/**
* Whether to remove child namespaces that have no sockets connected to them
* @default false
*/
cleanupEmptyChildNamespaces: boolean;
}
/**
* Represents a Socket.IO server.
*
* @example
* import { Server } from "socket.io";
*
* const io = new Server();
*
* io.on("connection", (socket) => {
* console.log(`socket ${socket.id} connected`);
*
* // send an event to the client
* socket.emit("foo", "bar");
*
* socket.on("foobar", () => {
* // an event was received from the client
* });
*
* // upon disconnection
* socket.on("disconnect", (reason) => {
* console.log(`socket ${socket.id} disconnected due to ${reason}`);
* });
* });
*
* io.listen(3000);
*/
export declare class Server<
/**
* Types for the events received from the clients.
*
* @example
* interface ClientToServerEvents {
* hello: (arg: string) => void;
* }
*
* const io = new Server<ClientToServerEvents>();
*
* io.on("connection", (socket) => {
* socket.on("hello", (arg) => {
* // `arg` is inferred as string
* });
* });
*/
ListenEvents extends EventsMap = DefaultEventsMap,
/**
* Types for the events sent to the clients.
*
* @example
* interface ServerToClientEvents {
* hello: (arg: string) => void;
* }
*
* const io = new Server<DefaultEventMap, ServerToClientEvents>();
*
* io.emit("hello", "world");
*/
EmitEvents extends EventsMap = ListenEvents,
/**
* Types for the events received from and sent to the other servers.
*
* @example
* interface InterServerEvents {
* ping: (arg: number) => void;
* }
*
* const io = new Server<DefaultEventMap, DefaultEventMap, ServerToClientEvents>();
*
* io.serverSideEmit("ping", 123);
*
* io.on("ping", (arg) => {
* // `arg` is inferred as number
* });
*/
ServerSideEvents extends EventsMap = DefaultEventsMap,
/**
* Additional properties that can be attached to the socket instance.
*
* Note: any property can be attached directly to the socket instance (`socket.foo = "bar"`), but the `data` object
* will be included when calling {@link Server#fetchSockets}.
*
* @example
* io.on("connection", (socket) => {
* socket.data.eventsCount = 0;
*
* socket.onAny(() => {
* socket.data.eventsCount++;
* });
* });
*/
SocketData = any> extends StrictEventEmitter<ServerSideEvents, RemoveAcknowledgements<EmitEvents>, ServerReservedEventsMap<ListenEvents, EmitEvents, ServerSideEvents, SocketData>> {
readonly sockets: Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData>;
/**
* A reference to the underlying Engine.IO server.
*
* @example
* const clientsCount = io.engine.clientsCount;
*
*/
engine: Engine;
/**
* The underlying Node.js HTTP server.
*
* @see https://nodejs.org/api/http.html
*/
httpServer: TServerInstance;
/** @private */
readonly _parser: typeof parser;
/** @private */
readonly encoder: Encoder;
/**
* @private
*/
_nsps: Map<string, Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData>>;
private parentNsps;
/**
* A subset of the {@link parentNsps} map, only containing {@link ParentNamespace} which are based on a regular
* expression.
*
* @private
*/
private parentNamespacesFromRegExp;
private _adapter?;
private _serveClient;
private readonly opts;
private eio;
private _path;
private clientPathRegex;
/**
* @private
*/
_connectTimeout: number;
private _corsMiddleware;
/**
* Server constructor.
*
* @param srv http server, port, or options
* @param [opts]
*/
constructor(opts?: Partial<ServerOptions>);
constructor(srv?: TServerInstance | number, opts?: Partial<ServerOptions>);
constructor(srv: undefined | Partial<ServerOptions> | TServerInstance | number, opts?: Partial<ServerOptions>);
get _opts(): Partial<ServerOptions>;
/**
* Sets/gets whether client code is being served.
*
* @param v - whether to serve client code
* @return self when setting or value when getting
*/
serveClient(v: boolean): this;
serveClient(): boolean;
serveClient(v?: boolean): this | boolean;
/**
* Executes the middleware for an incoming namespace not already created on the server.
*
* @param name - name of incoming namespace
* @param auth - the auth parameters
* @param fn - callback
*
* @private
*/
_checkNamespace(name: string, auth: {
[key: string]: any;
}, fn: (nsp: Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData> | false) => void): void;
/**
* Sets the client serving path.
*
* @param {String} v pathname
* @return {Server|String} self when setting or value when getting
*/
path(v: string): this;
path(): string;
path(v?: string): this | string;
/**
* Set the delay after which a client without namespace is closed
* @param v
*/
connectTimeout(v: number): this;
connectTimeout(): number;
connectTimeout(v?: number): this | number;
/**
* Sets the adapter for rooms.
*
* @param v pathname
* @return self when setting or value when getting
*/
adapter(): AdapterConstructor | undefined;
adapter(v: AdapterConstructor): this;
/**
* Attaches socket.io to a server or port.
*
* @param srv - server or port
* @param opts - options passed to engine.io
* @return self
*/
listen(srv: TServerInstance | number, opts?: Partial<ServerOptions>): this;
/**
* Attaches socket.io to a server or port.
*
* @param srv - server or port
* @param opts - options passed to engine.io
* @return self
*/
attach(srv: TServerInstance | number, opts?: Partial<ServerOptions>): this;
attachApp(app: any, opts?: Partial<ServerOptions>): void;
/**
* Initialize engine
*
* @param srv - the server to attach to
* @param opts - options passed to engine.io
* @private
*/
private initEngine;
/**
* Attaches the static file serving.
*
* @param srv http server
* @private
*/
private attachServe;
/**
* Handles a request serving of client source and map
*
* @param req
* @param res
* @private
*/
private serve;
/**
* @param filename
* @param req
* @param res
* @private
*/
private static sendFile;
/**
* Binds socket.io to an engine.io instance.
*
* @param engine engine.io (or compatible) server
* @return self
*/
bind(engine: any): this;
/**
* Called with each incoming transport connection.
*
* @param {engine.Socket} conn
* @return self
* @private
*/
private onconnection;
/**
* Looks up a namespace.
*
* @example
* // with a simple string
* const myNamespace = io.of("/my-namespace");
*
* // with a regex
* const dynamicNsp = io.of(/^\/dynamic-\d+$/).on("connection", (socket) => {
* const namespace = socket.nsp; // newNamespace.name === "/dynamic-101"
*
* // broadcast to all clients in the given sub-namespace
* namespace.emit("hello");
* });
*
* @param name - nsp name
* @param fn optional, nsp `connection` ev handler
*/
of(name: string | RegExp | ParentNspNameMatchFn, fn?: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>) => void): Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData>;
/**
* Closes server connection
*
* @param [fn] optional, called as `fn([err])` on error OR all conns closed
*/
close(fn?: (err?: Error) => void): Promise<void>;
/**
* Registers a middleware, which is a function that gets executed for every incoming {@link Socket}.
*
* @example
* io.use((socket, next) => {
* // ...
* next();
* });
*
* @param fn - the middleware function
*/
use(fn: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>, next: (err?: ExtendedError) => void) => void): this;
/**
* Targets a room when emitting.
*
* @example
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* io.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room: Room | Room[]): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* // disconnect all clients in the "room-101" room
* io.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room: Room | Room[]): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Excludes a room when emitting.
*
* @example
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* io.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* io.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room: Room | Room[]): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sends a `message` event to all clients.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* io.send("hello");
*
* // this is equivalent to
* io.emit("message", "hello");
*
* @return self
*/
send(...args: EventParams<EmitEvents, "message">): this;
/**
* Sends a `message` event to all clients. Alias of {@link send}.
*
* @return self
*/
write(...args: EventParams<EmitEvents, "message">): this;
/**
* Sends a message to the other Socket.IO servers of the cluster.
*
* @example
* io.serverSideEmit("hello", "world");
*
* io.on("hello", (arg1) => {
* console.log(arg1); // prints "world"
* });
*
* // acknowledgements (without binary content) are supported too:
* io.serverSideEmit("ping", (err, responses) => {
* if (err) {
* // some servers did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per server (except the current one)
* }
* });
*
* io.on("ping", (cb) => {
* cb("pong");
* });
*
* @param ev - the event name
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*/
serverSideEmit<Ev extends EventNames<ServerSideEvents>>(ev: Ev, ...args: EventParams<DecorateAcknowledgementsWithTimeoutAndMultipleResponses<ServerSideEvents>, Ev>): boolean;
/**
* Sends a message and expect an acknowledgement from the other Socket.IO servers of the cluster.
*
* @example
* try {
* const responses = await io.serverSideEmitWithAck("ping");
* console.log(responses); // one response per server (except the current one)
* } catch (e) {
* // some servers did not acknowledge the event in the given delay
* }
*
* @param ev - the event name
* @param args - an array of arguments
*
* @return a Promise that will be fulfilled when all servers have acknowledged the event
*/
serverSideEmitWithAck<Ev extends EventNamesWithAck<ServerSideEvents>>(ev: Ev, ...args: AllButLast<EventParams<ServerSideEvents, Ev>>): Promise<FirstNonErrorArg<Last<EventParams<ServerSideEvents, Ev>>>[]>;
/**
* Gets a list of socket ids.
*
* @deprecated this method will be removed in the next major release, please use {@link Server#serverSideEmit} or
* {@link Server#fetchSockets} instead.
*/
allSockets(): Promise<Set<SocketId>>;
/**
* Sets the compress flag.
*
* @example
* io.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return a new {@link BroadcastOperator} instance for chaining
*/
compress(compress: boolean): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.volatile.emit("hello"); // the clients may or may not receive it
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get volatile(): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* // the “foo” event will be broadcast to all connected clients on this node
* io.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local(): BroadcastOperator<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout: number): BroadcastOperator<import("./typed-events").DecorateAcknowledgements<import("./typed-events").DecorateAcknowledgementsWithMultipleResponses<EmitEvents>>, SocketData>;
/**
* Returns the matching socket instances.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // return all Socket instances
* const sockets = await io.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await io.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets(): Promise<RemoteSocket<EmitEvents, SocketData>[]>;
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
*
* // make all socket instances join the "room1" room
* io.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* io.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room: Room | Room[]): void;
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances leave the "room1" room
* io.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* io.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room: Room | Room[]): void;
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* io.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* io.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close?: boolean): void;
}
export { Socket, DisconnectReason, ServerOptions, Namespace, BroadcastOperator, RemoteSocket, DefaultEventsMap, ExtendedError, };
export { Event } from "./socket";

804
node_modules/socket.io/dist/index.js generated vendored Normal file
View File

@ -0,0 +1,804 @@
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
var desc = Object.getOwnPropertyDescriptor(m, k);
if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) {
desc = { enumerable: true, get: function() { return m[k]; } };
}
Object.defineProperty(o, k2, desc);
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", { value: true });
exports.Namespace = exports.Socket = exports.Server = void 0;
const http = require("http");
const fs_1 = require("fs");
const zlib_1 = require("zlib");
const accepts = require("accepts");
const stream_1 = require("stream");
const path = require("path");
const engine_io_1 = require("engine.io");
const client_1 = require("./client");
const events_1 = require("events");
const namespace_1 = require("./namespace");
Object.defineProperty(exports, "Namespace", { enumerable: true, get: function () { return namespace_1.Namespace; } });
const parent_namespace_1 = require("./parent-namespace");
const socket_io_adapter_1 = require("socket.io-adapter");
const parser = __importStar(require("socket.io-parser"));
const debug_1 = __importDefault(require("debug"));
const socket_1 = require("./socket");
Object.defineProperty(exports, "Socket", { enumerable: true, get: function () { return socket_1.Socket; } });
const typed_events_1 = require("./typed-events");
const uws_1 = require("./uws");
const cors_1 = __importDefault(require("cors"));
const debug = (0, debug_1.default)("socket.io:server");
const clientVersion = require("../package.json").version;
const dotMapRegex = /\.map/;
/**
* Represents a Socket.IO server.
*
* @example
* import { Server } from "socket.io";
*
* const io = new Server();
*
* io.on("connection", (socket) => {
* console.log(`socket ${socket.id} connected`);
*
* // send an event to the client
* socket.emit("foo", "bar");
*
* socket.on("foobar", () => {
* // an event was received from the client
* });
*
* // upon disconnection
* socket.on("disconnect", (reason) => {
* console.log(`socket ${socket.id} disconnected due to ${reason}`);
* });
* });
*
* io.listen(3000);
*/
class Server extends typed_events_1.StrictEventEmitter {
constructor(srv, opts = {}) {
super();
/**
* @private
*/
this._nsps = new Map();
this.parentNsps = new Map();
/**
* A subset of the {@link parentNsps} map, only containing {@link ParentNamespace} which are based on a regular
* expression.
*
* @private
*/
this.parentNamespacesFromRegExp = new Map();
if ("object" === typeof srv &&
srv instanceof Object &&
!srv.listen) {
opts = srv;
srv = undefined;
}
this.path(opts.path || "/socket.io");
this.connectTimeout(opts.connectTimeout || 45000);
this.serveClient(false !== opts.serveClient);
this._parser = opts.parser || parser;
this.encoder = new this._parser.Encoder();
this.opts = opts;
if (opts.connectionStateRecovery) {
opts.connectionStateRecovery = Object.assign({
maxDisconnectionDuration: 2 * 60 * 1000,
skipMiddlewares: true,
}, opts.connectionStateRecovery);
this.adapter(opts.adapter || socket_io_adapter_1.SessionAwareAdapter);
}
else {
this.adapter(opts.adapter || socket_io_adapter_1.Adapter);
}
opts.cleanupEmptyChildNamespaces = !!opts.cleanupEmptyChildNamespaces;
this.sockets = this.of("/");
if (srv || typeof srv == "number")
this.attach(srv);
if (this.opts.cors) {
this._corsMiddleware = (0, cors_1.default)(this.opts.cors);
}
}
get _opts() {
return this.opts;
}
serveClient(v) {
if (!arguments.length)
return this._serveClient;
this._serveClient = v;
return this;
}
/**
* Executes the middleware for an incoming namespace not already created on the server.
*
* @param name - name of incoming namespace
* @param auth - the auth parameters
* @param fn - callback
*
* @private
*/
_checkNamespace(name, auth, fn) {
if (this.parentNsps.size === 0)
return fn(false);
const keysIterator = this.parentNsps.keys();
const run = () => {
const nextFn = keysIterator.next();
if (nextFn.done) {
return fn(false);
}
nextFn.value(name, auth, (err, allow) => {
if (err || !allow) {
return run();
}
if (this._nsps.has(name)) {
// the namespace was created in the meantime
debug("dynamic namespace %s already exists", name);
return fn(this._nsps.get(name));
}
const namespace = this.parentNsps.get(nextFn.value).createChild(name);
debug("dynamic namespace %s was created", name);
fn(namespace);
});
};
run();
}
path(v) {
if (!arguments.length)
return this._path;
this._path = v.replace(/\/$/, "");
const escapedPath = this._path.replace(/[-\/\\^$*+?.()|[\]{}]/g, "\\$&");
this.clientPathRegex = new RegExp("^" +
escapedPath +
"/socket\\.io(\\.msgpack|\\.esm)?(\\.min)?\\.js(\\.map)?(?:\\?|$)");
return this;
}
connectTimeout(v) {
if (v === undefined)
return this._connectTimeout;
this._connectTimeout = v;
return this;
}
adapter(v) {
if (!arguments.length)
return this._adapter;
this._adapter = v;
for (const nsp of this._nsps.values()) {
nsp._initAdapter();
}
return this;
}
/**
* Attaches socket.io to a server or port.
*
* @param srv - server or port
* @param opts - options passed to engine.io
* @return self
*/
listen(srv, opts = {}) {
return this.attach(srv, opts);
}
/**
* Attaches socket.io to a server or port.
*
* @param srv - server or port
* @param opts - options passed to engine.io
* @return self
*/
attach(srv, opts = {}) {
if ("function" == typeof srv) {
const msg = "You are trying to attach socket.io to an express " +
"request handler function. Please pass a http.Server instance.";
throw new Error(msg);
}
// handle a port as a string
if (Number(srv) == srv) {
srv = Number(srv);
}
if ("number" == typeof srv) {
debug("creating http server and binding to %d", srv);
const port = srv;
srv = http.createServer((req, res) => {
res.writeHead(404);
res.end();
});
srv.listen(port);
}
// merge the options passed to the Socket.IO server
Object.assign(opts, this.opts);
// set engine.io path to `/socket.io`
opts.path = opts.path || this._path;
this.initEngine(srv, opts);
return this;
}
attachApp(app /*: TemplatedApp */, opts = {}) {
// merge the options passed to the Socket.IO server
Object.assign(opts, this.opts);
// set engine.io path to `/socket.io`
opts.path = opts.path || this._path;
// initialize engine
debug("creating uWebSockets.js-based engine with opts %j", opts);
const engine = new engine_io_1.uServer(opts);
engine.attach(app, opts);
// bind to engine events
this.bind(engine);
if (this._serveClient) {
// attach static file serving
app.get(`${this._path}/*`, (res, req) => {
if (!this.clientPathRegex.test(req.getUrl())) {
req.setYield(true);
return;
}
const filename = req
.getUrl()
.replace(this._path, "")
.replace(/\?.*$/, "")
.replace(/^\//, "");
const isMap = dotMapRegex.test(filename);
const type = isMap ? "map" : "source";
// Per the standard, ETags must be quoted:
// https://tools.ietf.org/html/rfc7232#section-2.3
const expectedEtag = '"' + clientVersion + '"';
const weakEtag = "W/" + expectedEtag;
const etag = req.getHeader("if-none-match");
if (etag) {
if (expectedEtag === etag || weakEtag === etag) {
debug("serve client %s 304", type);
res.writeStatus("304 Not Modified");
res.end();
return;
}
}
debug("serve client %s", type);
res.writeHeader("cache-control", "public, max-age=0");
res.writeHeader("content-type", "application/" + (isMap ? "json" : "javascript") + "; charset=utf-8");
res.writeHeader("etag", expectedEtag);
const filepath = path.join(__dirname, "../client-dist/", filename);
(0, uws_1.serveFile)(res, filepath);
});
}
(0, uws_1.patchAdapter)(app);
}
/**
* Initialize engine
*
* @param srv - the server to attach to
* @param opts - options passed to engine.io
* @private
*/
initEngine(srv, opts) {
// initialize engine
debug("creating engine.io instance with opts %j", opts);
this.eio = (0, engine_io_1.attach)(srv, opts);
// attach static file serving
if (this._serveClient)
this.attachServe(srv);
// Export http server
this.httpServer = srv;
// bind to engine events
this.bind(this.eio);
}
/**
* Attaches the static file serving.
*
* @param srv http server
* @private
*/
attachServe(srv) {
debug("attaching client serving req handler");
const evs = srv.listeners("request").slice(0);
srv.removeAllListeners("request");
srv.on("request", (req, res) => {
if (this.clientPathRegex.test(req.url)) {
if (this._corsMiddleware) {
this._corsMiddleware(req, res, () => {
this.serve(req, res);
});
}
else {
this.serve(req, res);
}
}
else {
for (let i = 0; i < evs.length; i++) {
evs[i].call(srv, req, res);
}
}
});
}
/**
* Handles a request serving of client source and map
*
* @param req
* @param res
* @private
*/
serve(req, res) {
const filename = req.url.replace(this._path, "").replace(/\?.*$/, "");
const isMap = dotMapRegex.test(filename);
const type = isMap ? "map" : "source";
// Per the standard, ETags must be quoted:
// https://tools.ietf.org/html/rfc7232#section-2.3
const expectedEtag = '"' + clientVersion + '"';
const weakEtag = "W/" + expectedEtag;
const etag = req.headers["if-none-match"];
if (etag) {
if (expectedEtag === etag || weakEtag === etag) {
debug("serve client %s 304", type);
res.writeHead(304);
res.end();
return;
}
}
debug("serve client %s", type);
res.setHeader("Cache-Control", "public, max-age=0");
res.setHeader("Content-Type", "application/" + (isMap ? "json" : "javascript") + "; charset=utf-8");
res.setHeader("ETag", expectedEtag);
Server.sendFile(filename, req, res);
}
/**
* @param filename
* @param req
* @param res
* @private
*/
static sendFile(filename, req, res) {
const readStream = (0, fs_1.createReadStream)(path.join(__dirname, "../client-dist/", filename));
const encoding = accepts(req).encodings(["br", "gzip", "deflate"]);
const onError = (err) => {
if (err) {
res.end();
}
};
switch (encoding) {
case "br":
res.writeHead(200, { "content-encoding": "br" });
(0, stream_1.pipeline)(readStream, (0, zlib_1.createBrotliCompress)(), res, onError);
break;
case "gzip":
res.writeHead(200, { "content-encoding": "gzip" });
(0, stream_1.pipeline)(readStream, (0, zlib_1.createGzip)(), res, onError);
break;
case "deflate":
res.writeHead(200, { "content-encoding": "deflate" });
(0, stream_1.pipeline)(readStream, (0, zlib_1.createDeflate)(), res, onError);
break;
default:
res.writeHead(200);
(0, stream_1.pipeline)(readStream, res, onError);
}
}
/**
* Binds socket.io to an engine.io instance.
*
* @param engine engine.io (or compatible) server
* @return self
*/
bind(engine) {
// TODO apply strict types to the engine: "connection" event, `close()` and a method to serve static content
// this would allow to provide any custom engine, like one based on Deno or Bun built-in HTTP server
this.engine = engine;
this.engine.on("connection", this.onconnection.bind(this));
return this;
}
/**
* Called with each incoming transport connection.
*
* @param {engine.Socket} conn
* @return self
* @private
*/
onconnection(conn) {
debug("incoming connection with id %s", conn.id);
const client = new client_1.Client(this, conn);
if (conn.protocol === 3) {
// @ts-ignore
client.connect("/");
}
return this;
}
/**
* Looks up a namespace.
*
* @example
* // with a simple string
* const myNamespace = io.of("/my-namespace");
*
* // with a regex
* const dynamicNsp = io.of(/^\/dynamic-\d+$/).on("connection", (socket) => {
* const namespace = socket.nsp; // newNamespace.name === "/dynamic-101"
*
* // broadcast to all clients in the given sub-namespace
* namespace.emit("hello");
* });
*
* @param name - nsp name
* @param fn optional, nsp `connection` ev handler
*/
of(name, fn) {
if (typeof name === "function" || name instanceof RegExp) {
const parentNsp = new parent_namespace_1.ParentNamespace(this);
debug("initializing parent namespace %s", parentNsp.name);
if (typeof name === "function") {
this.parentNsps.set(name, parentNsp);
}
else {
this.parentNsps.set((nsp, conn, next) => next(null, name.test(nsp)), parentNsp);
this.parentNamespacesFromRegExp.set(name, parentNsp);
}
if (fn) {
// @ts-ignore
parentNsp.on("connect", fn);
}
return parentNsp;
}
if (String(name)[0] !== "/")
name = "/" + name;
let nsp = this._nsps.get(name);
if (!nsp) {
for (const [regex, parentNamespace] of this.parentNamespacesFromRegExp) {
if (regex.test(name)) {
debug("attaching namespace %s to parent namespace %s", name, regex);
return parentNamespace.createChild(name);
}
}
debug("initializing namespace %s", name);
nsp = new namespace_1.Namespace(this, name);
this._nsps.set(name, nsp);
if (name !== "/") {
// @ts-ignore
this.sockets.emitReserved("new_namespace", nsp);
}
}
if (fn)
nsp.on("connect", fn);
return nsp;
}
/**
* Closes server connection
*
* @param [fn] optional, called as `fn([err])` on error OR all conns closed
*/
async close(fn) {
await Promise.allSettled([...this._nsps.values()].map(async (nsp) => {
nsp.sockets.forEach((socket) => {
socket._onclose("server shutting down");
});
await nsp.adapter.close();
}));
this.engine.close();
// restore the Adapter prototype, when the Socket.IO server was attached to a uWebSockets.js server
(0, uws_1.restoreAdapter)();
if (this.httpServer) {
this.httpServer.close(fn);
}
else {
fn && fn();
}
}
/**
* Registers a middleware, which is a function that gets executed for every incoming {@link Socket}.
*
* @example
* io.use((socket, next) => {
* // ...
* next();
* });
*
* @param fn - the middleware function
*/
use(fn) {
this.sockets.use(fn);
return this;
}
/**
* Targets a room when emitting.
*
* @example
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* io.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* io.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room) {
return this.sockets.to(room);
}
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* // disconnect all clients in the "room-101" room
* io.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room) {
return this.sockets.in(room);
}
/**
* Excludes a room when emitting.
*
* @example
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* io.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* io.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* io.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room) {
return this.sockets.except(room);
}
/**
* Sends a `message` event to all clients.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* io.send("hello");
*
* // this is equivalent to
* io.emit("message", "hello");
*
* @return self
*/
send(...args) {
// This type-cast is needed because EmitEvents likely doesn't have `message` as a key.
// if you specify the EmitEvents, the type of args will be never.
this.sockets.emit("message", ...args);
return this;
}
/**
* Sends a `message` event to all clients. Alias of {@link send}.
*
* @return self
*/
write(...args) {
// This type-cast is needed because EmitEvents likely doesn't have `message` as a key.
// if you specify the EmitEvents, the type of args will be never.
this.sockets.emit("message", ...args);
return this;
}
/**
* Sends a message to the other Socket.IO servers of the cluster.
*
* @example
* io.serverSideEmit("hello", "world");
*
* io.on("hello", (arg1) => {
* console.log(arg1); // prints "world"
* });
*
* // acknowledgements (without binary content) are supported too:
* io.serverSideEmit("ping", (err, responses) => {
* if (err) {
* // some servers did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per server (except the current one)
* }
* });
*
* io.on("ping", (cb) => {
* cb("pong");
* });
*
* @param ev - the event name
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*/
serverSideEmit(ev, ...args) {
return this.sockets.serverSideEmit(ev, ...args);
}
/**
* Sends a message and expect an acknowledgement from the other Socket.IO servers of the cluster.
*
* @example
* try {
* const responses = await io.serverSideEmitWithAck("ping");
* console.log(responses); // one response per server (except the current one)
* } catch (e) {
* // some servers did not acknowledge the event in the given delay
* }
*
* @param ev - the event name
* @param args - an array of arguments
*
* @return a Promise that will be fulfilled when all servers have acknowledged the event
*/
serverSideEmitWithAck(ev, ...args) {
return this.sockets.serverSideEmitWithAck(ev, ...args);
}
/**
* Gets a list of socket ids.
*
* @deprecated this method will be removed in the next major release, please use {@link Server#serverSideEmit} or
* {@link Server#fetchSockets} instead.
*/
allSockets() {
return this.sockets.allSockets();
}
/**
* Sets the compress flag.
*
* @example
* io.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return a new {@link BroadcastOperator} instance for chaining
*/
compress(compress) {
return this.sockets.compress(compress);
}
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.volatile.emit("hello"); // the clients may or may not receive it
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get volatile() {
return this.sockets.volatile;
}
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* // the “foo” event will be broadcast to all connected clients on this node
* io.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local() {
return this.sockets.local;
}
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* io.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout) {
return this.sockets.timeout(timeout);
}
/**
* Returns the matching socket instances.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // return all Socket instances
* const sockets = await io.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await io.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets() {
return this.sockets.fetchSockets();
}
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
*
* // make all socket instances join the "room1" room
* io.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* io.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room) {
return this.sockets.socketsJoin(room);
}
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances leave the "room1" room
* io.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* io.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room) {
return this.sockets.socketsLeave(room);
}
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* io.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* io.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close = false) {
return this.sockets.disconnectSockets(close);
}
}
exports.Server = Server;
/**
* Expose main namespace (/).
*/
const emitterMethods = Object.keys(events_1.EventEmitter.prototype).filter(function (key) {
return typeof events_1.EventEmitter.prototype[key] === "function";
});
emitterMethods.forEach(function (fn) {
Server.prototype[fn] = function () {
return this.sockets[fn].apply(this.sockets, arguments);
};
});
module.exports = (srv, opts) => new Server(srv, opts);
module.exports.Server = Server;
module.exports.Namespace = namespace_1.Namespace;
module.exports.Socket = socket_1.Socket;

432
node_modules/socket.io/dist/namespace.d.ts generated vendored Normal file
View File

@ -0,0 +1,432 @@
import { Socket } from "./socket";
import type { Server } from "./index";
import { EventParams, EventNames, EventsMap, StrictEventEmitter, DefaultEventsMap, DecorateAcknowledgementsWithTimeoutAndMultipleResponses, AllButLast, Last, DecorateAcknowledgementsWithMultipleResponses, RemoveAcknowledgements, EventNamesWithAck, FirstNonErrorArg, EventNamesWithoutAck } from "./typed-events";
import type { Client } from "./client";
import type { Adapter, Room, SocketId } from "socket.io-adapter";
import { BroadcastOperator } from "./broadcast-operator";
export interface ExtendedError extends Error {
data?: any;
}
export interface NamespaceReservedEventsMap<ListenEvents extends EventsMap, EmitEvents extends EventsMap, ServerSideEvents extends EventsMap, SocketData> {
connect: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>) => void;
connection: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>) => void;
}
export interface ServerReservedEventsMap<ListenEvents extends EventsMap, EmitEvents extends EventsMap, ServerSideEvents extends EventsMap, SocketData> extends NamespaceReservedEventsMap<ListenEvents, EmitEvents, ServerSideEvents, SocketData> {
new_namespace: (namespace: Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData>) => void;
}
export declare const RESERVED_EVENTS: ReadonlySet<string | Symbol>;
/**
* A Namespace is a communication channel that allows you to split the logic of your application over a single shared
* connection.
*
* Each namespace has its own:
*
* - event handlers
*
* ```
* io.of("/orders").on("connection", (socket) => {
* socket.on("order:list", () => {});
* socket.on("order:create", () => {});
* });
*
* io.of("/users").on("connection", (socket) => {
* socket.on("user:list", () => {});
* });
* ```
*
* - rooms
*
* ```
* const orderNamespace = io.of("/orders");
*
* orderNamespace.on("connection", (socket) => {
* socket.join("room1");
* orderNamespace.to("room1").emit("hello");
* });
*
* const userNamespace = io.of("/users");
*
* userNamespace.on("connection", (socket) => {
* socket.join("room1"); // distinct from the room in the "orders" namespace
* userNamespace.to("room1").emit("holà");
* });
* ```
*
* - middlewares
*
* ```
* const orderNamespace = io.of("/orders");
*
* orderNamespace.use((socket, next) => {
* // ensure the socket has access to the "orders" namespace
* });
*
* const userNamespace = io.of("/users");
*
* userNamespace.use((socket, next) => {
* // ensure the socket has access to the "users" namespace
* });
* ```
*/
export declare class Namespace<ListenEvents extends EventsMap = DefaultEventsMap, EmitEvents extends EventsMap = ListenEvents, ServerSideEvents extends EventsMap = DefaultEventsMap, SocketData = any> extends StrictEventEmitter<ServerSideEvents, RemoveAcknowledgements<EmitEvents>, NamespaceReservedEventsMap<ListenEvents, EmitEvents, ServerSideEvents, SocketData>> {
readonly name: string;
/**
* A map of currently connected sockets.
*/
readonly sockets: Map<SocketId, Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>>;
/**
* A map of currently connecting sockets.
*/
private _preConnectSockets;
adapter: Adapter;
/** @private */
readonly server: Server<ListenEvents, EmitEvents, ServerSideEvents, SocketData>;
private _fns;
/** @private */
_ids: number;
/**
* Namespace constructor.
*
* @param server instance
* @param name
*/
constructor(server: Server<ListenEvents, EmitEvents, ServerSideEvents, SocketData>, name: string);
/**
* Initializes the `Adapter` for this nsp.
* Run upon changing adapter by `Server#adapter`
* in addition to the constructor.
*
* @private
*/
_initAdapter(): void;
/**
* Registers a middleware, which is a function that gets executed for every incoming {@link Socket}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.use((socket, next) => {
* // ...
* next();
* });
*
* @param fn - the middleware function
*/
use(fn: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>, next: (err?: ExtendedError) => void) => void): this;
/**
* Executes the middleware for an incoming client.
*
* @param socket - the socket that will get added
* @param fn - last fn call in the middleware
* @private
*/
private run;
/**
* Targets a room when emitting.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* myNamespace.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* myNamespace.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* myNamespace.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // disconnect all clients in the "room-101" room
* myNamespace.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Excludes a room when emitting.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* myNamespace.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* myNamespace.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* myNamespace.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Adds a new client.
*
* @return {Socket}
* @private
*/
_add(client: Client<ListenEvents, EmitEvents, ServerSideEvents>, auth: Record<string, unknown>, fn: (socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>) => void): Promise<void>;
private _createSocket;
private _doConnect;
/**
* Removes a client. Called by each `Socket`.
*
* @private
*/
_remove(socket: Socket<ListenEvents, EmitEvents, ServerSideEvents, SocketData>): void;
/**
* Emits to all connected clients.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.emit("hello", "world");
*
* // all serializable datastructures are supported (no need to call JSON.stringify)
* myNamespace.emit("hello", 1, "2", { 3: ["4"], 5: Uint8Array.from([6]) });
*
* // with an acknowledgement from the clients
* myNamespace.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @return Always true
*/
emit<Ev extends EventNamesWithoutAck<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
/**
* Sends a `message` event to all clients.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.send("hello");
*
* // this is equivalent to
* myNamespace.emit("message", "hello");
*
* @return self
*/
send(...args: EventParams<EmitEvents, "message">): this;
/**
* Sends a `message` event to all clients. Sends a `message` event. Alias of {@link send}.
*
* @return self
*/
write(...args: EventParams<EmitEvents, "message">): this;
/**
* Sends a message to the other Socket.IO servers of the cluster.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.serverSideEmit("hello", "world");
*
* myNamespace.on("hello", (arg1) => {
* console.log(arg1); // prints "world"
* });
*
* // acknowledgements (without binary content) are supported too:
* myNamespace.serverSideEmit("ping", (err, responses) => {
* if (err) {
* // some servers did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per server (except the current one)
* }
* });
*
* myNamespace.on("ping", (cb) => {
* cb("pong");
* });
*
* @param ev - the event name
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*/
serverSideEmit<Ev extends EventNames<ServerSideEvents>>(ev: Ev, ...args: EventParams<DecorateAcknowledgementsWithTimeoutAndMultipleResponses<ServerSideEvents>, Ev>): boolean;
/**
* Sends a message and expect an acknowledgement from the other Socket.IO servers of the cluster.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* try {
* const responses = await myNamespace.serverSideEmitWithAck("ping");
* console.log(responses); // one response per server (except the current one)
* } catch (e) {
* // some servers did not acknowledge the event in the given delay
* }
*
* @param ev - the event name
* @param args - an array of arguments
*
* @return a Promise that will be fulfilled when all servers have acknowledged the event
*/
serverSideEmitWithAck<Ev extends EventNamesWithAck<ServerSideEvents>>(ev: Ev, ...args: AllButLast<EventParams<ServerSideEvents, Ev>>): Promise<FirstNonErrorArg<Last<EventParams<ServerSideEvents, Ev>>>[]>;
/**
* Called when a packet is received from another Socket.IO server
*
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*
* @private
*/
_onServerSideEmit(args: [string, ...any[]]): void;
/**
* Gets a list of clients.
*
* @deprecated this method will be removed in the next major release, please use {@link Namespace#serverSideEmit} or
* {@link Namespace#fetchSockets} instead.
*/
allSockets(): Promise<Set<SocketId>>;
/**
* Sets the compress flag.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return self
*/
compress(compress: boolean): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.volatile.emit("hello"); // the clients may or may not receive it
*
* @return self
*/
get volatile(): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the “foo” event will be broadcast to all connected clients on this node
* myNamespace.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local(): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout: number): BroadcastOperator<import("./typed-events").DecorateAcknowledgements<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>>, SocketData>;
/**
* Returns the matching socket instances.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // return all Socket instances
* const sockets = await myNamespace.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await myNamespace.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets(): Promise<import("./broadcast-operator").RemoteSocket<EmitEvents, SocketData>[]>;
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances join the "room1" room
* myNamespace.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* myNamespace.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room: Room | Room[]): void;
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances leave the "room1" room
* myNamespace.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* myNamespace.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room: Room | Room[]): void;
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* myNamespace.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* myNamespace.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close?: boolean): void;
}

581
node_modules/socket.io/dist/namespace.js generated vendored Normal file
View File

@ -0,0 +1,581 @@
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", { value: true });
exports.Namespace = exports.RESERVED_EVENTS = void 0;
const socket_1 = require("./socket");
const typed_events_1 = require("./typed-events");
const debug_1 = __importDefault(require("debug"));
const broadcast_operator_1 = require("./broadcast-operator");
const debug = (0, debug_1.default)("socket.io:namespace");
exports.RESERVED_EVENTS = new Set(["connect", "connection", "new_namespace"]);
/**
* A Namespace is a communication channel that allows you to split the logic of your application over a single shared
* connection.
*
* Each namespace has its own:
*
* - event handlers
*
* ```
* io.of("/orders").on("connection", (socket) => {
* socket.on("order:list", () => {});
* socket.on("order:create", () => {});
* });
*
* io.of("/users").on("connection", (socket) => {
* socket.on("user:list", () => {});
* });
* ```
*
* - rooms
*
* ```
* const orderNamespace = io.of("/orders");
*
* orderNamespace.on("connection", (socket) => {
* socket.join("room1");
* orderNamespace.to("room1").emit("hello");
* });
*
* const userNamespace = io.of("/users");
*
* userNamespace.on("connection", (socket) => {
* socket.join("room1"); // distinct from the room in the "orders" namespace
* userNamespace.to("room1").emit("holà");
* });
* ```
*
* - middlewares
*
* ```
* const orderNamespace = io.of("/orders");
*
* orderNamespace.use((socket, next) => {
* // ensure the socket has access to the "orders" namespace
* });
*
* const userNamespace = io.of("/users");
*
* userNamespace.use((socket, next) => {
* // ensure the socket has access to the "users" namespace
* });
* ```
*/
class Namespace extends typed_events_1.StrictEventEmitter {
/**
* Namespace constructor.
*
* @param server instance
* @param name
*/
constructor(server, name) {
super();
/**
* A map of currently connected sockets.
*/
this.sockets = new Map();
/**
* A map of currently connecting sockets.
*/
this._preConnectSockets = new Map();
this._fns = [];
/** @private */
this._ids = 0;
this.server = server;
this.name = name;
this._initAdapter();
}
/**
* Initializes the `Adapter` for this nsp.
* Run upon changing adapter by `Server#adapter`
* in addition to the constructor.
*
* @private
*/
_initAdapter() {
// @ts-ignore
this.adapter = new (this.server.adapter())(this);
}
/**
* Registers a middleware, which is a function that gets executed for every incoming {@link Socket}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.use((socket, next) => {
* // ...
* next();
* });
*
* @param fn - the middleware function
*/
use(fn) {
this._fns.push(fn);
return this;
}
/**
* Executes the middleware for an incoming client.
*
* @param socket - the socket that will get added
* @param fn - last fn call in the middleware
* @private
*/
run(socket, fn) {
if (!this._fns.length)
return fn();
const fns = this._fns.slice(0);
function run(i) {
fns[i](socket, (err) => {
// upon error, short-circuit
if (err)
return fn(err);
// if no middleware left, summon callback
if (!fns[i + 1])
return fn();
// go on to next
run(i + 1);
});
}
run(0);
}
/**
* Targets a room when emitting.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the “foo” event will be broadcast to all connected clients in the “room-101” room
* myNamespace.to("room-101").emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* myNamespace.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* myNamespace.to("room-101").to("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).to(room);
}
/**
* Targets a room when emitting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // disconnect all clients in the "room-101" room
* myNamespace.in("room-101").disconnectSockets();
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).in(room);
}
/**
* Excludes a room when emitting.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* myNamespace.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* myNamespace.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* myNamespace.except("room-101").except("room-102").emit("foo", "bar");
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).except(room);
}
/**
* Adds a new client.
*
* @return {Socket}
* @private
*/
async _add(client, auth, fn) {
var _a;
debug("adding socket to nsp %s", this.name);
const socket = await this._createSocket(client, auth);
this._preConnectSockets.set(socket.id, socket);
if (
// @ts-ignore
((_a = this.server.opts.connectionStateRecovery) === null || _a === void 0 ? void 0 : _a.skipMiddlewares) &&
socket.recovered &&
client.conn.readyState === "open") {
return this._doConnect(socket, fn);
}
this.run(socket, (err) => {
process.nextTick(() => {
if ("open" !== client.conn.readyState) {
debug("next called after client was closed - ignoring socket");
socket._cleanup();
return;
}
if (err) {
debug("middleware error, sending CONNECT_ERROR packet to the client");
socket._cleanup();
if (client.conn.protocol === 3) {
return socket._error(err.data || err.message);
}
else {
return socket._error({
message: err.message,
data: err.data,
});
}
}
this._doConnect(socket, fn);
});
});
}
async _createSocket(client, auth) {
const sessionId = auth.pid;
const offset = auth.offset;
if (
// @ts-ignore
this.server.opts.connectionStateRecovery &&
typeof sessionId === "string" &&
typeof offset === "string") {
let session;
try {
session = await this.adapter.restoreSession(sessionId, offset);
}
catch (e) {
debug("error while restoring session: %s", e);
}
if (session) {
debug("connection state recovered for sid %s", session.sid);
return new socket_1.Socket(this, client, auth, session);
}
}
return new socket_1.Socket(this, client, auth);
}
_doConnect(socket, fn) {
this._preConnectSockets.delete(socket.id);
this.sockets.set(socket.id, socket);
// it's paramount that the internal `onconnect` logic
// fires before user-set events to prevent state order
// violations (such as a disconnection before the connection
// logic is complete)
socket._onconnect();
if (fn)
fn(socket);
// fire user-set events
this.emitReserved("connect", socket);
this.emitReserved("connection", socket);
}
/**
* Removes a client. Called by each `Socket`.
*
* @private
*/
_remove(socket) {
this.sockets.delete(socket.id) || this._preConnectSockets.delete(socket.id);
}
/**
* Emits to all connected clients.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.emit("hello", "world");
*
* // all serializable datastructures are supported (no need to call JSON.stringify)
* myNamespace.emit("hello", 1, "2", { 3: ["4"], 5: Uint8Array.from([6]) });
*
* // with an acknowledgement from the clients
* myNamespace.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @return Always true
*/
emit(ev, ...args) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).emit(ev, ...args);
}
/**
* Sends a `message` event to all clients.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.send("hello");
*
* // this is equivalent to
* myNamespace.emit("message", "hello");
*
* @return self
*/
send(...args) {
// This type-cast is needed because EmitEvents likely doesn't have `message` as a key.
// if you specify the EmitEvents, the type of args will be never.
this.emit("message", ...args);
return this;
}
/**
* Sends a `message` event to all clients. Sends a `message` event. Alias of {@link send}.
*
* @return self
*/
write(...args) {
// This type-cast is needed because EmitEvents likely doesn't have `message` as a key.
// if you specify the EmitEvents, the type of args will be never.
this.emit("message", ...args);
return this;
}
/**
* Sends a message to the other Socket.IO servers of the cluster.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.serverSideEmit("hello", "world");
*
* myNamespace.on("hello", (arg1) => {
* console.log(arg1); // prints "world"
* });
*
* // acknowledgements (without binary content) are supported too:
* myNamespace.serverSideEmit("ping", (err, responses) => {
* if (err) {
* // some servers did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per server (except the current one)
* }
* });
*
* myNamespace.on("ping", (cb) => {
* cb("pong");
* });
*
* @param ev - the event name
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*/
serverSideEmit(ev, ...args) {
if (exports.RESERVED_EVENTS.has(ev)) {
throw new Error(`"${String(ev)}" is a reserved event name`);
}
args.unshift(ev);
this.adapter.serverSideEmit(args);
return true;
}
/**
* Sends a message and expect an acknowledgement from the other Socket.IO servers of the cluster.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* try {
* const responses = await myNamespace.serverSideEmitWithAck("ping");
* console.log(responses); // one response per server (except the current one)
* } catch (e) {
* // some servers did not acknowledge the event in the given delay
* }
*
* @param ev - the event name
* @param args - an array of arguments
*
* @return a Promise that will be fulfilled when all servers have acknowledged the event
*/
serverSideEmitWithAck(ev, ...args) {
return new Promise((resolve, reject) => {
args.push((err, responses) => {
if (err) {
err.responses = responses;
return reject(err);
}
else {
return resolve(responses);
}
});
this.serverSideEmit(ev, ...args);
});
}
/**
* Called when a packet is received from another Socket.IO server
*
* @param args - an array of arguments, which may include an acknowledgement callback at the end
*
* @private
*/
_onServerSideEmit(args) {
super.emitUntyped.apply(this, args);
}
/**
* Gets a list of clients.
*
* @deprecated this method will be removed in the next major release, please use {@link Namespace#serverSideEmit} or
* {@link Namespace#fetchSockets} instead.
*/
allSockets() {
return new broadcast_operator_1.BroadcastOperator(this.adapter).allSockets();
}
/**
* Sets the compress flag.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.compress(false).emit("hello");
*
* @param compress - if `true`, compresses the sending data
* @return self
*/
compress(compress) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).compress(compress);
}
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.volatile.emit("hello"); // the clients may or may not receive it
*
* @return self
*/
get volatile() {
return new broadcast_operator_1.BroadcastOperator(this.adapter).volatile;
}
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // the “foo” event will be broadcast to all connected clients on this node
* myNamespace.local.emit("foo", "bar");
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local() {
return new broadcast_operator_1.BroadcastOperator(this.adapter).local;
}
/**
* Adds a timeout in milliseconds for the next operation.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* myNamespace.timeout(1000).emit("some-event", (err, responses) => {
* if (err) {
* // some clients did not acknowledge the event in the given delay
* } else {
* console.log(responses); // one response per client
* }
* });
*
* @param timeout
*/
timeout(timeout) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).timeout(timeout);
}
/**
* Returns the matching socket instances.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // return all Socket instances
* const sockets = await myNamespace.fetchSockets();
*
* // return all Socket instances in the "room1" room
* const sockets = await myNamespace.in("room1").fetchSockets();
*
* for (const socket of sockets) {
* console.log(socket.id);
* console.log(socket.handshake);
* console.log(socket.rooms);
* console.log(socket.data);
*
* socket.emit("hello");
* socket.join("room1");
* socket.leave("room2");
* socket.disconnect();
* }
*/
fetchSockets() {
return new broadcast_operator_1.BroadcastOperator(this.adapter).fetchSockets();
}
/**
* Makes the matching socket instances join the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances join the "room1" room
* myNamespace.socketsJoin("room1");
*
* // make all socket instances in the "room1" room join the "room2" and "room3" rooms
* myNamespace.in("room1").socketsJoin(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsJoin(room) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).socketsJoin(room);
}
/**
* Makes the matching socket instances leave the specified rooms.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances leave the "room1" room
* myNamespace.socketsLeave("room1");
*
* // make all socket instances in the "room1" room leave the "room2" and "room3" rooms
* myNamespace.in("room1").socketsLeave(["room2", "room3"]);
*
* @param room - a room, or an array of rooms
*/
socketsLeave(room) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).socketsLeave(room);
}
/**
* Makes the matching socket instances disconnect.
*
* Note: this method also works within a cluster of multiple Socket.IO servers, with a compatible {@link Adapter}.
*
* @example
* const myNamespace = io.of("/my-namespace");
*
* // make all socket instances disconnect (the connections might be kept alive for other namespaces)
* myNamespace.disconnectSockets();
*
* // make all socket instances in the "room1" room disconnect and close the underlying connections
* myNamespace.in("room1").disconnectSockets(true);
*
* @param close - whether to close the underlying connection
*/
disconnectSockets(close = false) {
return new broadcast_operator_1.BroadcastOperator(this.adapter).disconnectSockets(close);
}
}
exports.Namespace = Namespace;

30
node_modules/socket.io/dist/parent-namespace.d.ts generated vendored Normal file
View File

@ -0,0 +1,30 @@
import { Namespace } from "./namespace";
import type { Server, RemoteSocket } from "./index";
import type { EventParams, EventsMap, DefaultEventsMap, EventNamesWithoutAck } from "./typed-events";
/**
* A parent namespace is a special {@link Namespace} that holds a list of child namespaces which were created either
* with a regular expression or with a function.
*
* @example
* const parentNamespace = io.of(/\/dynamic-\d+/);
*
* parentNamespace.on("connection", (socket) => {
* const childNamespace = socket.nsp;
* }
*
* // will reach all the clients that are in one of the child namespaces, like "/dynamic-101"
* parentNamespace.emit("hello", "world");
*
*/
export declare class ParentNamespace<ListenEvents extends EventsMap = DefaultEventsMap, EmitEvents extends EventsMap = ListenEvents, ServerSideEvents extends EventsMap = DefaultEventsMap, SocketData = any> extends Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData> {
private static count;
private readonly children;
constructor(server: Server<ListenEvents, EmitEvents, ServerSideEvents, SocketData>);
/**
* @private
*/
_initAdapter(): void;
emit<Ev extends EventNamesWithoutAck<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
createChild(name: string): Namespace<ListenEvents, EmitEvents, ServerSideEvents, SocketData>;
fetchSockets(): Promise<RemoteSocket<EmitEvents, SocketData>[]>;
}

88
node_modules/socket.io/dist/parent-namespace.js generated vendored Normal file
View File

@ -0,0 +1,88 @@
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", { value: true });
exports.ParentNamespace = void 0;
const namespace_1 = require("./namespace");
const socket_io_adapter_1 = require("socket.io-adapter");
const debug_1 = __importDefault(require("debug"));
const debug = (0, debug_1.default)("socket.io:parent-namespace");
/**
* A parent namespace is a special {@link Namespace} that holds a list of child namespaces which were created either
* with a regular expression or with a function.
*
* @example
* const parentNamespace = io.of(/\/dynamic-\d+/);
*
* parentNamespace.on("connection", (socket) => {
* const childNamespace = socket.nsp;
* }
*
* // will reach all the clients that are in one of the child namespaces, like "/dynamic-101"
* parentNamespace.emit("hello", "world");
*
*/
class ParentNamespace extends namespace_1.Namespace {
constructor(server) {
super(server, "/_" + ParentNamespace.count++);
this.children = new Set();
}
/**
* @private
*/
_initAdapter() {
this.adapter = new ParentBroadcastAdapter(this);
}
emit(ev, ...args) {
this.children.forEach((nsp) => {
nsp.emit(ev, ...args);
});
return true;
}
createChild(name) {
debug("creating child namespace %s", name);
const namespace = new namespace_1.Namespace(this.server, name);
this["_fns"].forEach((fn) => namespace.use(fn));
this.listeners("connect").forEach((listener) => namespace.on("connect", listener));
this.listeners("connection").forEach((listener) => namespace.on("connection", listener));
this.children.add(namespace);
if (this.server._opts.cleanupEmptyChildNamespaces) {
const remove = namespace._remove;
namespace._remove = (socket) => {
remove.call(namespace, socket);
if (namespace.sockets.size === 0) {
debug("closing child namespace %s", name);
namespace.adapter.close();
this.server._nsps.delete(namespace.name);
this.children.delete(namespace);
}
};
}
this.server._nsps.set(name, namespace);
// @ts-ignore
this.server.sockets.emitReserved("new_namespace", namespace);
return namespace;
}
fetchSockets() {
// note: we could make the fetchSockets() method work for dynamic namespaces created with a regex (by sending the
// regex to the other Socket.IO servers, and returning the sockets of each matching namespace for example), but
// the behavior for namespaces created with a function is less clear
// note²: we cannot loop over each children namespace, because with multiple Socket.IO servers, a given namespace
// may exist on one node but not exist on another (since it is created upon client connection)
throw new Error("fetchSockets() is not supported on parent namespaces");
}
}
exports.ParentNamespace = ParentNamespace;
ParentNamespace.count = 0;
/**
* A dummy adapter that only supports broadcasting to child (concrete) namespaces.
* @private file
*/
class ParentBroadcastAdapter extends socket_io_adapter_1.Adapter {
broadcast(packet, opts) {
this.nsp.children.forEach((nsp) => {
nsp.adapter.broadcast(packet, opts);
});
}
}

56
node_modules/socket.io/dist/socket-types.d.ts generated vendored Normal file
View File

@ -0,0 +1,56 @@
import type { IncomingHttpHeaders } from "http";
import type { ParsedUrlQuery } from "querystring";
export type DisconnectReason = "transport error" | "transport close" | "forced close" | "ping timeout" | "parse error" | "server shutting down" | "forced server close" | "client namespace disconnect" | "server namespace disconnect";
export interface SocketReservedEventsMap {
disconnect: (reason: DisconnectReason, description?: any) => void;
disconnecting: (reason: DisconnectReason, description?: any) => void;
error: (err: Error) => void;
}
export interface EventEmitterReservedEventsMap {
newListener: (eventName: string | Symbol, listener: (...args: any[]) => void) => void;
removeListener: (eventName: string | Symbol, listener: (...args: any[]) => void) => void;
}
export declare const RESERVED_EVENTS: ReadonlySet<string | Symbol>;
/**
* The handshake details
*/
export interface Handshake {
/**
* The headers sent as part of the handshake
*/
headers: IncomingHttpHeaders;
/**
* The date of creation (as string)
*/
time: string;
/**
* The ip of the client
*/
address: string;
/**
* Whether the connection is cross-domain
*/
xdomain: boolean;
/**
* Whether the connection is secure
*/
secure: boolean;
/**
* The date of creation (as unix timestamp)
*/
issued: number;
/**
* The request URL string
*/
url: string;
/**
* The query object
*/
query: ParsedUrlQuery;
/**
* The auth object
*/
auth: {
[key: string]: any;
};
}

11
node_modules/socket.io/dist/socket-types.js generated vendored Normal file
View File

@ -0,0 +1,11 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.RESERVED_EVENTS = void 0;
exports.RESERVED_EVENTS = new Set([
"connect",
"connect_error",
"disconnect",
"disconnecting",
"newListener",
"removeListener",
]);

613
node_modules/socket.io/dist/socket.d.ts generated vendored Normal file
View File

@ -0,0 +1,613 @@
import { Packet } from "socket.io-parser";
import { AllButLast, DecorateAcknowledgements, DecorateAcknowledgementsWithMultipleResponses, DefaultEventsMap, EventNames, EventNamesWithAck, EventParams, EventsMap, FirstNonErrorArg, Last, StrictEventEmitter } from "./typed-events";
import type { Client } from "./client";
import type { Namespace } from "./namespace";
import type { IncomingMessage } from "http";
import type { Room, Session, SocketId } from "socket.io-adapter";
import { BroadcastOperator } from "./broadcast-operator";
import { DisconnectReason, Handshake, SocketReservedEventsMap } from "./socket-types";
/**
* `[eventName, ...args]`
*/
export type Event = [string, ...any[]];
/**
* This is the main object for interacting with a client.
*
* A Socket belongs to a given {@link Namespace} and uses an underlying {@link Client} to communicate.
*
* Within each {@link Namespace}, you can also define arbitrary channels (called "rooms") that the {@link Socket} can
* join and leave. That provides a convenient way to broadcast to a group of socket instances.
*
* @example
* io.on("connection", (socket) => {
* console.log(`socket ${socket.id} connected`);
*
* // send an event to the client
* socket.emit("foo", "bar");
*
* socket.on("foobar", () => {
* // an event was received from the client
* });
*
* // join the room named "room1"
* socket.join("room1");
*
* // broadcast to everyone in the room named "room1"
* io.to("room1").emit("hello");
*
* // upon disconnection
* socket.on("disconnect", (reason) => {
* console.log(`socket ${socket.id} disconnected due to ${reason}`);
* });
* });
*/
export declare class Socket<ListenEvents extends EventsMap = DefaultEventsMap, EmitEvents extends EventsMap = ListenEvents, ServerSideEvents extends EventsMap = DefaultEventsMap, SocketData = any> extends StrictEventEmitter<ListenEvents, EmitEvents, SocketReservedEventsMap> {
readonly nsp: Namespace<ListenEvents, EmitEvents, ServerSideEvents>;
readonly client: Client<ListenEvents, EmitEvents, ServerSideEvents>;
/**
* An unique identifier for the session.
*/
readonly id: SocketId;
/**
* Whether the connection state was recovered after a temporary disconnection. In that case, any missed packets will
* be transmitted to the client, the data attribute and the rooms will be restored.
*/
readonly recovered: boolean;
/**
* The handshake details.
*/
readonly handshake: Handshake;
/**
* Additional information that can be attached to the Socket instance and which will be used in the
* {@link Server.fetchSockets()} method.
*/
data: SocketData;
/**
* Whether the socket is currently connected or not.
*
* @example
* io.use((socket, next) => {
* console.log(socket.connected); // false
* next();
* });
*
* io.on("connection", (socket) => {
* console.log(socket.connected); // true
* });
*/
connected: boolean;
/**
* The session ID, which must not be shared (unlike {@link id}).
*
* @private
*/
private readonly pid;
private readonly server;
private readonly adapter;
private acks;
private fns;
private flags;
private _anyListeners?;
private _anyOutgoingListeners?;
/**
* Interface to a `Client` for a given `Namespace`.
*
* @param {Namespace} nsp
* @param {Client} client
* @param {Object} auth
* @package
*/
constructor(nsp: Namespace<ListenEvents, EmitEvents, ServerSideEvents>, client: Client<ListenEvents, EmitEvents, ServerSideEvents>, auth: Record<string, unknown>, previousSession?: Session);
/**
* Builds the `handshake` BC object
*
* @private
*/
private buildHandshake;
/**
* Emits to this client.
*
* @example
* io.on("connection", (socket) => {
* socket.emit("hello", "world");
*
* // all serializable datastructures are supported (no need to call JSON.stringify)
* socket.emit("hello", 1, "2", { 3: ["4"], 5: Buffer.from([6]) });
*
* // with an acknowledgement from the client
* socket.emit("hello", "world", (val) => {
* // ...
* });
* });
*
* @return Always returns `true`.
*/
emit<Ev extends EventNames<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
/**
* Emits an event and waits for an acknowledgement
*
* @example
* io.on("connection", async (socket) => {
* // without timeout
* const response = await socket.emitWithAck("hello", "world");
*
* // with a specific timeout
* try {
* const response = await socket.timeout(1000).emitWithAck("hello", "world");
* } catch (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
*
* @return a Promise that will be fulfilled when the client acknowledges the event
*/
emitWithAck<Ev extends EventNamesWithAck<EmitEvents>>(ev: Ev, ...args: AllButLast<EventParams<EmitEvents, Ev>>): Promise<FirstNonErrorArg<Last<EventParams<EmitEvents, Ev>>>>;
/**
* @private
*/
private registerAckCallback;
/**
* Targets a room when broadcasting.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients in the “room-101” room, except this socket
* socket.to("room-101").emit("foo", "bar");
*
* // the code above is equivalent to:
* io.to("room-101").except(socket.id).emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* socket.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* socket.to("room-101").to("room-102").emit("foo", "bar");
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Targets a room when broadcasting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* io.on("connection", (socket) => {
* // disconnect all clients in the "room-101" room, except this socket
* socket.in("room-101").disconnectSockets();
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Excludes a room when broadcasting.
*
* @example
* io.on("connection", (socket) => {
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* // and this socket
* socket.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* socket.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* socket.except("room-101").except("room-102").emit("foo", "bar");
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room: Room | Room[]): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sends a `message` event.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* io.on("connection", (socket) => {
* socket.send("hello");
*
* // this is equivalent to
* socket.emit("message", "hello");
* });
*
* @return self
*/
send(...args: EventParams<EmitEvents, "message">): this;
/**
* Sends a `message` event. Alias of {@link send}.
*
* @return self
*/
write(...args: EventParams<EmitEvents, "message">): this;
/**
* Writes a packet.
*
* @param {Object} packet - packet object
* @param {Object} opts - options
* @private
*/
private packet;
/**
* Joins a room.
*
* @example
* io.on("connection", (socket) => {
* // join a single room
* socket.join("room1");
*
* // join multiple rooms
* socket.join(["room1", "room2"]);
* });
*
* @param {String|Array} rooms - room or array of rooms
* @return a Promise or nothing, depending on the adapter
*/
join(rooms: Room | Array<Room>): Promise<void> | void;
/**
* Leaves a room.
*
* @example
* io.on("connection", (socket) => {
* // leave a single room
* socket.leave("room1");
*
* // leave multiple rooms
* socket.leave("room1").leave("room2");
* });
*
* @param {String} room
* @return a Promise or nothing, depending on the adapter
*/
leave(room: string): Promise<void> | void;
/**
* Leave all rooms.
*
* @private
*/
private leaveAll;
/**
* Called by `Namespace` upon successful
* middleware execution (ie: authorization).
* Socket is added to namespace array before
* call to join, so adapters can access it.
*
* @private
*/
_onconnect(): void;
/**
* Called with each packet. Called by `Client`.
*
* @param {Object} packet
* @private
*/
_onpacket(packet: Packet): void;
/**
* Called upon event packet.
*
* @param {Packet} packet - packet object
* @private
*/
private onevent;
/**
* Produces an ack callback to emit with an event.
*
* @param {Number} id - packet id
* @private
*/
private ack;
/**
* Called upon ack packet.
*
* @private
*/
private onack;
/**
* Called upon client disconnect packet.
*
* @private
*/
private ondisconnect;
/**
* Handles a client error.
*
* @private
*/
_onerror(err: Error): void;
/**
* Called upon closing. Called by `Client`.
*
* @param {String} reason
* @param description
* @throw {Error} optional error object
*
* @private
*/
_onclose(reason: DisconnectReason, description?: any): this | undefined;
/**
* Makes the socket leave all the rooms it was part of and prevents it from joining any other room
*
* @private
*/
_cleanup(): void;
/**
* Produces an `error` packet.
*
* @param {Object} err - error object
*
* @private
*/
_error(err: any): void;
/**
* Disconnects this client.
*
* @example
* io.on("connection", (socket) => {
* // disconnect this socket (the connection might be kept alive for other namespaces)
* socket.disconnect();
*
* // disconnect this socket and close the underlying connection
* socket.disconnect(true);
* })
*
* @param {Boolean} close - if `true`, closes the underlying connection
* @return self
*/
disconnect(close?: boolean): this;
/**
* Sets the compress flag.
*
* @example
* io.on("connection", (socket) => {
* socket.compress(false).emit("hello");
* });
*
* @param {Boolean} compress - if `true`, compresses the sending data
* @return {Socket} self
*/
compress(compress: boolean): this;
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.on("connection", (socket) => {
* socket.volatile.emit("hello"); // the client may or may not receive it
* });
*
* @return {Socket} self
*/
get volatile(): this;
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to every sockets but the
* sender.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients, except this socket
* socket.broadcast.emit("foo", "bar");
* });
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get broadcast(): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients on this node, except this socket
* socket.local.emit("foo", "bar");
* });
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local(): BroadcastOperator<DecorateAcknowledgementsWithMultipleResponses<EmitEvents>, SocketData>;
/**
* Sets a modifier for a subsequent event emission that the callback will be called with an error when the
* given number of milliseconds have elapsed without an acknowledgement from the client:
*
* @example
* io.on("connection", (socket) => {
* socket.timeout(5000).emit("my-event", (err) => {
* if (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
* });
*
* @returns self
*/
timeout(timeout: number): Socket<ListenEvents, DecorateAcknowledgements<EmitEvents>, ServerSideEvents, SocketData>;
/**
* Dispatch incoming event to socket listeners.
*
* @param {Array} event - event that will get emitted
* @private
*/
private dispatch;
/**
* Sets up socket middleware.
*
* @example
* io.on("connection", (socket) => {
* socket.use(([event, ...args], next) => {
* if (isUnauthorized(event)) {
* return next(new Error("unauthorized event"));
* }
* // do not forget to call next
* next();
* });
*
* socket.on("error", (err) => {
* if (err && err.message === "unauthorized event") {
* socket.disconnect();
* }
* });
* });
*
* @param {Function} fn - middleware function (event, next)
* @return {Socket} self
*/
use(fn: (event: Event, next: (err?: Error) => void) => void): this;
/**
* Executes the middleware for an incoming event.
*
* @param {Array} event - event that will get emitted
* @param {Function} fn - last fn call in the middleware
* @private
*/
private run;
/**
* Whether the socket is currently disconnected
*/
get disconnected(): boolean;
/**
* A reference to the request that originated the underlying Engine.IO Socket.
*/
get request(): IncomingMessage;
/**
* A reference to the underlying Client transport connection (Engine.IO Socket object).
*
* @example
* io.on("connection", (socket) => {
* console.log(socket.conn.transport.name); // prints "polling" or "websocket"
*
* socket.conn.once("upgrade", () => {
* console.log(socket.conn.transport.name); // prints "websocket"
* });
* });
*/
get conn(): import("engine.io").Socket;
/**
* Returns the rooms the socket is currently in.
*
* @example
* io.on("connection", (socket) => {
* console.log(socket.rooms); // Set { <socket.id> }
*
* socket.join("room1");
*
* console.log(socket.rooms); // Set { <socket.id>, "room1" }
* });
*/
get rooms(): Set<Room>;
/**
* Adds a listener that will be fired when any event is received. The event name is passed as the first argument to
* the callback.
*
* @example
* io.on("connection", (socket) => {
* socket.onAny((event, ...args) => {
* console.log(`got event ${event}`);
* });
* });
*
* @param listener
*/
onAny(listener: (...args: any[]) => void): this;
/**
* Adds a listener that will be fired when any event is received. The event name is passed as the first argument to
* the callback. The listener is added to the beginning of the listeners array.
*
* @param listener
*/
prependAny(listener: (...args: any[]) => void): this;
/**
* Removes the listener that will be fired when any event is received.
*
* @example
* io.on("connection", (socket) => {
* const catchAllListener = (event, ...args) => {
* console.log(`got event ${event}`);
* }
*
* socket.onAny(catchAllListener);
*
* // remove a specific listener
* socket.offAny(catchAllListener);
*
* // or remove all listeners
* socket.offAny();
* });
*
* @param listener
*/
offAny(listener?: (...args: any[]) => void): this;
/**
* Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
* e.g. to remove listeners.
*/
listenersAny(): ((...args: any[]) => void)[];
/**
* Adds a listener that will be fired when any event is sent. The event name is passed as the first argument to
* the callback.
*
* Note: acknowledgements sent to the client are not included.
*
* @example
* io.on("connection", (socket) => {
* socket.onAnyOutgoing((event, ...args) => {
* console.log(`sent event ${event}`);
* });
* });
*
* @param listener
*/
onAnyOutgoing(listener: (...args: any[]) => void): this;
/**
* Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
* callback. The listener is added to the beginning of the listeners array.
*
* @example
* io.on("connection", (socket) => {
* socket.prependAnyOutgoing((event, ...args) => {
* console.log(`sent event ${event}`);
* });
* });
*
* @param listener
*/
prependAnyOutgoing(listener: (...args: any[]) => void): this;
/**
* Removes the listener that will be fired when any event is sent.
*
* @example
* io.on("connection", (socket) => {
* const catchAllListener = (event, ...args) => {
* console.log(`sent event ${event}`);
* }
*
* socket.onAnyOutgoing(catchAllListener);
*
* // remove a specific listener
* socket.offAnyOutgoing(catchAllListener);
*
* // or remove all listeners
* socket.offAnyOutgoing();
* });
*
* @param listener - the catch-all listener
*/
offAnyOutgoing(listener?: (...args: any[]) => void): this;
/**
* Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
* e.g. to remove listeners.
*/
listenersAnyOutgoing(): ((...args: any[]) => void)[];
/**
* Notify the listeners for each packet sent (emit or broadcast)
*
* @param packet
*
* @private
*/
private notifyOutgoingListeners;
private newBroadcastOperator;
}

977
node_modules/socket.io/dist/socket.js generated vendored Normal file
View File

@ -0,0 +1,977 @@
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", { value: true });
exports.Socket = void 0;
const socket_io_parser_1 = require("socket.io-parser");
const debug_1 = __importDefault(require("debug"));
const typed_events_1 = require("./typed-events");
const base64id_1 = __importDefault(require("base64id"));
const broadcast_operator_1 = require("./broadcast-operator");
const socket_types_1 = require("./socket-types");
const debug = (0, debug_1.default)("socket.io:socket");
const RECOVERABLE_DISCONNECT_REASONS = new Set([
"transport error",
"transport close",
"forced close",
"ping timeout",
"server shutting down",
"forced server close",
]);
function noop() { }
/**
* This is the main object for interacting with a client.
*
* A Socket belongs to a given {@link Namespace} and uses an underlying {@link Client} to communicate.
*
* Within each {@link Namespace}, you can also define arbitrary channels (called "rooms") that the {@link Socket} can
* join and leave. That provides a convenient way to broadcast to a group of socket instances.
*
* @example
* io.on("connection", (socket) => {
* console.log(`socket ${socket.id} connected`);
*
* // send an event to the client
* socket.emit("foo", "bar");
*
* socket.on("foobar", () => {
* // an event was received from the client
* });
*
* // join the room named "room1"
* socket.join("room1");
*
* // broadcast to everyone in the room named "room1"
* io.to("room1").emit("hello");
*
* // upon disconnection
* socket.on("disconnect", (reason) => {
* console.log(`socket ${socket.id} disconnected due to ${reason}`);
* });
* });
*/
class Socket extends typed_events_1.StrictEventEmitter {
/**
* Interface to a `Client` for a given `Namespace`.
*
* @param {Namespace} nsp
* @param {Client} client
* @param {Object} auth
* @package
*/
constructor(nsp, client, auth, previousSession) {
super();
this.nsp = nsp;
this.client = client;
/**
* Whether the connection state was recovered after a temporary disconnection. In that case, any missed packets will
* be transmitted to the client, the data attribute and the rooms will be restored.
*/
this.recovered = false;
/**
* Additional information that can be attached to the Socket instance and which will be used in the
* {@link Server.fetchSockets()} method.
*/
this.data = {};
/**
* Whether the socket is currently connected or not.
*
* @example
* io.use((socket, next) => {
* console.log(socket.connected); // false
* next();
* });
*
* io.on("connection", (socket) => {
* console.log(socket.connected); // true
* });
*/
this.connected = false;
this.acks = new Map();
this.fns = [];
this.flags = {};
this.server = nsp.server;
this.adapter = this.nsp.adapter;
if (previousSession) {
this.id = previousSession.sid;
this.pid = previousSession.pid;
previousSession.rooms.forEach((room) => this.join(room));
this.data = previousSession.data;
previousSession.missedPackets.forEach((packet) => {
this.packet({
type: socket_io_parser_1.PacketType.EVENT,
data: packet,
});
});
this.recovered = true;
}
else {
if (client.conn.protocol === 3) {
// @ts-ignore
this.id = nsp.name !== "/" ? nsp.name + "#" + client.id : client.id;
}
else {
this.id = base64id_1.default.generateId(); // don't reuse the Engine.IO id because it's sensitive information
}
if (this.server._opts.connectionStateRecovery) {
this.pid = base64id_1.default.generateId();
}
}
this.handshake = this.buildHandshake(auth);
// prevents crash when the socket receives an "error" event without listener
this.on("error", noop);
}
/**
* Builds the `handshake` BC object
*
* @private
*/
buildHandshake(auth) {
var _a, _b, _c, _d;
return {
headers: ((_a = this.request) === null || _a === void 0 ? void 0 : _a.headers) || {},
time: new Date() + "",
address: this.conn.remoteAddress,
xdomain: !!((_b = this.request) === null || _b === void 0 ? void 0 : _b.headers.origin),
// @ts-ignore
secure: !this.request || !!this.request.connection.encrypted,
issued: +new Date(),
url: (_c = this.request) === null || _c === void 0 ? void 0 : _c.url,
// @ts-ignore
query: ((_d = this.request) === null || _d === void 0 ? void 0 : _d._query) || {},
auth,
};
}
/**
* Emits to this client.
*
* @example
* io.on("connection", (socket) => {
* socket.emit("hello", "world");
*
* // all serializable datastructures are supported (no need to call JSON.stringify)
* socket.emit("hello", 1, "2", { 3: ["4"], 5: Buffer.from([6]) });
*
* // with an acknowledgement from the client
* socket.emit("hello", "world", (val) => {
* // ...
* });
* });
*
* @return Always returns `true`.
*/
emit(ev, ...args) {
if (socket_types_1.RESERVED_EVENTS.has(ev)) {
throw new Error(`"${String(ev)}" is a reserved event name`);
}
const data = [ev, ...args];
const packet = {
type: socket_io_parser_1.PacketType.EVENT,
data: data,
};
// access last argument to see if it's an ACK callback
if (typeof data[data.length - 1] === "function") {
const id = this.nsp._ids++;
debug("emitting packet with ack id %d", id);
this.registerAckCallback(id, data.pop());
packet.id = id;
}
const flags = Object.assign({}, this.flags);
this.flags = {};
// @ts-ignore
if (this.nsp.server.opts.connectionStateRecovery) {
// this ensures the packet is stored and can be transmitted upon reconnection
this.adapter.broadcast(packet, {
rooms: new Set([this.id]),
except: new Set(),
flags,
});
}
else {
this.notifyOutgoingListeners(packet);
this.packet(packet, flags);
}
return true;
}
/**
* Emits an event and waits for an acknowledgement
*
* @example
* io.on("connection", async (socket) => {
* // without timeout
* const response = await socket.emitWithAck("hello", "world");
*
* // with a specific timeout
* try {
* const response = await socket.timeout(1000).emitWithAck("hello", "world");
* } catch (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
*
* @return a Promise that will be fulfilled when the client acknowledges the event
*/
emitWithAck(ev, ...args) {
// the timeout flag is optional
const withErr = this.flags.timeout !== undefined;
return new Promise((resolve, reject) => {
args.push((arg1, arg2) => {
if (withErr) {
return arg1 ? reject(arg1) : resolve(arg2);
}
else {
return resolve(arg1);
}
});
this.emit(ev, ...args);
});
}
/**
* @private
*/
registerAckCallback(id, ack) {
const timeout = this.flags.timeout;
if (timeout === undefined) {
this.acks.set(id, ack);
return;
}
const timer = setTimeout(() => {
debug("event with ack id %d has timed out after %d ms", id, timeout);
this.acks.delete(id);
ack.call(this, new Error("operation has timed out"));
}, timeout);
this.acks.set(id, (...args) => {
clearTimeout(timer);
ack.apply(this, [null, ...args]);
});
}
/**
* Targets a room when broadcasting.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients in the “room-101” room, except this socket
* socket.to("room-101").emit("foo", "bar");
*
* // the code above is equivalent to:
* io.to("room-101").except(socket.id).emit("foo", "bar");
*
* // with an array of rooms (a client will be notified at most once)
* socket.to(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* socket.to("room-101").to("room-102").emit("foo", "bar");
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
to(room) {
return this.newBroadcastOperator().to(room);
}
/**
* Targets a room when broadcasting. Similar to `to()`, but might feel clearer in some cases:
*
* @example
* io.on("connection", (socket) => {
* // disconnect all clients in the "room-101" room, except this socket
* socket.in("room-101").disconnectSockets();
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
in(room) {
return this.newBroadcastOperator().in(room);
}
/**
* Excludes a room when broadcasting.
*
* @example
* io.on("connection", (socket) => {
* // the "foo" event will be broadcast to all connected clients, except the ones that are in the "room-101" room
* // and this socket
* socket.except("room-101").emit("foo", "bar");
*
* // with an array of rooms
* socket.except(["room-101", "room-102"]).emit("foo", "bar");
*
* // with multiple chained calls
* socket.except("room-101").except("room-102").emit("foo", "bar");
* });
*
* @param room - a room, or an array of rooms
* @return a new {@link BroadcastOperator} instance for chaining
*/
except(room) {
return this.newBroadcastOperator().except(room);
}
/**
* Sends a `message` event.
*
* This method mimics the WebSocket.send() method.
*
* @see https://developer.mozilla.org/en-US/docs/Web/API/WebSocket/send
*
* @example
* io.on("connection", (socket) => {
* socket.send("hello");
*
* // this is equivalent to
* socket.emit("message", "hello");
* });
*
* @return self
*/
send(...args) {
this.emit("message", ...args);
return this;
}
/**
* Sends a `message` event. Alias of {@link send}.
*
* @return self
*/
write(...args) {
this.emit("message", ...args);
return this;
}
/**
* Writes a packet.
*
* @param {Object} packet - packet object
* @param {Object} opts - options
* @private
*/
packet(packet, opts = {}) {
packet.nsp = this.nsp.name;
opts.compress = false !== opts.compress;
this.client._packet(packet, opts);
}
/**
* Joins a room.
*
* @example
* io.on("connection", (socket) => {
* // join a single room
* socket.join("room1");
*
* // join multiple rooms
* socket.join(["room1", "room2"]);
* });
*
* @param {String|Array} rooms - room or array of rooms
* @return a Promise or nothing, depending on the adapter
*/
join(rooms) {
debug("join room %s", rooms);
return this.adapter.addAll(this.id, new Set(Array.isArray(rooms) ? rooms : [rooms]));
}
/**
* Leaves a room.
*
* @example
* io.on("connection", (socket) => {
* // leave a single room
* socket.leave("room1");
*
* // leave multiple rooms
* socket.leave("room1").leave("room2");
* });
*
* @param {String} room
* @return a Promise or nothing, depending on the adapter
*/
leave(room) {
debug("leave room %s", room);
return this.adapter.del(this.id, room);
}
/**
* Leave all rooms.
*
* @private
*/
leaveAll() {
this.adapter.delAll(this.id);
}
/**
* Called by `Namespace` upon successful
* middleware execution (ie: authorization).
* Socket is added to namespace array before
* call to join, so adapters can access it.
*
* @private
*/
_onconnect() {
debug("socket connected - writing packet");
this.connected = true;
this.join(this.id);
if (this.conn.protocol === 3) {
this.packet({ type: socket_io_parser_1.PacketType.CONNECT });
}
else {
this.packet({
type: socket_io_parser_1.PacketType.CONNECT,
data: { sid: this.id, pid: this.pid },
});
}
}
/**
* Called with each packet. Called by `Client`.
*
* @param {Object} packet
* @private
*/
_onpacket(packet) {
debug("got packet %j", packet);
switch (packet.type) {
case socket_io_parser_1.PacketType.EVENT:
this.onevent(packet);
break;
case socket_io_parser_1.PacketType.BINARY_EVENT:
this.onevent(packet);
break;
case socket_io_parser_1.PacketType.ACK:
this.onack(packet);
break;
case socket_io_parser_1.PacketType.BINARY_ACK:
this.onack(packet);
break;
case socket_io_parser_1.PacketType.DISCONNECT:
this.ondisconnect();
break;
}
}
/**
* Called upon event packet.
*
* @param {Packet} packet - packet object
* @private
*/
onevent(packet) {
const args = packet.data || [];
debug("emitting event %j", args);
if (null != packet.id) {
debug("attaching ack callback to event");
args.push(this.ack(packet.id));
}
if (this._anyListeners && this._anyListeners.length) {
const listeners = this._anyListeners.slice();
for (const listener of listeners) {
listener.apply(this, args);
}
}
this.dispatch(args);
}
/**
* Produces an ack callback to emit with an event.
*
* @param {Number} id - packet id
* @private
*/
ack(id) {
const self = this;
let sent = false;
return function () {
// prevent double callbacks
if (sent)
return;
const args = Array.prototype.slice.call(arguments);
debug("sending ack %j", args);
self.packet({
id: id,
type: socket_io_parser_1.PacketType.ACK,
data: args,
});
sent = true;
};
}
/**
* Called upon ack packet.
*
* @private
*/
onack(packet) {
const ack = this.acks.get(packet.id);
if ("function" == typeof ack) {
debug("calling ack %s with %j", packet.id, packet.data);
ack.apply(this, packet.data);
this.acks.delete(packet.id);
}
else {
debug("bad ack %s", packet.id);
}
}
/**
* Called upon client disconnect packet.
*
* @private
*/
ondisconnect() {
debug("got disconnect packet");
this._onclose("client namespace disconnect");
}
/**
* Handles a client error.
*
* @private
*/
_onerror(err) {
// FIXME the meaning of the "error" event is overloaded:
// - it can be sent by the client (`socket.emit("error")`)
// - it can be emitted when the connection encounters an error (an invalid packet for example)
// - it can be emitted when a packet is rejected in a middleware (`socket.use()`)
this.emitReserved("error", err);
}
/**
* Called upon closing. Called by `Client`.
*
* @param {String} reason
* @param description
* @throw {Error} optional error object
*
* @private
*/
_onclose(reason, description) {
if (!this.connected)
return this;
debug("closing socket - reason %s", reason);
this.emitReserved("disconnecting", reason, description);
if (this.server._opts.connectionStateRecovery &&
RECOVERABLE_DISCONNECT_REASONS.has(reason)) {
debug("connection state recovery is enabled for sid %s", this.id);
this.adapter.persistSession({
sid: this.id,
pid: this.pid,
rooms: [...this.rooms],
data: this.data,
});
}
this._cleanup();
this.client._remove(this);
this.connected = false;
this.emitReserved("disconnect", reason, description);
return;
}
/**
* Makes the socket leave all the rooms it was part of and prevents it from joining any other room
*
* @private
*/
_cleanup() {
this.leaveAll();
this.nsp._remove(this);
this.join = noop;
}
/**
* Produces an `error` packet.
*
* @param {Object} err - error object
*
* @private
*/
_error(err) {
this.packet({ type: socket_io_parser_1.PacketType.CONNECT_ERROR, data: err });
}
/**
* Disconnects this client.
*
* @example
* io.on("connection", (socket) => {
* // disconnect this socket (the connection might be kept alive for other namespaces)
* socket.disconnect();
*
* // disconnect this socket and close the underlying connection
* socket.disconnect(true);
* })
*
* @param {Boolean} close - if `true`, closes the underlying connection
* @return self
*/
disconnect(close = false) {
if (!this.connected)
return this;
if (close) {
this.client._disconnect();
}
else {
this.packet({ type: socket_io_parser_1.PacketType.DISCONNECT });
this._onclose("server namespace disconnect");
}
return this;
}
/**
* Sets the compress flag.
*
* @example
* io.on("connection", (socket) => {
* socket.compress(false).emit("hello");
* });
*
* @param {Boolean} compress - if `true`, compresses the sending data
* @return {Socket} self
*/
compress(compress) {
this.flags.compress = compress;
return this;
}
/**
* Sets a modifier for a subsequent event emission that the event data may be lost if the client is not ready to
* receive messages (because of network slowness or other issues, or because they’re connected through long polling
* and is in the middle of a request-response cycle).
*
* @example
* io.on("connection", (socket) => {
* socket.volatile.emit("hello"); // the client may or may not receive it
* });
*
* @return {Socket} self
*/
get volatile() {
this.flags.volatile = true;
return this;
}
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to every sockets but the
* sender.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients, except this socket
* socket.broadcast.emit("foo", "bar");
* });
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get broadcast() {
return this.newBroadcastOperator();
}
/**
* Sets a modifier for a subsequent event emission that the event data will only be broadcast to the current node.
*
* @example
* io.on("connection", (socket) => {
* // the “foo” event will be broadcast to all connected clients on this node, except this socket
* socket.local.emit("foo", "bar");
* });
*
* @return a new {@link BroadcastOperator} instance for chaining
*/
get local() {
return this.newBroadcastOperator().local;
}
/**
* Sets a modifier for a subsequent event emission that the callback will be called with an error when the
* given number of milliseconds have elapsed without an acknowledgement from the client:
*
* @example
* io.on("connection", (socket) => {
* socket.timeout(5000).emit("my-event", (err) => {
* if (err) {
* // the client did not acknowledge the event in the given delay
* }
* });
* });
*
* @returns self
*/
timeout(timeout) {
this.flags.timeout = timeout;
return this;
}
/**
* Dispatch incoming event to socket listeners.
*
* @param {Array} event - event that will get emitted
* @private
*/
dispatch(event) {
debug("dispatching an event %j", event);
this.run(event, (err) => {
process.nextTick(() => {
if (err) {
return this._onerror(err);
}
if (this.connected) {
super.emitUntyped.apply(this, event);
}
else {
debug("ignore packet received after disconnection");
}
});
});
}
/**
* Sets up socket middleware.
*
* @example
* io.on("connection", (socket) => {
* socket.use(([event, ...args], next) => {
* if (isUnauthorized(event)) {
* return next(new Error("unauthorized event"));
* }
* // do not forget to call next
* next();
* });
*
* socket.on("error", (err) => {
* if (err && err.message === "unauthorized event") {
* socket.disconnect();
* }
* });
* });
*
* @param {Function} fn - middleware function (event, next)
* @return {Socket} self
*/
use(fn) {
this.fns.push(fn);
return this;
}
/**
* Executes the middleware for an incoming event.
*
* @param {Array} event - event that will get emitted
* @param {Function} fn - last fn call in the middleware
* @private
*/
run(event, fn) {
if (!this.fns.length)
return fn();
const fns = this.fns.slice(0);
function run(i) {
fns[i](event, (err) => {
// upon error, short-circuit
if (err)
return fn(err);
// if no middleware left, summon callback
if (!fns[i + 1])
return fn();
// go on to next
run(i + 1);
});
}
run(0);
}
/**
* Whether the socket is currently disconnected
*/
get disconnected() {
return !this.connected;
}
/**
* A reference to the request that originated the underlying Engine.IO Socket.
*/
get request() {
return this.client.request;
}
/**
* A reference to the underlying Client transport connection (Engine.IO Socket object).
*
* @example
* io.on("connection", (socket) => {
* console.log(socket.conn.transport.name); // prints "polling" or "websocket"
*
* socket.conn.once("upgrade", () => {
* console.log(socket.conn.transport.name); // prints "websocket"
* });
* });
*/
get conn() {
return this.client.conn;
}
/**
* Returns the rooms the socket is currently in.
*
* @example
* io.on("connection", (socket) => {
* console.log(socket.rooms); // Set { <socket.id> }
*
* socket.join("room1");
*
* console.log(socket.rooms); // Set { <socket.id>, "room1" }
* });
*/
get rooms() {
return this.adapter.socketRooms(this.id) || new Set();
}
/**
* Adds a listener that will be fired when any event is received. The event name is passed as the first argument to
* the callback.
*
* @example
* io.on("connection", (socket) => {
* socket.onAny((event, ...args) => {
* console.log(`got event ${event}`);
* });
* });
*
* @param listener
*/
onAny(listener) {
this._anyListeners = this._anyListeners || [];
this._anyListeners.push(listener);
return this;
}
/**
* Adds a listener that will be fired when any event is received. The event name is passed as the first argument to
* the callback. The listener is added to the beginning of the listeners array.
*
* @param listener
*/
prependAny(listener) {
this._anyListeners = this._anyListeners || [];
this._anyListeners.unshift(listener);
return this;
}
/**
* Removes the listener that will be fired when any event is received.
*
* @example
* io.on("connection", (socket) => {
* const catchAllListener = (event, ...args) => {
* console.log(`got event ${event}`);
* }
*
* socket.onAny(catchAllListener);
*
* // remove a specific listener
* socket.offAny(catchAllListener);
*
* // or remove all listeners
* socket.offAny();
* });
*
* @param listener
*/
offAny(listener) {
if (!this._anyListeners) {
return this;
}
if (listener) {
const listeners = this._anyListeners;
for (let i = 0; i < listeners.length; i++) {
if (listener === listeners[i]) {
listeners.splice(i, 1);
return this;
}
}
}
else {
this._anyListeners = [];
}
return this;
}
/**
* Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
* e.g. to remove listeners.
*/
listenersAny() {
return this._anyListeners || [];
}
/**
* Adds a listener that will be fired when any event is sent. The event name is passed as the first argument to
* the callback.
*
* Note: acknowledgements sent to the client are not included.
*
* @example
* io.on("connection", (socket) => {
* socket.onAnyOutgoing((event, ...args) => {
* console.log(`sent event ${event}`);
* });
* });
*
* @param listener
*/
onAnyOutgoing(listener) {
this._anyOutgoingListeners = this._anyOutgoingListeners || [];
this._anyOutgoingListeners.push(listener);
return this;
}
/**
* Adds a listener that will be fired when any event is emitted. The event name is passed as the first argument to the
* callback. The listener is added to the beginning of the listeners array.
*
* @example
* io.on("connection", (socket) => {
* socket.prependAnyOutgoing((event, ...args) => {
* console.log(`sent event ${event}`);
* });
* });
*
* @param listener
*/
prependAnyOutgoing(listener) {
this._anyOutgoingListeners = this._anyOutgoingListeners || [];
this._anyOutgoingListeners.unshift(listener);
return this;
}
/**
* Removes the listener that will be fired when any event is sent.
*
* @example
* io.on("connection", (socket) => {
* const catchAllListener = (event, ...args) => {
* console.log(`sent event ${event}`);
* }
*
* socket.onAnyOutgoing(catchAllListener);
*
* // remove a specific listener
* socket.offAnyOutgoing(catchAllListener);
*
* // or remove all listeners
* socket.offAnyOutgoing();
* });
*
* @param listener - the catch-all listener
*/
offAnyOutgoing(listener) {
if (!this._anyOutgoingListeners) {
return this;
}
if (listener) {
const listeners = this._anyOutgoingListeners;
for (let i = 0; i < listeners.length; i++) {
if (listener === listeners[i]) {
listeners.splice(i, 1);
return this;
}
}
}
else {
this._anyOutgoingListeners = [];
}
return this;
}
/**
* Returns an array of listeners that are listening for any event that is specified. This array can be manipulated,
* e.g. to remove listeners.
*/
listenersAnyOutgoing() {
return this._anyOutgoingListeners || [];
}
/**
* Notify the listeners for each packet sent (emit or broadcast)
*
* @param packet
*
* @private
*/
notifyOutgoingListeners(packet) {
if (this._anyOutgoingListeners && this._anyOutgoingListeners.length) {
const listeners = this._anyOutgoingListeners.slice();
for (const listener of listeners) {
listener.apply(this, packet.data);
}
}
}
newBroadcastOperator() {
const flags = Object.assign({}, this.flags);
this.flags = {};
return new broadcast_operator_1.BroadcastOperator(this.adapter, new Set(), new Set([this.id]), flags);
}
}
exports.Socket = Socket;

203
node_modules/socket.io/dist/typed-events.d.ts generated vendored Normal file
View File

@ -0,0 +1,203 @@
import { EventEmitter } from "events";
/**
* An events map is an interface that maps event names to their value, which
* represents the type of the `on` listener.
*/
export interface EventsMap {
[event: string]: any;
}
/**
* The default events map, used if no EventsMap is given. Using this EventsMap
* is equivalent to accepting all event names, and any data.
*/
export interface DefaultEventsMap {
[event: string]: (...args: any[]) => void;
}
/**
* Returns a union type containing all the keys of an event map.
*/
export type EventNames<Map extends EventsMap> = keyof Map & (string | symbol);
/**
* Returns a union type containing all the keys of an event map that have an acknowledgement callback.
*
* That also have *some* data coming in.
*/
export type EventNamesWithAck<Map extends EventsMap, K extends EventNames<Map> = EventNames<Map>> = IfAny<Last<Parameters<Map[K]>> | Map[K], K, K extends (Last<Parameters<Map[K]>> extends (...args: any[]) => any ? FirstNonErrorArg<Last<Parameters<Map[K]>>> extends void ? never : K : never) ? K : never>;
/**
* Returns a union type containing all the keys of an event map that have an acknowledgement callback.
*
* That also have *some* data coming in.
*/
export type EventNamesWithoutAck<Map extends EventsMap, K extends EventNames<Map> = EventNames<Map>> = IfAny<Last<Parameters<Map[K]>> | Map[K], K, K extends (Parameters<Map[K]> extends never[] ? K : never) ? K : K extends (Last<Parameters<Map[K]>> extends (...args: any[]) => any ? never : K) ? K : never>;
export type RemoveAcknowledgements<E extends EventsMap> = {
[K in EventNamesWithoutAck<E>]: E[K];
};
export type EventNamesWithError<Map extends EventsMap, K extends EventNamesWithAck<Map> = EventNamesWithAck<Map>> = IfAny<Last<Parameters<Map[K]>> | Map[K], K, K extends (LooseParameters<Last<Parameters<Map[K]>>>[0] extends Error ? K : never) ? K : never>;
/** The tuple type representing the parameters of an event listener */
export type EventParams<Map extends EventsMap, Ev extends EventNames<Map>> = Parameters<Map[Ev]>;
/**
* The event names that are either in ReservedEvents or in UserEvents
*/
export type ReservedOrUserEventNames<ReservedEventsMap extends EventsMap, UserEvents extends EventsMap> = EventNames<ReservedEventsMap> | EventNames<UserEvents>;
/**
* Type of a listener of a user event or a reserved event. If `Ev` is in
* `ReservedEvents`, the reserved event listener is returned.
*/
export type ReservedOrUserListener<ReservedEvents extends EventsMap, UserEvents extends EventsMap, Ev extends ReservedOrUserEventNames<ReservedEvents, UserEvents>> = FallbackToUntypedListener<Ev extends EventNames<ReservedEvents> ? ReservedEvents[Ev] : Ev extends EventNames<UserEvents> ? UserEvents[Ev] : never>;
/**
* Returns an untyped listener type if `T` is `never`; otherwise, returns `T`.
*
* This is a hack to mitigate https://github.com/socketio/socket.io/issues/3833.
* Needed because of https://github.com/microsoft/TypeScript/issues/41778
*/
type FallbackToUntypedListener<T> = [T] extends [never] ? (...args: any[]) => void | Promise<void> : T;
/**
* Interface for classes that aren't `EventEmitter`s, but still expose a
* strictly typed `emit` method.
*/
export interface TypedEventBroadcaster<EmitEvents extends EventsMap> {
emit<Ev extends EventNames<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
}
/**
* Strictly typed version of an `EventEmitter`. A `TypedEventEmitter` takes type
* parameters for mappings of event names to event data types, and strictly
* types method calls to the `EventEmitter` according to these event maps.
*
* @typeParam ListenEvents - `EventsMap` of user-defined events that can be
* listened to with `on` or `once`
* @typeParam EmitEvents - `EventsMap` of user-defined events that can be
* emitted with `emit`
* @typeParam ReservedEvents - `EventsMap` of reserved events, that can be
* emitted by socket.io with `emitReserved`, and can be listened to with
* `listen`.
*/
export declare abstract class StrictEventEmitter<ListenEvents extends EventsMap, EmitEvents extends EventsMap, ReservedEvents extends EventsMap = {}> extends EventEmitter implements TypedEventBroadcaster<EmitEvents> {
/**
* Adds the `listener` function as an event listener for `ev`.
*
* @param ev Name of the event
* @param listener Callback function
*/
on<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>(ev: Ev, listener: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev>): this;
/**
* Adds a one-time `listener` function as an event listener for `ev`.
*
* @param ev Name of the event
* @param listener Callback function
*/
once<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>(ev: Ev, listener: ReservedOrUserListener<ReservedEvents, ListenEvents, Ev>): this;
/**
* Emits an event.
*
* @param ev Name of the event
* @param args Values to send to listeners of this event
*/
emit<Ev extends EventNames<EmitEvents>>(ev: Ev, ...args: EventParams<EmitEvents, Ev>): boolean;
/**
* Emits a reserved event.
*
* This method is `protected`, so that only a class extending
* `StrictEventEmitter` can emit its own reserved events.
*
* @param ev Reserved event name
* @param args Arguments to emit along with the event
*/
protected emitReserved<Ev extends EventNames<ReservedEvents>>(ev: Ev, ...args: EventParams<ReservedEvents, Ev>): boolean;
/**
* Emits an event.
*
* This method is `protected`, so that only a class extending
* `StrictEventEmitter` can get around the strict typing. This is useful for
* calling `emit.apply`, which can be called as `emitUntyped.apply`.
*
* @param ev Event name
* @param args Arguments to emit along with the event
*/
protected emitUntyped(ev: string, ...args: any[]): boolean;
/**
* Returns the listeners listening to an event.
*
* @param event Event name
* @returns Array of listeners subscribed to `event`
*/
listeners<Ev extends ReservedOrUserEventNames<ReservedEvents, ListenEvents>>(event: Ev): ReservedOrUserListener<ReservedEvents, ListenEvents, Ev>[];
}
/**
* Returns a boolean for whether the given type is `any`.
*
* @link https://stackoverflow.com/a/49928360/1490091
*
* Useful in type utilities, such as disallowing `any`s to be passed to a function.
*
* @author sindresorhus
* @link https://github.com/sindresorhus/type-fest
*/
type IsAny<T> = 0 extends 1 & T ? true : false;
/**
* An if-else-like type that resolves depending on whether the given type is `any`.
*
* @see {@link IsAny}
*
* @author sindresorhus
* @link https://github.com/sindresorhus/type-fest
*/
type IfAny<T, TypeIfAny = true, TypeIfNotAny = false> = IsAny<T> extends true ? TypeIfAny : TypeIfNotAny;
/**
* Extracts the type of the last element of an array.
*
* Use-case: Defining the return type of functions that extract the last element of an array, for example [`lodash.last`](https://lodash.com/docs/4.17.15#last).
*
* @author sindresorhus
* @link https://github.com/sindresorhus/type-fest
*/
export type Last<ValueType extends readonly unknown[]> = ValueType extends readonly [infer ElementType] ? ElementType : ValueType extends readonly [infer _, ...infer Tail] ? Last<Tail> : ValueType extends ReadonlyArray<infer ElementType> ? ElementType : never;
export type FirstNonErrorTuple<T extends unknown[]> = T[0] extends Error ? T[1] : T[0];
export type AllButLast<T extends any[]> = T extends [...infer H, infer L] ? H : any[];
/**
* Like `Parameters<T>`, but doesn't require `T` to be a function ahead of time.
*/
type LooseParameters<T> = T extends (...args: infer P) => any ? P : never;
export type FirstNonErrorArg<T> = T extends (...args: infer Params) => any ? FirstNonErrorTuple<Params> : any;
type PrependTimeoutError<T extends any[]> = {
[K in keyof T]: T[K] extends (...args: infer Params) => infer Result ? Params[0] extends Error ? T[K] : (err: Error, ...args: Params) => Result : T[K];
};
export type MultiplyArray<T extends unknown[]> = {
[K in keyof T]: T[K][];
};
type InferFirstAndPreserveLabel<T extends any[]> = T extends [any, ...infer R] ? T extends [...infer H, ...R] ? H : never : never;
/**
* Utility type to decorate the acknowledgement callbacks multiple values
* on the first non error element while removing any elements after
*/
type ExpectMultipleResponses<T extends any[]> = {
[K in keyof T]: T[K] extends (...args: infer Params) => infer Result ? Params extends [Error] ? (err: Error) => Result : Params extends [Error, ...infer Rest] ? (err: Error, ...args: InferFirstAndPreserveLabel<MultiplyArray<Rest>>) => Result : Params extends [] ? () => Result : (...args: InferFirstAndPreserveLabel<MultiplyArray<Params>>) => Result : T[K];
};
/**
* Utility type to decorate the acknowledgement callbacks with a timeout error.
*
* This is needed because the timeout() flag breaks the symmetry between the sender and the receiver:
*
* @example
* interface Events {
* "my-event": (val: string) => void;
* }
*
* socket.on("my-event", (cb) => {
* cb("123"); // one single argument here
* });
*
* socket.timeout(1000).emit("my-event", (err, val) => {
* // two arguments there (the "err" argument is not properly typed)
* });
*
*/
export type DecorateAcknowledgements<E> = {
[K in keyof E]: E[K] extends (...args: infer Params) => infer Result ? (...args: PrependTimeoutError<Params>) => Result : E[K];
};
export type DecorateAcknowledgementsWithTimeoutAndMultipleResponses<E> = {
[K in keyof E]: E[K] extends (...args: infer Params) => infer Result ? (...args: ExpectMultipleResponses<PrependTimeoutError<Params>>) => Result : E[K];
};
export type DecorateAcknowledgementsWithMultipleResponses<E> = {
[K in keyof E]: E[K] extends (...args: infer Params) => infer Result ? (...args: ExpectMultipleResponses<Params>) => Result : E[K];
};
export {};

81
node_modules/socket.io/dist/typed-events.js generated vendored Normal file
View File

@ -0,0 +1,81 @@
"use strict";
Object.defineProperty(exports, "__esModule", { value: true });
exports.StrictEventEmitter = void 0;
const events_1 = require("events");
/**
* Strictly typed version of an `EventEmitter`. A `TypedEventEmitter` takes type
* parameters for mappings of event names to event data types, and strictly
* types method calls to the `EventEmitter` according to these event maps.
*
* @typeParam ListenEvents - `EventsMap` of user-defined events that can be
* listened to with `on` or `once`
* @typeParam EmitEvents - `EventsMap` of user-defined events that can be
* emitted with `emit`
* @typeParam ReservedEvents - `EventsMap` of reserved events, that can be
* emitted by socket.io with `emitReserved`, and can be listened to with
* `listen`.
*/
class StrictEventEmitter extends events_1.EventEmitter {
/**
* Adds the `listener` function as an event listener for `ev`.
*
* @param ev Name of the event
* @param listener Callback function
*/
on(ev, listener) {
return super.on(ev, listener);
}
/**
* Adds a one-time `listener` function as an event listener for `ev`.
*
* @param ev Name of the event
* @param listener Callback function
*/
once(ev, listener) {
return super.once(ev, listener);
}
/**
* Emits an event.
*
* @param ev Name of the event
* @param args Values to send to listeners of this event
*/
emit(ev, ...args) {
return super.emit(ev, ...args);
}
/**
* Emits a reserved event.
*
* This method is `protected`, so that only a class extending
* `StrictEventEmitter` can emit its own reserved events.
*
* @param ev Reserved event name
* @param args Arguments to emit along with the event
*/
emitReserved(ev, ...args) {
return super.emit(ev, ...args);
}
/**
* Emits an event.
*
* This method is `protected`, so that only a class extending
* `StrictEventEmitter` can get around the strict typing. This is useful for
* calling `emit.apply`, which can be called as `emitUntyped.apply`.
*
* @param ev Event name
* @param args Arguments to emit along with the event
*/
emitUntyped(ev, ...args) {
return super.emit(ev, ...args);
}
/**
* Returns the listeners listening to an event.
*
* @param event Event name
* @returns Array of listeners subscribed to `event`
*/
listeners(event) {
return super.listeners(event);
}
}
exports.StrictEventEmitter = StrictEventEmitter;

3
node_modules/socket.io/dist/uws.d.ts generated vendored Normal file
View File

@ -0,0 +1,3 @@
export declare function patchAdapter(app: any): void;
export declare function restoreAdapter(): void;
export declare function serveFile(res: any, filepath: string): void;

136
node_modules/socket.io/dist/uws.js generated vendored Normal file
View File

@ -0,0 +1,136 @@
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", { value: true });
exports.patchAdapter = patchAdapter;
exports.restoreAdapter = restoreAdapter;
exports.serveFile = serveFile;
const socket_io_adapter_1 = require("socket.io-adapter");
const fs_1 = require("fs");
const debug_1 = __importDefault(require("debug"));
const debug = (0, debug_1.default)("socket.io:adapter-uws");
const SEPARATOR = "\x1f"; // see https://en.wikipedia.org/wiki/Delimiter#ASCII_delimited_text
const { addAll, del, broadcast } = socket_io_adapter_1.Adapter.prototype;
function patchAdapter(app /* : TemplatedApp */) {
socket_io_adapter_1.Adapter.prototype.addAll = function (id, rooms) {
const isNew = !this.sids.has(id);
addAll.call(this, id, rooms);
const socket = this.nsp.sockets.get(id) || this.nsp._preConnectSockets.get(id);
if (!socket) {
return;
}
if (socket.conn.transport.name === "websocket") {
subscribe(this.nsp.name, socket, isNew, rooms);
return;
}
if (isNew) {
socket.conn.on("upgrade", () => {
const rooms = this.sids.get(id);
if (rooms) {
subscribe(this.nsp.name, socket, isNew, rooms);
}
});
}
};
socket_io_adapter_1.Adapter.prototype.del = function (id, room) {
del.call(this, id, room);
const socket = this.nsp.sockets.get(id) || this.nsp._preConnectSockets.get(id);
if (socket && socket.conn.transport.name === "websocket") {
// @ts-ignore
const sessionId = socket.conn.id;
// @ts-ignore
const websocket = socket.conn.transport.socket;
const topic = `${this.nsp.name}${SEPARATOR}${room}`;
debug("unsubscribe connection %s from topic %s", sessionId, topic);
websocket.unsubscribe(topic);
}
};
socket_io_adapter_1.Adapter.prototype.broadcast = function (packet, opts) {
const useFastPublish = opts.rooms.size <= 1 && opts.except.size === 0;
if (!useFastPublish) {
broadcast.call(this, packet, opts);
return;
}
const flags = opts.flags || {};
const basePacketOpts = {
preEncoded: true,
volatile: flags.volatile,
compress: flags.compress,
};
packet.nsp = this.nsp.name;
const encodedPackets = this.encoder.encode(packet);
const topic = opts.rooms.size === 0
? this.nsp.name
: `${this.nsp.name}${SEPARATOR}${opts.rooms.keys().next().value}`;
debug("fast publish to %s", topic);
// fast publish for clients connected with WebSocket
encodedPackets.forEach((encodedPacket) => {
const isBinary = typeof encodedPacket !== "string";
// "4" being the message type in the Engine.IO protocol, see https://github.com/socketio/engine.io-protocol
app.publish(topic, isBinary ? encodedPacket : "4" + encodedPacket, isBinary);
});
this.apply(opts, (socket) => {
if (socket.conn.transport.name !== "websocket") {
// classic publish for clients connected with HTTP long-polling
socket.client.writeToEngine(encodedPackets, basePacketOpts);
}
});
};
}
function subscribe(namespaceName, socket, isNew, rooms) {
// @ts-ignore
const sessionId = socket.conn.id;
// @ts-ignore
const websocket = socket.conn.transport.socket;
if (isNew) {
debug("subscribe connection %s to topic %s", sessionId, namespaceName);
websocket.subscribe(namespaceName);
}
rooms.forEach((room) => {
const topic = `${namespaceName}${SEPARATOR}${room}`; // '#' can be used as wildcard
debug("subscribe connection %s to topic %s", sessionId, topic);
websocket.subscribe(topic);
});
}
function restoreAdapter() {
socket_io_adapter_1.Adapter.prototype.addAll = addAll;
socket_io_adapter_1.Adapter.prototype.del = del;
socket_io_adapter_1.Adapter.prototype.broadcast = broadcast;
}
const toArrayBuffer = (buffer) => {
const { buffer: arrayBuffer, byteOffset, byteLength } = buffer;
return arrayBuffer.slice(byteOffset, byteOffset + byteLength);
};
// imported from https://github.com/kolodziejczak-sz/uwebsocket-serve
function serveFile(res /* : HttpResponse */, filepath) {
const { size } = (0, fs_1.statSync)(filepath);
const readStream = (0, fs_1.createReadStream)(filepath);
const destroyReadStream = () => !readStream.destroyed && readStream.destroy();
const onError = (error) => {
destroyReadStream();
throw error;
};
const onDataChunk = (chunk) => {
const arrayBufferChunk = toArrayBuffer(chunk);
res.cork(() => {
const lastOffset = res.getWriteOffset();
const [ok, done] = res.tryEnd(arrayBufferChunk, size);
if (!done && !ok) {
readStream.pause();
res.onWritable((offset) => {
const [ok, done] = res.tryEnd(arrayBufferChunk.slice(offset - lastOffset), size);
if (!done && ok) {
readStream.resume();
}
return ok;
});
}
});
};
res.onAborted(destroyReadStream);
readStream
.on("data", onDataChunk)
.on("error", onError)
.on("end", destroyReadStream);
}

243
node_modules/socket.io/node_modules/accepts/HISTORY.md generated vendored Normal file
View File

@ -0,0 +1,243 @@
1.3.8 / 2022-02-02
==================
* deps: mime-types@~2.1.34
- deps: mime-db@~1.51.0
* deps: negotiator@0.6.3
1.3.7 / 2019-04-29
==================
* deps: negotiator@0.6.2
- Fix sorting charset, encoding, and language with extra parameters
1.3.6 / 2019-04-28
==================
* deps: mime-types@~2.1.24
- deps: mime-db@~1.40.0
1.3.5 / 2018-02-28
==================
* deps: mime-types@~2.1.18
- deps: mime-db@~1.33.0
1.3.4 / 2017-08-22
==================
* deps: mime-types@~2.1.16
- deps: mime-db@~1.29.0
1.3.3 / 2016-05-02
==================
* deps: mime-types@~2.1.11
- deps: mime-db@~1.23.0
* deps: negotiator@0.6.1
- perf: improve `Accept` parsing speed
- perf: improve `Accept-Charset` parsing speed
- perf: improve `Accept-Encoding` parsing speed
- perf: improve `Accept-Language` parsing speed
1.3.2 / 2016-03-08
==================
* deps: mime-types@~2.1.10
- Fix extension of `application/dash+xml`
- Update primary extension for `audio/mp4`
- deps: mime-db@~1.22.0
1.3.1 / 2016-01-19
==================
* deps: mime-types@~2.1.9
- deps: mime-db@~1.21.0
1.3.0 / 2015-09-29
==================
* deps: mime-types@~2.1.7
- deps: mime-db@~1.19.0
* deps: negotiator@0.6.0
- Fix including type extensions in parameters in `Accept` parsing
- Fix parsing `Accept` parameters with quoted equals
- Fix parsing `Accept` parameters with quoted semicolons
- Lazy-load modules from main entry point
- perf: delay type concatenation until needed
- perf: enable strict mode
- perf: hoist regular expressions
- perf: remove closures getting spec properties
- perf: remove a closure from media type parsing
- perf: remove property delete from media type parsing
1.2.13 / 2015-09-06
===================
* deps: mime-types@~2.1.6
- deps: mime-db@~1.18.0
1.2.12 / 2015-07-30
===================
* deps: mime-types@~2.1.4
- deps: mime-db@~1.16.0
1.2.11 / 2015-07-16
===================
* deps: mime-types@~2.1.3
- deps: mime-db@~1.15.0
1.2.10 / 2015-07-01
===================
* deps: mime-types@~2.1.2
- deps: mime-db@~1.14.0
1.2.9 / 2015-06-08
==================
* deps: mime-types@~2.1.1
- perf: fix deopt during mapping
1.2.8 / 2015-06-07
==================
* deps: mime-types@~2.1.0
- deps: mime-db@~1.13.0
* perf: avoid argument reassignment & argument slice
* perf: avoid negotiator recursive construction
* perf: enable strict mode
* perf: remove unnecessary bitwise operator
1.2.7 / 2015-05-10
==================
* deps: negotiator@0.5.3
- Fix media type parameter matching to be case-insensitive
1.2.6 / 2015-05-07
==================
* deps: mime-types@~2.0.11
- deps: mime-db@~1.9.1
* deps: negotiator@0.5.2
- Fix comparing media types with quoted values
- Fix splitting media types with quoted commas
1.2.5 / 2015-03-13
==================
* deps: mime-types@~2.0.10
- deps: mime-db@~1.8.0
1.2.4 / 2015-02-14
==================
* Support Node.js 0.6
* deps: mime-types@~2.0.9
- deps: mime-db@~1.7.0
* deps: negotiator@0.5.1
- Fix preference sorting to be stable for long acceptable lists
1.2.3 / 2015-01-31
==================
* deps: mime-types@~2.0.8
- deps: mime-db@~1.6.0
1.2.2 / 2014-12-30
==================
* deps: mime-types@~2.0.7
- deps: mime-db@~1.5.0
1.2.1 / 2014-12-30
==================
* deps: mime-types@~2.0.5
- deps: mime-db@~1.3.1
1.2.0 / 2014-12-19
==================
* deps: negotiator@0.5.0
- Fix list return order when large accepted list
- Fix missing identity encoding when q=0 exists
- Remove dynamic building of Negotiator class
1.1.4 / 2014-12-10
==================
* deps: mime-types@~2.0.4
- deps: mime-db@~1.3.0
1.1.3 / 2014-11-09
==================
* deps: mime-types@~2.0.3
- deps: mime-db@~1.2.0
1.1.2 / 2014-10-14
==================
* deps: negotiator@0.4.9
- Fix error when media type has invalid parameter
1.1.1 / 2014-09-28
==================
* deps: mime-types@~2.0.2
- deps: mime-db@~1.1.0
* deps: negotiator@0.4.8
- Fix all negotiations to be case-insensitive
- Stable sort preferences of same quality according to client order
1.1.0 / 2014-09-02
==================
* update `mime-types`
1.0.7 / 2014-07-04
==================
* Fix wrong type returned from `type` when match after unknown extension
1.0.6 / 2014-06-24
==================
* deps: negotiator@0.4.7
1.0.5 / 2014-06-20
==================
* fix crash when unknown extension given
1.0.4 / 2014-06-19
==================
* use `mime-types`
1.0.3 / 2014-06-11
==================
* deps: negotiator@0.4.6
- Order by specificity when quality is the same
1.0.2 / 2014-05-29
==================
* Fix interpretation when header not in request
* deps: pin negotiator@0.4.5
1.0.1 / 2014-01-18
==================
* Identity encoding isn't always acceptable
* deps: negotiator@~0.4.0
1.0.0 / 2013-12-27
==================
* Genesis

23
node_modules/socket.io/node_modules/accepts/LICENSE generated vendored Normal file
View File

@ -0,0 +1,23 @@
(The MIT License)
Copyright (c) 2014 Jonathan Ong <me@jongleberry.com>
Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com>
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

140
node_modules/socket.io/node_modules/accepts/README.md generated vendored Normal file
View File

@ -0,0 +1,140 @@
# accepts
[![NPM Version][npm-version-image]][npm-url]
[![NPM Downloads][npm-downloads-image]][npm-url]
[![Node.js Version][node-version-image]][node-version-url]
[![Build Status][github-actions-ci-image]][github-actions-ci-url]
[![Test Coverage][coveralls-image]][coveralls-url]
Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
In addition to negotiator, it allows:
- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
as well as `('text/html', 'application/json')`.
- Allows type shorthands such as `json`.
- Returns `false` when no types match
- Treats non-existent headers as `*`
## Installation
This is a [Node.js](https://nodejs.org/en/) module available through the
[npm registry](https://www.npmjs.com/). Installation is done using the
[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
```sh
$ npm install accepts
```
## API
```js
var accepts = require('accepts')
```
### accepts(req)
Create a new `Accepts` object for the given `req`.
#### .charset(charsets)
Return the first accepted charset. If nothing in `charsets` is accepted,
then `false` is returned.
#### .charsets()
Return the charsets that the request accepts, in the order of the client's
preference (most preferred first).
#### .encoding(encodings)
Return the first accepted encoding. If nothing in `encodings` is accepted,
then `false` is returned.
#### .encodings()
Return the encodings that the request accepts, in the order of the client's
preference (most preferred first).
#### .language(languages)
Return the first accepted language. If nothing in `languages` is accepted,
then `false` is returned.
#### .languages()
Return the languages that the request accepts, in the order of the client's
preference (most preferred first).
#### .type(types)
Return the first accepted type (and it is returned as the same text as what
appears in the `types` array). If nothing in `types` is accepted, then `false`
is returned.
The `types` array can contain full MIME types or file extensions. Any value
that is not a full MIME types is passed to `require('mime-types').lookup`.
#### .types()
Return the types that the request accepts, in the order of the client's
preference (most preferred first).
## Examples
### Simple type negotiation
This simple example shows how to use `accepts` to return a different typed
respond body based on what the client wants to accept. The server lists it's
preferences in order and will get back the best match between the client and
server.
```js
var accepts = require('accepts')
var http = require('http')
function app (req, res) {
var accept = accepts(req)
// the order of this list is significant; should be server preferred order
switch (accept.type(['json', 'html'])) {
case 'json':
res.setHeader('Content-Type', 'application/json')
res.write('{"hello":"world!"}')
break
case 'html':
res.setHeader('Content-Type', 'text/html')
res.write('<b>hello, world!</b>')
break
default:
// the fallback is text/plain, so no need to specify it above
res.setHeader('Content-Type', 'text/plain')
res.write('hello, world!')
break
}
res.end()
}
http.createServer(app).listen(3000)
```
You can test this out with the cURL program:
```sh
curl -I -H'Accept: text/html' http://localhost:3000/
```
## License
[MIT](LICENSE)
[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci
[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml
[node-version-image]: https://badgen.net/npm/node/accepts
[node-version-url]: https://nodejs.org/en/download
[npm-downloads-image]: https://badgen.net/npm/dm/accepts
[npm-url]: https://npmjs.org/package/accepts
[npm-version-image]: https://badgen.net/npm/v/accepts

238
node_modules/socket.io/node_modules/accepts/index.js generated vendored Normal file
View File

@ -0,0 +1,238 @@
/*!
* accepts
* Copyright(c) 2014 Jonathan Ong
* Copyright(c) 2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict'
/**
* Module dependencies.
* @private
*/
var Negotiator = require('negotiator')
var mime = require('mime-types')
/**
* Module exports.
* @public
*/
module.exports = Accepts
/**
* Create a new Accepts object for the given req.
*
* @param {object} req
* @public
*/
function Accepts (req) {
if (!(this instanceof Accepts)) {
return new Accepts(req)
}
this.headers = req.headers
this.negotiator = new Negotiator(req)
}
/**
* Check if the given `type(s)` is acceptable, returning
* the best match when true, otherwise `undefined`, in which
* case you should respond with 406 "Not Acceptable".
*
* The `type` value may be a single mime type string
* such as "application/json", the extension name
* such as "json" or an array `["json", "html", "text/plain"]`. When a list
* or array is given the _best_ match, if any is returned.
*
* Examples:
*
* // Accept: text/html
* this.types('html');
* // => "html"
*
* // Accept: text/*, application/json
* this.types('html');
* // => "html"
* this.types('text/html');
* // => "text/html"
* this.types('json', 'text');
* // => "json"
* this.types('application/json');
* // => "application/json"
*
* // Accept: text/*, application/json
* this.types('image/png');
* this.types('png');
* // => undefined
*
* // Accept: text/*;q=.5, application/json
* this.types(['html', 'json']);
* this.types('html', 'json');
* // => "json"
*
* @param {String|Array} types...
* @return {String|Array|Boolean}
* @public
*/
Accepts.prototype.type =
Accepts.prototype.types = function (types_) {
var types = types_
// support flattened arguments
if (types && !Array.isArray(types)) {
types = new Array(arguments.length)
for (var i = 0; i < types.length; i++) {
types[i] = arguments[i]
}
}
// no types, return all requested types
if (!types || types.length === 0) {
return this.negotiator.mediaTypes()
}
// no accept header, return first given type
if (!this.headers.accept) {
return types[0]
}
var mimes = types.map(extToMime)
var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
var first = accepts[0]
return first
? types[mimes.indexOf(first)]
: false
}
/**
* Return accepted encodings or best fit based on `encodings`.
*
* Given `Accept-Encoding: gzip, deflate`
* an array sorted by quality is returned:
*
* ['gzip', 'deflate']
*
* @param {String|Array} encodings...
* @return {String|Array}
* @public
*/
Accepts.prototype.encoding =
Accepts.prototype.encodings = function (encodings_) {
var encodings = encodings_
// support flattened arguments
if (encodings && !Array.isArray(encodings)) {
encodings = new Array(arguments.length)
for (var i = 0; i < encodings.length; i++) {
encodings[i] = arguments[i]
}
}
// no encodings, return all requested encodings
if (!encodings || encodings.length === 0) {
return this.negotiator.encodings()
}
return this.negotiator.encodings(encodings)[0] || false
}
/**
* Return accepted charsets or best fit based on `charsets`.
*
* Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
* an array sorted by quality is returned:
*
* ['utf-8', 'utf-7', 'iso-8859-1']
*
* @param {String|Array} charsets...
* @return {String|Array}
* @public
*/
Accepts.prototype.charset =
Accepts.prototype.charsets = function (charsets_) {
var charsets = charsets_
// support flattened arguments
if (charsets && !Array.isArray(charsets)) {
charsets = new Array(arguments.length)
for (var i = 0; i < charsets.length; i++) {
charsets[i] = arguments[i]
}
}
// no charsets, return all requested charsets
if (!charsets || charsets.length === 0) {
return this.negotiator.charsets()
}
return this.negotiator.charsets(charsets)[0] || false
}
/**
* Return accepted languages or best fit based on `langs`.
*
* Given `Accept-Language: en;q=0.8, es, pt`
* an array sorted by quality is returned:
*
* ['es', 'pt', 'en']
*
* @param {String|Array} langs...
* @return {Array|String}
* @public
*/
Accepts.prototype.lang =
Accepts.prototype.langs =
Accepts.prototype.language =
Accepts.prototype.languages = function (languages_) {
var languages = languages_
// support flattened arguments
if (languages && !Array.isArray(languages)) {
languages = new Array(arguments.length)
for (var i = 0; i < languages.length; i++) {
languages[i] = arguments[i]
}
}
// no languages, return all requested languages
if (!languages || languages.length === 0) {
return this.negotiator.languages()
}
return this.negotiator.languages(languages)[0] || false
}
/**
* Convert extnames to mime.
*
* @param {String} type
* @return {String}
* @private
*/
function extToMime (type) {
return type.indexOf('/') === -1
? mime.lookup(type)
: type
}
/**
* Check if mime is valid.
*
* @param {String} type
* @return {String}
* @private
*/
function validMime (type) {
return typeof type === 'string'
}

47
node_modules/socket.io/node_modules/accepts/package.json generated vendored Normal file
View File

@ -0,0 +1,47 @@
{
"name": "accepts",
"description": "Higher-level content negotiation",
"version": "1.3.8",
"contributors": [
"Douglas Christopher Wilson <doug@somethingdoug.com>",
"Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)"
],
"license": "MIT",
"repository": "jshttp/accepts",
"dependencies": {
"mime-types": "~2.1.34",
"negotiator": "0.6.3"
},
"devDependencies": {
"deep-equal": "1.0.1",
"eslint": "7.32.0",
"eslint-config-standard": "14.1.1",
"eslint-plugin-import": "2.25.4",
"eslint-plugin-markdown": "2.2.1",
"eslint-plugin-node": "11.1.0",
"eslint-plugin-promise": "4.3.1",
"eslint-plugin-standard": "4.1.0",
"mocha": "9.2.0",
"nyc": "15.1.0"
},
"files": [
"LICENSE",
"HISTORY.md",
"index.js"
],
"engines": {
"node": ">= 0.6"
},
"scripts": {
"lint": "eslint .",
"test": "mocha --reporter spec --check-leaks --bail test/",
"test-ci": "nyc --reporter=lcov --reporter=text npm test",
"test-cov": "nyc --reporter=html --reporter=text npm test"
},
"keywords": [
"content",
"negotiation",
"accept",
"accepts"
]
}

20
node_modules/socket.io/node_modules/debug/LICENSE generated vendored Normal file
View File

@ -0,0 +1,20 @@
(The MIT License)
Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
Copyright (c) 2018-2021 Josh Junon
Permission is hereby granted, free of charge, to any person obtaining a copy of this software
and associated documentation files (the 'Software'), to deal in the Software without restriction,
including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
subject to the following conditions:
The above copyright notice and this permission notice shall be included in all copies or substantial
portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

481
node_modules/socket.io/node_modules/debug/README.md generated vendored Normal file
View File

@ -0,0 +1,481 @@
# debug
[![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
A tiny JavaScript debugging utility modelled after Node.js core's debugging
technique. Works in Node.js and web browsers.
## Installation
```bash
$ npm install debug
```
## Usage
`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
Example [_app.js_](./examples/node/app.js):
```js
var debug = require('debug')('http')
, http = require('http')
, name = 'My App';
// fake app
debug('booting %o', name);
http.createServer(function(req, res){
debug(req.method + ' ' + req.url);
res.end('hello\n');
}).listen(3000, function(){
debug('listening');
});
// fake worker of some kind
require('./worker');
```
Example [_worker.js_](./examples/node/worker.js):
```js
var a = require('debug')('worker:a')
, b = require('debug')('worker:b');
function work() {
a('doing lots of uninteresting work');
setTimeout(work, Math.random() * 1000);
}
work();
function workb() {
b('doing some work');
setTimeout(workb, Math.random() * 2000);
}
workb();
```
The `DEBUG` environment variable is then used to enable these based on space or
comma-delimited names.
Here are some examples:
<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
#### Windows command prompt notes
##### CMD
On Windows the environment variable is set using the `set` command.
```cmd
set DEBUG=*,-not_this
```
Example:
```cmd
set DEBUG=* & node app.js
```
##### PowerShell (VS Code default)
PowerShell uses different syntax to set environment variables.
```cmd
$env:DEBUG = "*,-not_this"
```
Example:
```cmd
$env:DEBUG='app';node app.js
```
Then, run the program to be debugged as usual.
npm script example:
```js
"windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
```
## Namespace Colors
Every debug instance has a color generated for it based on its namespace name.
This helps when visually parsing the debug output to identify which debug instance
a debug line belongs to.
#### Node.js
In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
otherwise debug will only use a small handful of basic colors.
<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
#### Web Browser
Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
option. These are WebKit web inspectors, Firefox ([since version
31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
and the Firebug plugin for Firefox (any version).
<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
## Millisecond diff
When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
## Conventions
If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
## Wildcards
The `*` character may be used as a wildcard. Suppose for example your library has
debuggers named "connect:bodyParser", "connect:compress", "connect:session",
instead of listing all three with
`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
You can also exclude specific debuggers by prefixing them with a "-" character.
For example, `DEBUG=*,-connect:*` would include all debuggers except those
starting with "connect:".
## Environment Variables
When running through Node.js, you can set a few environment variables that will
change the behavior of the debug logging:
| Name | Purpose |
|-----------|-------------------------------------------------|
| `DEBUG` | Enables/disables specific debugging namespaces. |
| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
| `DEBUG_DEPTH` | Object inspection depth. |
| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
__Note:__ The environment variables beginning with `DEBUG_` end up being
converted into an Options object that gets used with `%o`/`%O` formatters.
See the Node.js documentation for
[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
for the complete list.
## Formatters
Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
Below are the officially supported formatters:
| Formatter | Representation |
|-----------|----------------|
| `%O` | Pretty-print an Object on multiple lines. |
| `%o` | Pretty-print an Object all on a single line. |
| `%s` | String. |
| `%d` | Number (both integer and float). |
| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
| `%%` | Single percent sign ('%'). This does not consume an argument. |
### Custom formatters
You can add custom formatters by extending the `debug.formatters` object.
For example, if you wanted to add support for rendering a Buffer as hex with
`%h`, you could do something like:
```js
const createDebug = require('debug')
createDebug.formatters.h = (v) => {
return v.toString('hex')
}
// …elsewhere
const debug = createDebug('foo')
debug('this is hex: %h', new Buffer('hello world'))
// foo this is hex: 68656c6c6f20776f726c6421 +0ms
```
## Browser Support
You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
if you don't want to build it yourself.
Debug's enable state is currently persisted by `localStorage`.
Consider the situation shown below where you have `worker:a` and `worker:b`,
and wish to debug both. You can enable this using `localStorage.debug`:
```js
localStorage.debug = 'worker:*'
```
And then refresh the page.
```js
a = debug('worker:a');
b = debug('worker:b');
setInterval(function(){
a('doing some work');
}, 1000);
setInterval(function(){
b('doing some work');
}, 1200);
```
In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png">
## Output streams
By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
Example [_stdout.js_](./examples/node/stdout.js):
```js
var debug = require('debug');
var error = debug('app:error');
// by default stderr is used
error('goes to stderr!');
var log = debug('app:log');
// set this namespace to log via console.log
log.log = console.log.bind(console); // don't forget to bind to console!
log('goes to stdout');
error('still goes to stderr!');
// set all output to go via console.info
// overrides all per-namespace log settings
debug.log = console.info.bind(console);
error('now goes to stdout via console.info');
log('still goes to stdout, but via console.info now');
```
## Extend
You can simply extend debugger
```js
const log = require('debug')('auth');
//creates new debug instance with extended namespace
const logSign = log.extend('sign');
const logLogin = log.extend('login');
log('hello'); // auth hello
logSign('hello'); //auth:sign hello
logLogin('hello'); //auth:login hello
```
## Set dynamically
You can also enable debug dynamically by calling the `enable()` method :
```js
let debug = require('debug');
console.log(1, debug.enabled('test'));
debug.enable('test');
console.log(2, debug.enabled('test'));
debug.disable();
console.log(3, debug.enabled('test'));
```
print :
```
1 false
2 true
3 false
```
Usage :
`enable(namespaces)`
`namespaces` can include modes separated by a colon and wildcards.
Note that calling `enable()` completely overrides previously set DEBUG variable :
```
$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
=> false
```
`disable()`
Will disable all namespaces. The functions returns the namespaces currently
enabled (and skipped). This can be useful if you want to disable debugging
temporarily without knowing what was enabled to begin with.
For example:
```js
let debug = require('debug');
debug.enable('foo:*,-foo:bar');
let namespaces = debug.disable();
debug.enable(namespaces);
```
Note: There is no guarantee that the string will be identical to the initial
enable string, but semantically they will be identical.
## Checking whether a debug target is enabled
After you've created a debug instance, you can determine whether or not it is
enabled by checking the `enabled` property:
```javascript
const debug = require('debug')('http');
if (debug.enabled) {
// do stuff...
}
```
You can also manually toggle this property to force the debug instance to be
enabled or disabled.
## Usage in child processes
Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.
For example:
```javascript
worker = fork(WORKER_WRAP_PATH, [workerPath], {
stdio: [
/* stdin: */ 0,
/* stdout: */ 'pipe',
/* stderr: */ 'pipe',
'ipc',
],
env: Object.assign({}, process.env, {
DEBUG_COLORS: 1 // without this settings, colors won't be shown
}),
});
worker.stderr.pipe(process.stderr, { end: false });
```
## Authors
- TJ Holowaychuk
- Nathan Rajlich
- Andrew Rhyne
- Josh Junon
## Backers
Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
## Sponsors
Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
## License
(The MIT License)
Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
Copyright (c) 2018-2021 Josh Junon
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

60
node_modules/socket.io/node_modules/debug/package.json generated vendored Normal file
View File

@ -0,0 +1,60 @@
{
"name": "debug",
"version": "4.3.7",
"repository": {
"type": "git",
"url": "git://github.com/debug-js/debug.git"
},
"description": "Lightweight debugging utility for Node.js and the browser",
"keywords": [
"debug",
"log",
"debugger"
],
"files": [
"src",
"LICENSE",
"README.md"
],
"author": "Josh Junon (https://github.com/qix-)",
"contributors": [
"TJ Holowaychuk <tj@vision-media.ca>",
"Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
"Andrew Rhyne <rhyneandrew@gmail.com>"
],
"license": "MIT",
"scripts": {
"lint": "xo",
"test": "npm run test:node && npm run test:browser && npm run lint",
"test:node": "istanbul cover _mocha -- test.js test.node.js",
"test:browser": "karma start --single-run",
"test:coverage": "cat ./coverage/lcov.info | coveralls"
},
"dependencies": {
"ms": "^2.1.3"
},
"devDependencies": {
"brfs": "^2.0.1",
"browserify": "^16.2.3",
"coveralls": "^3.0.2",
"istanbul": "^0.4.5",
"karma": "^3.1.4",
"karma-browserify": "^6.0.0",
"karma-chrome-launcher": "^2.2.0",
"karma-mocha": "^1.3.0",
"mocha": "^5.2.0",
"mocha-lcov-reporter": "^1.2.0",
"sinon": "^14.0.0",
"xo": "^0.23.0"
},
"peerDependenciesMeta": {
"supports-color": {
"optional": true
}
},
"main": "./src/index.js",
"browser": "./src/browser.js",
"engines": {
"node": ">=6.0"
}
}

271
node_modules/socket.io/node_modules/debug/src/browser.js generated vendored Normal file
View File

@ -0,0 +1,271 @@
/* eslint-env browser */
/**
* This is the web browser implementation of `debug()`.
*/
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.storage = localstorage();
exports.destroy = (() => {
let warned = false;
return () => {
if (!warned) {
warned = true;
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
};
})();
/**
* Colors.
*/
exports.colors = [
'#0000CC',
'#0000FF',
'#0033CC',
'#0033FF',
'#0066CC',
'#0066FF',
'#0099CC',
'#0099FF',
'#00CC00',
'#00CC33',
'#00CC66',
'#00CC99',
'#00CCCC',
'#00CCFF',
'#3300CC',
'#3300FF',
'#3333CC',
'#3333FF',
'#3366CC',
'#3366FF',
'#3399CC',
'#3399FF',
'#33CC00',
'#33CC33',
'#33CC66',
'#33CC99',
'#33CCCC',
'#33CCFF',
'#6600CC',
'#6600FF',
'#6633CC',
'#6633FF',
'#66CC00',
'#66CC33',
'#9900CC',
'#9900FF',
'#9933CC',
'#9933FF',
'#99CC00',
'#99CC33',
'#CC0000',
'#CC0033',
'#CC0066',
'#CC0099',
'#CC00CC',
'#CC00FF',
'#CC3300',
'#CC3333',
'#CC3366',
'#CC3399',
'#CC33CC',
'#CC33FF',
'#CC6600',
'#CC6633',
'#CC9900',
'#CC9933',
'#CCCC00',
'#CCCC33',
'#FF0000',
'#FF0033',
'#FF0066',
'#FF0099',
'#FF00CC',
'#FF00FF',
'#FF3300',
'#FF3333',
'#FF3366',
'#FF3399',
'#FF33CC',
'#FF33FF',
'#FF6600',
'#FF6633',
'#FF9900',
'#FF9933',
'#FFCC00',
'#FFCC33'
];
/**
* Currently only WebKit-based Web Inspectors, Firefox >= v31,
* and the Firebug extension (any Firefox version) are known
* to support "%c" CSS customizations.
*
* TODO: add a `localStorage` variable to explicitly enable/disable colors
*/
// eslint-disable-next-line complexity
function useColors() {
// NB: In an Electron preload script, document will be defined but not fully
// initialized. Since we know we're in Chrome, we'll just detect this case
// explicitly
if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
return true;
}
// Internet Explorer and Edge do not support colors.
if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
return false;
}
let m;
// Is webkit? http://stackoverflow.com/a/16459606/376773
// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
// Is firebug? http://stackoverflow.com/a/398120/376773
(typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
// Is firefox >= v31?
// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
(typeof navigator !== 'undefined' && navigator.userAgent && (m = navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)) && parseInt(m[1], 10) >= 31) ||
// Double check webkit in userAgent just in case we are in a worker
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
}
/**
* Colorize log arguments if enabled.
*
* @api public
*/
function formatArgs(args) {
args[0] = (this.useColors ? '%c' : '') +
this.namespace +
(this.useColors ? ' %c' : ' ') +
args[0] +
(this.useColors ? '%c ' : ' ') +
'+' + module.exports.humanize(this.diff);
if (!this.useColors) {
return;
}
const c = 'color: ' + this.color;
args.splice(1, 0, c, 'color: inherit');
// The final "%c" is somewhat tricky, because there could be other
// arguments passed either before or after the %c, so we need to
// figure out the correct index to insert the CSS into
let index = 0;
let lastC = 0;
args[0].replace(/%[a-zA-Z%]/g, match => {
if (match === '%%') {
return;
}
index++;
if (match === '%c') {
// We only are interested in the *last* %c
// (the user may have provided their own)
lastC = index;
}
});
args.splice(lastC, 0, c);
}
/**
* Invokes `console.debug()` when available.
* No-op when `console.debug` is not a "function".
* If `console.debug` is not available, falls back
* to `console.log`.
*
* @api public
*/
exports.log = console.debug || console.log || (() => {});
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
try {
if (namespaces) {
exports.storage.setItem('debug', namespaces);
} else {
exports.storage.removeItem('debug');
}
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
let r;
try {
r = exports.storage.getItem('debug');
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
if (!r && typeof process !== 'undefined' && 'env' in process) {
r = process.env.DEBUG;
}
return r;
}
/**
* Localstorage attempts to return the localstorage.
*
* This is necessary because safari throws
* when a user disables cookies/localstorage
* and you attempt to access it.
*
* @return {LocalStorage}
* @api private
*/
function localstorage() {
try {
// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
// The Browser also has localStorage in the global context.
return localStorage;
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
module.exports = require('./common')(exports);
const {formatters} = module.exports;
/**
* Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
*/
formatters.j = function (v) {
try {
return JSON.stringify(v);
} catch (error) {
return '[UnexpectedJSONParseError]: ' + error.message;
}
};

274
node_modules/socket.io/node_modules/debug/src/common.js generated vendored Normal file
View File

@ -0,0 +1,274 @@
/**
* This is the common logic for both the Node.js and web browser
* implementations of `debug()`.
*/
function setup(env) {
createDebug.debug = createDebug;
createDebug.default = createDebug;
createDebug.coerce = coerce;
createDebug.disable = disable;
createDebug.enable = enable;
createDebug.enabled = enabled;
createDebug.humanize = require('ms');
createDebug.destroy = destroy;
Object.keys(env).forEach(key => {
createDebug[key] = env[key];
});
/**
* The currently active debug mode names, and names to skip.
*/
createDebug.names = [];
createDebug.skips = [];
/**
* Map of special "%n" handling functions, for the debug "format" argument.
*
* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
*/
createDebug.formatters = {};
/**
* Selects a color for a debug namespace
* @param {String} namespace The namespace string for the debug instance to be colored
* @return {Number|String} An ANSI color code for the given namespace
* @api private
*/
function selectColor(namespace) {
let hash = 0;
for (let i = 0; i < namespace.length; i++) {
hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
hash |= 0; // Convert to 32bit integer
}
return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
}
createDebug.selectColor = selectColor;
/**
* Create a debugger with the given `namespace`.
*
* @param {String} namespace
* @return {Function}
* @api public
*/
function createDebug(namespace) {
let prevTime;
let enableOverride = null;
let namespacesCache;
let enabledCache;
function debug(...args) {
// Disabled?
if (!debug.enabled) {
return;
}
const self = debug;
// Set `diff` timestamp
const curr = Number(new Date());
const ms = curr - (prevTime || curr);
self.diff = ms;
self.prev = prevTime;
self.curr = curr;
prevTime = curr;
args[0] = createDebug.coerce(args[0]);
if (typeof args[0] !== 'string') {
// Anything else let's inspect with %O
args.unshift('%O');
}
// Apply any `formatters` transformations
let index = 0;
args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => {
// If we encounter an escaped % then don't increase the array index
if (match === '%%') {
return '%';
}
index++;
const formatter = createDebug.formatters[format];
if (typeof formatter === 'function') {
const val = args[index];
match = formatter.call(self, val);
// Now we need to remove `args[index]` since it's inlined in the `format`
args.splice(index, 1);
index--;
}
return match;
});
// Apply env-specific formatting (colors, etc.)
createDebug.formatArgs.call(self, args);
const logFn = self.log || createDebug.log;
logFn.apply(self, args);
}
debug.namespace = namespace;
debug.useColors = createDebug.useColors();
debug.color = createDebug.selectColor(namespace);
debug.extend = extend;
debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
Object.defineProperty(debug, 'enabled', {
enumerable: true,
configurable: false,
get: () => {
if (enableOverride !== null) {
return enableOverride;
}
if (namespacesCache !== createDebug.namespaces) {
namespacesCache = createDebug.namespaces;
enabledCache = createDebug.enabled(namespace);
}
return enabledCache;
},
set: v => {
enableOverride = v;
}
});
// Env-specific initialization logic for debug instances
if (typeof createDebug.init === 'function') {
createDebug.init(debug);
}
return debug;
}
function extend(namespace, delimiter) {
const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
newDebug.log = this.log;
return newDebug;
}
/**
* Enables a debug mode by namespaces. This can include modes
* separated by a colon and wildcards.
*
* @param {String} namespaces
* @api public
*/
function enable(namespaces) {
createDebug.save(namespaces);
createDebug.namespaces = namespaces;
createDebug.names = [];
createDebug.skips = [];
let i;
const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
const len = split.length;
for (i = 0; i < len; i++) {
if (!split[i]) {
// ignore empty strings
continue;
}
namespaces = split[i].replace(/\*/g, '.*?');
if (namespaces[0] === '-') {
createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$'));
} else {
createDebug.names.push(new RegExp('^' + namespaces + '$'));
}
}
}
/**
* Disable debug output.
*
* @return {String} namespaces
* @api public
*/
function disable() {
const namespaces = [
...createDebug.names.map(toNamespace),
...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace)
].join(',');
createDebug.enable('');
return namespaces;
}
/**
* Returns true if the given mode name is enabled, false otherwise.
*
* @param {String} name
* @return {Boolean}
* @api public
*/
function enabled(name) {
if (name[name.length - 1] === '*') {
return true;
}
let i;
let len;
for (i = 0, len = createDebug.skips.length; i < len; i++) {
if (createDebug.skips[i].test(name)) {
return false;
}
}
for (i = 0, len = createDebug.names.length; i < len; i++) {
if (createDebug.names[i].test(name)) {
return true;
}
}
return false;
}
/**
* Convert regexp to namespace
*
* @param {RegExp} regxep
* @return {String} namespace
* @api private
*/
function toNamespace(regexp) {
return regexp.toString()
.substring(2, regexp.toString().length - 2)
.replace(/\.\*\?$/, '*');
}
/**
* Coerce `val`.
*
* @param {Mixed} val
* @return {Mixed}
* @api private
*/
function coerce(val) {
if (val instanceof Error) {
return val.stack || val.message;
}
return val;
}
/**
* XXX DO NOT USE. This is a temporary stub function.
* XXX It WILL be removed in the next major release.
*/
function destroy() {
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
createDebug.enable(createDebug.load());
return createDebug;
}
module.exports = setup;

10
node_modules/socket.io/node_modules/debug/src/index.js generated vendored Normal file
View File

@ -0,0 +1,10 @@
/**
* Detect Electron renderer / nwjs process, which is node, but we should
* treat as a browser.
*/
if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
module.exports = require('./browser.js');
} else {
module.exports = require('./node.js');
}

263
node_modules/socket.io/node_modules/debug/src/node.js generated vendored Normal file
View File

@ -0,0 +1,263 @@
/**
* Module dependencies.
*/
const tty = require('tty');
const util = require('util');
/**
* This is the Node.js implementation of `debug()`.
*/
exports.init = init;
exports.log = log;
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.destroy = util.deprecate(
() => {},
'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'
);
/**
* Colors.
*/
exports.colors = [6, 2, 3, 4, 5, 1];
try {
// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
// eslint-disable-next-line import/no-extraneous-dependencies
const supportsColor = require('supports-color');
if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
exports.colors = [
20,
21,
26,
27,
32,
33,
38,
39,
40,
41,
42,
43,
44,
45,
56,
57,
62,
63,
68,
69,
74,
75,
76,
77,
78,
79,
80,
81,
92,
93,
98,
99,
112,
113,
128,
129,
134,
135,
148,
149,
160,
161,
162,
163,
164,
165,
166,
167,
168,
169,
170,
171,
172,
173,
178,
179,
184,
185,
196,
197,
198,
199,
200,
201,
202,
203,
204,
205,
206,
207,
208,
209,
214,
215,
220,
221
];
}
} catch (error) {
// Swallow - we only care if `supports-color` is available; it doesn't have to be.
}
/**
* Build up the default `inspectOpts` object from the environment variables.
*
* $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
*/
exports.inspectOpts = Object.keys(process.env).filter(key => {
return /^debug_/i.test(key);
}).reduce((obj, key) => {
// Camel-case
const prop = key
.substring(6)
.toLowerCase()
.replace(/_([a-z])/g, (_, k) => {
return k.toUpperCase();
});
// Coerce string value into JS value
let val = process.env[key];
if (/^(yes|on|true|enabled)$/i.test(val)) {
val = true;
} else if (/^(no|off|false|disabled)$/i.test(val)) {
val = false;
} else if (val === 'null') {
val = null;
} else {
val = Number(val);
}
obj[prop] = val;
return obj;
}, {});
/**
* Is stdout a TTY? Colored output is enabled when `true`.
*/
function useColors() {
return 'colors' in exports.inspectOpts ?
Boolean(exports.inspectOpts.colors) :
tty.isatty(process.stderr.fd);
}
/**
* Adds ANSI color escape codes if enabled.
*
* @api public
*/
function formatArgs(args) {
const {namespace: name, useColors} = this;
if (useColors) {
const c = this.color;
const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c);
const prefix = ` ${colorCode};1m${name} \u001B[0m`;
args[0] = prefix + args[0].split('\n').join('\n' + prefix);
args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m');
} else {
args[0] = getDate() + name + ' ' + args[0];
}
}
function getDate() {
if (exports.inspectOpts.hideDate) {
return '';
}
return new Date().toISOString() + ' ';
}
/**
* Invokes `util.formatWithOptions()` with the specified arguments and writes to stderr.
*/
function log(...args) {
return process.stderr.write(util.formatWithOptions(exports.inspectOpts, ...args) + '\n');
}
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
if (namespaces) {
process.env.DEBUG = namespaces;
} else {
// If you set a process.env field to null or undefined, it gets cast to the
// string 'null' or 'undefined'. Just delete instead.
delete process.env.DEBUG;
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
return process.env.DEBUG;
}
/**
* Init logic for `debug` instances.
*
* Create a new `inspectOpts` object in case `useColors` is set
* differently for a particular `debug` instance.
*/
function init(debug) {
debug.inspectOpts = {};
const keys = Object.keys(exports.inspectOpts);
for (let i = 0; i < keys.length; i++) {
debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
}
}
module.exports = require('./common')(exports);
const {formatters} = module.exports;
/**
* Map %o to `util.inspect()`, all on a single line.
*/
formatters.o = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts)
.split('\n')
.map(str => str.trim())
.join(' ');
};
/**
* Map %O to `util.inspect()`, allowing multiple lines if needed.
*/
formatters.O = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts);
};

507
node_modules/socket.io/node_modules/mime-db/HISTORY.md generated vendored Normal file
View File

@ -0,0 +1,507 @@
1.52.0 / 2022-02-21
===================
* Add extensions from IANA for more `image/*` types
* Add extension `.asc` to `application/pgp-keys`
* Add extensions to various XML types
* Add new upstream MIME types
1.51.0 / 2021-11-08
===================
* Add new upstream MIME types
* Mark `image/vnd.microsoft.icon` as compressible
* Mark `image/vnd.ms-dds` as compressible
1.50.0 / 2021-09-15
===================
* Add deprecated iWorks mime types and extensions
* Add new upstream MIME types
1.49.0 / 2021-07-26
===================
* Add extension `.trig` to `application/trig`
* Add new upstream MIME types
1.48.0 / 2021-05-30
===================
* Add extension `.mvt` to `application/vnd.mapbox-vector-tile`
* Add new upstream MIME types
* Mark `text/yaml` as compressible
1.47.0 / 2021-04-01
===================
* Add new upstream MIME types
* Remove ambigious extensions from IANA for `application/*+xml` types
* Update primary extension to `.es` for `application/ecmascript`
1.46.0 / 2021-02-13
===================
* Add extension `.amr` to `audio/amr`
* Add extension `.m4s` to `video/iso.segment`
* Add extension `.opus` to `audio/ogg`
* Add new upstream MIME types
1.45.0 / 2020-09-22
===================
* Add `application/ubjson` with extension `.ubj`
* Add `image/avif` with extension `.avif`
* Add `image/ktx2` with extension `.ktx2`
* Add extension `.dbf` to `application/vnd.dbf`
* Add extension `.rar` to `application/vnd.rar`
* Add extension `.td` to `application/urc-targetdesc+xml`
* Add new upstream MIME types
* Fix extension of `application/vnd.apple.keynote` to be `.key`
1.44.0 / 2020-04-22
===================
* Add charsets from IANA
* Add extension `.cjs` to `application/node`
* Add new upstream MIME types
1.43.0 / 2020-01-05
===================
* Add `application/x-keepass2` with extension `.kdbx`
* Add extension `.mxmf` to `audio/mobile-xmf`
* Add extensions from IANA for `application/*+xml` types
* Add new upstream MIME types
1.42.0 / 2019-09-25
===================
* Add `image/vnd.ms-dds` with extension `.dds`
* Add new upstream MIME types
* Remove compressible from `multipart/mixed`
1.41.0 / 2019-08-30
===================
* Add new upstream MIME types
* Add `application/toml` with extension `.toml`
* Mark `font/ttf` as compressible
1.40.0 / 2019-04-20
===================
* Add extensions from IANA for `model/*` types
* Add `text/mdx` with extension `.mdx`
1.39.0 / 2019-04-04
===================
* Add extensions `.siv` and `.sieve` to `application/sieve`
* Add new upstream MIME types
1.38.0 / 2019-02-04
===================
* Add extension `.nq` to `application/n-quads`
* Add extension `.nt` to `application/n-triples`
* Add new upstream MIME types
* Mark `text/less` as compressible
1.37.0 / 2018-10-19
===================
* Add extensions to HEIC image types
* Add new upstream MIME types
1.36.0 / 2018-08-20
===================
* Add Apple file extensions from IANA
* Add extensions from IANA for `image/*` types
* Add new upstream MIME types
1.35.0 / 2018-07-15
===================
* Add extension `.owl` to `application/rdf+xml`
* Add new upstream MIME types
- Removes extension `.woff` from `application/font-woff`
1.34.0 / 2018-06-03
===================
* Add extension `.csl` to `application/vnd.citationstyles.style+xml`
* Add extension `.es` to `application/ecmascript`
* Add new upstream MIME types
* Add `UTF-8` as default charset for `text/turtle`
* Mark all XML-derived types as compressible
1.33.0 / 2018-02-15
===================
* Add extensions from IANA for `message/*` types
* Add new upstream MIME types
* Fix some incorrect OOXML types
* Remove `application/font-woff2`
1.32.0 / 2017-11-29
===================
* Add new upstream MIME types
* Update `text/hjson` to registered `application/hjson`
* Add `text/shex` with extension `.shex`
1.31.0 / 2017-10-25
===================
* Add `application/raml+yaml` with extension `.raml`
* Add `application/wasm` with extension `.wasm`
* Add new `font` type from IANA
* Add new upstream font extensions
* Add new upstream MIME types
* Add extensions for JPEG-2000 images
1.30.0 / 2017-08-27
===================
* Add `application/vnd.ms-outlook`
* Add `application/x-arj`
* Add extension `.mjs` to `application/javascript`
* Add glTF types and extensions
* Add new upstream MIME types
* Add `text/x-org`
* Add VirtualBox MIME types
* Fix `source` records for `video/*` types that are IANA
* Update `font/opentype` to registered `font/otf`
1.29.0 / 2017-07-10
===================
* Add `application/fido.trusted-apps+json`
* Add extension `.wadl` to `application/vnd.sun.wadl+xml`
* Add new upstream MIME types
* Add `UTF-8` as default charset for `text/css`
1.28.0 / 2017-05-14
===================
* Add new upstream MIME types
* Add extension `.gz` to `application/gzip`
* Update extensions `.md` and `.markdown` to be `text/markdown`
1.27.0 / 2017-03-16
===================
* Add new upstream MIME types
* Add `image/apng` with extension `.apng`
1.26.0 / 2017-01-14
===================
* Add new upstream MIME types
* Add extension `.geojson` to `application/geo+json`
1.25.0 / 2016-11-11
===================
* Add new upstream MIME types
1.24.0 / 2016-09-18
===================
* Add `audio/mp3`
* Add new upstream MIME types
1.23.0 / 2016-05-01
===================
* Add new upstream MIME types
* Add extension `.3gpp` to `audio/3gpp`
1.22.0 / 2016-02-15
===================
* Add `text/slim`
* Add extension `.rng` to `application/xml`
* Add new upstream MIME types
* Fix extension of `application/dash+xml` to be `.mpd`
* Update primary extension to `.m4a` for `audio/mp4`
1.21.0 / 2016-01-06
===================
* Add Google document types
* Add new upstream MIME types
1.20.0 / 2015-11-10
===================
* Add `text/x-suse-ymp`
* Add new upstream MIME types
1.19.0 / 2015-09-17
===================
* Add `application/vnd.apple.pkpass`
* Add new upstream MIME types
1.18.0 / 2015-09-03
===================
* Add new upstream MIME types
1.17.0 / 2015-08-13
===================
* Add `application/x-msdos-program`
* Add `audio/g711-0`
* Add `image/vnd.mozilla.apng`
* Add extension `.exe` to `application/x-msdos-program`
1.16.0 / 2015-07-29
===================
* Add `application/vnd.uri-map`
1.15.0 / 2015-07-13
===================
* Add `application/x-httpd-php`
1.14.0 / 2015-06-25
===================
* Add `application/scim+json`
* Add `application/vnd.3gpp.ussd+xml`
* Add `application/vnd.biopax.rdf+xml`
* Add `text/x-processing`
1.13.0 / 2015-06-07
===================
* Add nginx as a source
* Add `application/x-cocoa`
* Add `application/x-java-archive-diff`
* Add `application/x-makeself`
* Add `application/x-perl`
* Add `application/x-pilot`
* Add `application/x-redhat-package-manager`
* Add `application/x-sea`
* Add `audio/x-m4a`
* Add `audio/x-realaudio`
* Add `image/x-jng`
* Add `text/mathml`
1.12.0 / 2015-06-05
===================
* Add `application/bdoc`
* Add `application/vnd.hyperdrive+json`
* Add `application/x-bdoc`
* Add extension `.rtf` to `text/rtf`
1.11.0 / 2015-05-31
===================
* Add `audio/wav`
* Add `audio/wave`
* Add extension `.litcoffee` to `text/coffeescript`
* Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data`
* Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install`
1.10.0 / 2015-05-19
===================
* Add `application/vnd.balsamiq.bmpr`
* Add `application/vnd.microsoft.portable-executable`
* Add `application/x-ns-proxy-autoconfig`
1.9.1 / 2015-04-19
==================
* Remove `.json` extension from `application/manifest+json`
- This is causing bugs downstream
1.9.0 / 2015-04-19
==================
* Add `application/manifest+json`
* Add `application/vnd.micro+json`
* Add `image/vnd.zbrush.pcx`
* Add `image/x-ms-bmp`
1.8.0 / 2015-03-13
==================
* Add `application/vnd.citationstyles.style+xml`
* Add `application/vnd.fastcopy-disk-image`
* Add `application/vnd.gov.sk.xmldatacontainer+xml`
* Add extension `.jsonld` to `application/ld+json`
1.7.0 / 2015-02-08
==================
* Add `application/vnd.gerber`
* Add `application/vnd.msa-disk-image`
1.6.1 / 2015-02-05
==================
* Community extensions ownership transferred from `node-mime`
1.6.0 / 2015-01-29
==================
* Add `application/jose`
* Add `application/jose+json`
* Add `application/json-seq`
* Add `application/jwk+json`
* Add `application/jwk-set+json`
* Add `application/jwt`
* Add `application/rdap+json`
* Add `application/vnd.gov.sk.e-form+xml`
* Add `application/vnd.ims.imsccv1p3`
1.5.0 / 2014-12-30
==================
* Add `application/vnd.oracle.resource+json`
* Fix various invalid MIME type entries
- `application/mbox+xml`
- `application/oscp-response`
- `application/vwg-multiplexed`
- `audio/g721`
1.4.0 / 2014-12-21
==================
* Add `application/vnd.ims.imsccv1p2`
* Fix various invalid MIME type entries
- `application/vnd-acucobol`
- `application/vnd-curl`
- `application/vnd-dart`
- `application/vnd-dxr`
- `application/vnd-fdf`
- `application/vnd-mif`
- `application/vnd-sema`
- `application/vnd-wap-wmlc`
- `application/vnd.adobe.flash-movie`
- `application/vnd.dece-zip`
- `application/vnd.dvb_service`
- `application/vnd.micrografx-igx`
- `application/vnd.sealed-doc`
- `application/vnd.sealed-eml`
- `application/vnd.sealed-mht`
- `application/vnd.sealed-ppt`
- `application/vnd.sealed-tiff`
- `application/vnd.sealed-xls`
- `application/vnd.sealedmedia.softseal-html`
- `application/vnd.sealedmedia.softseal-pdf`
- `application/vnd.wap-slc`
- `application/vnd.wap-wbxml`
- `audio/vnd.sealedmedia.softseal-mpeg`
- `image/vnd-djvu`
- `image/vnd-svf`
- `image/vnd-wap-wbmp`
- `image/vnd.sealed-png`
- `image/vnd.sealedmedia.softseal-gif`
- `image/vnd.sealedmedia.softseal-jpg`
- `model/vnd-dwf`
- `model/vnd.parasolid.transmit-binary`
- `model/vnd.parasolid.transmit-text`
- `text/vnd-a`
- `text/vnd-curl`
- `text/vnd.wap-wml`
* Remove example template MIME types
- `application/example`
- `audio/example`
- `image/example`
- `message/example`
- `model/example`
- `multipart/example`
- `text/example`
- `video/example`
1.3.1 / 2014-12-16
==================
* Fix missing extensions
- `application/json5`
- `text/hjson`
1.3.0 / 2014-12-07
==================
* Add `application/a2l`
* Add `application/aml`
* Add `application/atfx`
* Add `application/atxml`
* Add `application/cdfx+xml`
* Add `application/dii`
* Add `application/json5`
* Add `application/lxf`
* Add `application/mf4`
* Add `application/vnd.apache.thrift.compact`
* Add `application/vnd.apache.thrift.json`
* Add `application/vnd.coffeescript`
* Add `application/vnd.enphase.envoy`
* Add `application/vnd.ims.imsccv1p1`
* Add `text/csv-schema`
* Add `text/hjson`
* Add `text/markdown`
* Add `text/yaml`
1.2.0 / 2014-11-09
==================
* Add `application/cea`
* Add `application/dit`
* Add `application/vnd.gov.sk.e-form+zip`
* Add `application/vnd.tmd.mediaflex.api+xml`
* Type `application/epub+zip` is now IANA-registered
1.1.2 / 2014-10-23
==================
* Rebuild database for `application/x-www-form-urlencoded` change
1.1.1 / 2014-10-20
==================
* Mark `application/x-www-form-urlencoded` as compressible.
1.1.0 / 2014-09-28
==================
* Add `application/font-woff2`
1.0.3 / 2014-09-25
==================
* Fix engine requirement in package
1.0.2 / 2014-09-25
==================
* Add `application/coap-group+json`
* Add `application/dcd`
* Add `application/vnd.apache.thrift.binary`
* Add `image/vnd.tencent.tap`
* Mark all JSON-derived types as compressible
* Update `text/vtt` data
1.0.1 / 2014-08-30
==================
* Fix extension ordering
1.0.0 / 2014-08-30
==================
* Add `application/atf`
* Add `application/merge-patch+json`
* Add `multipart/x-mixed-replace`
* Add `source: 'apache'` metadata
* Add `source: 'iana'` metadata
* Remove badly-assumed charset data

23
node_modules/socket.io/node_modules/mime-db/LICENSE generated vendored Normal file
View File

@ -0,0 +1,23 @@
(The MIT License)
Copyright (c) 2014 Jonathan Ong <me@jongleberry.com>
Copyright (c) 2015-2022 Douglas Christopher Wilson <doug@somethingdoug.com>
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

100
node_modules/socket.io/node_modules/mime-db/README.md generated vendored Normal file
View File

@ -0,0 +1,100 @@
# mime-db
[![NPM Version][npm-version-image]][npm-url]
[![NPM Downloads][npm-downloads-image]][npm-url]
[![Node.js Version][node-image]][node-url]
[![Build Status][ci-image]][ci-url]
[![Coverage Status][coveralls-image]][coveralls-url]
This is a large database of mime types and information about them.
It consists of a single, public JSON file and does not include any logic,
allowing it to remain as un-opinionated as possible with an API.
It aggregates data from the following sources:
- http://www.iana.org/assignments/media-types/media-types.xhtml
- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types
- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types
## Installation
```bash
npm install mime-db
```
### Database Download
If you're crazy enough to use this in the browser, you can just grab the
JSON file using [jsDelivr](https://www.jsdelivr.com/). It is recommended to
replace `master` with [a release tag](https://github.com/jshttp/mime-db/tags)
as the JSON format may change in the future.
```
https://cdn.jsdelivr.net/gh/jshttp/mime-db@master/db.json
```
## Usage
```js
var db = require('mime-db')
// grab data on .js files
var data = db['application/javascript']
```
## Data Structure
The JSON file is a map lookup for lowercased mime types.
Each mime type has the following properties:
- `.source` - where the mime type is defined.
If not set, it's probably a custom media type.
- `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types)
- `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml)
- `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types)
- `.extensions[]` - known extensions associated with this mime type.
- `.compressible` - whether a file of this type can be gzipped.
- `.charset` - the default charset associated with this type, if any.
If unknown, every property could be `undefined`.
## Contributing
To edit the database, only make PRs against `src/custom-types.json` or
`src/custom-suffix.json`.
The `src/custom-types.json` file is a JSON object with the MIME type as the
keys and the values being an object with the following keys:
- `compressible` - leave out if you don't know, otherwise `true`/`false` to
indicate whether the data represented by the type is typically compressible.
- `extensions` - include an array of file extensions that are associated with
the type.
- `notes` - human-readable notes about the type, typically what the type is.
- `sources` - include an array of URLs of where the MIME type and the associated
extensions are sourced from. This needs to be a [primary source](https://en.wikipedia.org/wiki/Primary_source);
links to type aggregating sites and Wikipedia are _not acceptable_.
To update the build, run `npm run build`.
### Adding Custom Media Types
The best way to get new media types included in this library is to register
them with the IANA. The community registration procedure is outlined in
[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types
registered with the IANA are automatically pulled into this library.
If that is not possible / feasible, they can be added directly here as a
"custom" type. To do this, it is required to have a primary source that
definitively lists the media type. If an extension is going to be listed as
associateed with this media type, the source must definitively link the
media type and extension as well.
[ci-image]: https://badgen.net/github/checks/jshttp/mime-db/master?label=ci
[ci-url]: https://github.com/jshttp/mime-db/actions?query=workflow%3Aci
[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-db/master
[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master
[node-image]: https://badgen.net/npm/node/mime-db
[node-url]: https://nodejs.org/en/download
[npm-downloads-image]: https://badgen.net/npm/dm/mime-db
[npm-url]: https://npmjs.org/package/mime-db
[npm-version-image]: https://badgen.net/npm/v/mime-db

8519
node_modules/socket.io/node_modules/mime-db/db.json generated vendored Normal file
View File

File diff suppressed because it is too large Load Diff

12
node_modules/socket.io/node_modules/mime-db/index.js generated vendored Normal file
View File

@ -0,0 +1,12 @@
/*!
* mime-db
* Copyright(c) 2014 Jonathan Ong
* Copyright(c) 2015-2022 Douglas Christopher Wilson
* MIT Licensed
*/
/**
* Module exports.
*/
module.exports = require('./db.json')

60
node_modules/socket.io/node_modules/mime-db/package.json generated vendored Normal file
View File

@ -0,0 +1,60 @@
{
"name": "mime-db",
"description": "Media Type Database",
"version": "1.52.0",
"contributors": [
"Douglas Christopher Wilson <doug@somethingdoug.com>",
"Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)",
"Robert Kieffer <robert@broofa.com> (http://github.com/broofa)"
],
"license": "MIT",
"keywords": [
"mime",
"db",
"type",
"types",
"database",
"charset",
"charsets"
],
"repository": "jshttp/mime-db",
"devDependencies": {
"bluebird": "3.7.2",
"co": "4.6.0",
"cogent": "1.0.1",
"csv-parse": "4.16.3",
"eslint": "7.32.0",
"eslint-config-standard": "15.0.1",
"eslint-plugin-import": "2.25.4",
"eslint-plugin-markdown": "2.2.1",
"eslint-plugin-node": "11.1.0",
"eslint-plugin-promise": "5.1.1",
"eslint-plugin-standard": "4.1.0",
"gnode": "0.1.2",
"media-typer": "1.1.0",
"mocha": "9.2.1",
"nyc": "15.1.0",
"raw-body": "2.5.0",
"stream-to-array": "2.3.0"
},
"files": [
"HISTORY.md",
"LICENSE",
"README.md",
"db.json",
"index.js"
],
"engines": {
"node": ">= 0.6"
},
"scripts": {
"build": "node scripts/build",
"fetch": "node scripts/fetch-apache && gnode scripts/fetch-iana && node scripts/fetch-nginx",
"lint": "eslint .",
"test": "mocha --reporter spec --bail --check-leaks test/",
"test-ci": "nyc --reporter=lcov --reporter=text npm test",
"test-cov": "nyc --reporter=html --reporter=text npm test",
"update": "npm run fetch && npm run build",
"version": "node scripts/version-history.js && git add HISTORY.md"
}
}

397
node_modules/socket.io/node_modules/mime-types/HISTORY.md generated vendored Normal file
View File

@ -0,0 +1,397 @@
2.1.35 / 2022-03-12
===================
* deps: mime-db@1.52.0
- Add extensions from IANA for more `image/*` types
- Add extension `.asc` to `application/pgp-keys`
- Add extensions to various XML types
- Add new upstream MIME types
2.1.34 / 2021-11-08
===================
* deps: mime-db@1.51.0
- Add new upstream MIME types
2.1.33 / 2021-10-01
===================
* deps: mime-db@1.50.0
- Add deprecated iWorks mime types and extensions
- Add new upstream MIME types
2.1.32 / 2021-07-27
===================
* deps: mime-db@1.49.0
- Add extension `.trig` to `application/trig`
- Add new upstream MIME types
2.1.31 / 2021-06-01
===================
* deps: mime-db@1.48.0
- Add extension `.mvt` to `application/vnd.mapbox-vector-tile`
- Add new upstream MIME types
2.1.30 / 2021-04-02
===================
* deps: mime-db@1.47.0
- Add extension `.amr` to `audio/amr`
- Remove ambigious extensions from IANA for `application/*+xml` types
- Update primary extension to `.es` for `application/ecmascript`
2.1.29 / 2021-02-17
===================
* deps: mime-db@1.46.0
- Add extension `.amr` to `audio/amr`
- Add extension `.m4s` to `video/iso.segment`
- Add extension `.opus` to `audio/ogg`
- Add new upstream MIME types
2.1.28 / 2021-01-01
===================
* deps: mime-db@1.45.0
- Add `application/ubjson` with extension `.ubj`
- Add `image/avif` with extension `.avif`
- Add `image/ktx2` with extension `.ktx2`
- Add extension `.dbf` to `application/vnd.dbf`
- Add extension `.rar` to `application/vnd.rar`
- Add extension `.td` to `application/urc-targetdesc+xml`
- Add new upstream MIME types
- Fix extension of `application/vnd.apple.keynote` to be `.key`
2.1.27 / 2020-04-23
===================
* deps: mime-db@1.44.0
- Add charsets from IANA
- Add extension `.cjs` to `application/node`
- Add new upstream MIME types
2.1.26 / 2020-01-05
===================
* deps: mime-db@1.43.0
- Add `application/x-keepass2` with extension `.kdbx`
- Add extension `.mxmf` to `audio/mobile-xmf`
- Add extensions from IANA for `application/*+xml` types
- Add new upstream MIME types
2.1.25 / 2019-11-12
===================
* deps: mime-db@1.42.0
- Add new upstream MIME types
- Add `application/toml` with extension `.toml`
- Add `image/vnd.ms-dds` with extension `.dds`
2.1.24 / 2019-04-20
===================
* deps: mime-db@1.40.0
- Add extensions from IANA for `model/*` types
- Add `text/mdx` with extension `.mdx`
2.1.23 / 2019-04-17
===================
* deps: mime-db@~1.39.0
- Add extensions `.siv` and `.sieve` to `application/sieve`
- Add new upstream MIME types
2.1.22 / 2019-02-14
===================
* deps: mime-db@~1.38.0
- Add extension `.nq` to `application/n-quads`
- Add extension `.nt` to `application/n-triples`
- Add new upstream MIME types
2.1.21 / 2018-10-19
===================
* deps: mime-db@~1.37.0
- Add extensions to HEIC image types
- Add new upstream MIME types
2.1.20 / 2018-08-26
===================
* deps: mime-db@~1.36.0
- Add Apple file extensions from IANA
- Add extensions from IANA for `image/*` types
- Add new upstream MIME types
2.1.19 / 2018-07-17
===================
* deps: mime-db@~1.35.0
- Add extension `.csl` to `application/vnd.citationstyles.style+xml`
- Add extension `.es` to `application/ecmascript`
- Add extension `.owl` to `application/rdf+xml`
- Add new upstream MIME types
- Add UTF-8 as default charset for `text/turtle`
2.1.18 / 2018-02-16
===================
* deps: mime-db@~1.33.0
- Add `application/raml+yaml` with extension `.raml`
- Add `application/wasm` with extension `.wasm`
- Add `text/shex` with extension `.shex`
- Add extensions for JPEG-2000 images
- Add extensions from IANA for `message/*` types
- Add new upstream MIME types
- Update font MIME types
- Update `text/hjson` to registered `application/hjson`
2.1.17 / 2017-09-01
===================
* deps: mime-db@~1.30.0
- Add `application/vnd.ms-outlook`
- Add `application/x-arj`
- Add extension `.mjs` to `application/javascript`
- Add glTF types and extensions
- Add new upstream MIME types
- Add `text/x-org`
- Add VirtualBox MIME types
- Fix `source` records for `video/*` types that are IANA
- Update `font/opentype` to registered `font/otf`
2.1.16 / 2017-07-24
===================
* deps: mime-db@~1.29.0
- Add `application/fido.trusted-apps+json`
- Add extension `.wadl` to `application/vnd.sun.wadl+xml`
- Add extension `.gz` to `application/gzip`
- Add new upstream MIME types
- Update extensions `.md` and `.markdown` to be `text/markdown`
2.1.15 / 2017-03-23
===================
* deps: mime-db@~1.27.0
- Add new mime types
- Add `image/apng`
2.1.14 / 2017-01-14
===================
* deps: mime-db@~1.26.0
- Add new mime types
2.1.13 / 2016-11-18
===================
* deps: mime-db@~1.25.0
- Add new mime types
2.1.12 / 2016-09-18
===================
* deps: mime-db@~1.24.0
- Add new mime types
- Add `audio/mp3`
2.1.11 / 2016-05-01
===================
* deps: mime-db@~1.23.0
- Add new mime types
2.1.10 / 2016-02-15
===================
* deps: mime-db@~1.22.0
- Add new mime types
- Fix extension of `application/dash+xml`
- Update primary extension for `audio/mp4`
2.1.9 / 2016-01-06
==================
* deps: mime-db@~1.21.0
- Add new mime types
2.1.8 / 2015-11-30
==================
* deps: mime-db@~1.20.0
- Add new mime types
2.1.7 / 2015-09-20
==================
* deps: mime-db@~1.19.0
- Add new mime types
2.1.6 / 2015-09-03
==================
* deps: mime-db@~1.18.0
- Add new mime types
2.1.5 / 2015-08-20
==================
* deps: mime-db@~1.17.0
- Add new mime types
2.1.4 / 2015-07-30
==================
* deps: mime-db@~1.16.0
- Add new mime types
2.1.3 / 2015-07-13
==================
* deps: mime-db@~1.15.0
- Add new mime types
2.1.2 / 2015-06-25
==================
* deps: mime-db@~1.14.0
- Add new mime types
2.1.1 / 2015-06-08
==================
* perf: fix deopt during mapping
2.1.0 / 2015-06-07
==================
* Fix incorrectly treating extension-less file name as extension
- i.e. `'path/to/json'` will no longer return `application/json`
* Fix `.charset(type)` to accept parameters
* Fix `.charset(type)` to match case-insensitive
* Improve generation of extension to MIME mapping
* Refactor internals for readability and no argument reassignment
* Prefer `application/*` MIME types from the same source
* Prefer any type over `application/octet-stream`
* deps: mime-db@~1.13.0
- Add nginx as a source
- Add new mime types
2.0.14 / 2015-06-06
===================
* deps: mime-db@~1.12.0
- Add new mime types
2.0.13 / 2015-05-31
===================
* deps: mime-db@~1.11.0
- Add new mime types
2.0.12 / 2015-05-19
===================
* deps: mime-db@~1.10.0
- Add new mime types
2.0.11 / 2015-05-05
===================
* deps: mime-db@~1.9.1
- Add new mime types
2.0.10 / 2015-03-13
===================
* deps: mime-db@~1.8.0
- Add new mime types
2.0.9 / 2015-02-09
==================
* deps: mime-db@~1.7.0
- Add new mime types
- Community extensions ownership transferred from `node-mime`
2.0.8 / 2015-01-29
==================
* deps: mime-db@~1.6.0
- Add new mime types
2.0.7 / 2014-12-30
==================
* deps: mime-db@~1.5.0
- Add new mime types
- Fix various invalid MIME type entries
2.0.6 / 2014-12-30
==================
* deps: mime-db@~1.4.0
- Add new mime types
- Fix various invalid MIME type entries
- Remove example template MIME types
2.0.5 / 2014-12-29
==================
* deps: mime-db@~1.3.1
- Fix missing extensions
2.0.4 / 2014-12-10
==================
* deps: mime-db@~1.3.0
- Add new mime types
2.0.3 / 2014-11-09
==================
* deps: mime-db@~1.2.0
- Add new mime types
2.0.2 / 2014-09-28
==================
* deps: mime-db@~1.1.0
- Add new mime types
- Update charsets
2.0.1 / 2014-09-07
==================
* Support Node.js 0.6
2.0.0 / 2014-09-02
==================
* Use `mime-db`
* Remove `.define()`
1.0.2 / 2014-08-04
==================
* Set charset=utf-8 for `text/javascript`
1.0.1 / 2014-06-24
==================
* Add `text/jsx` type
1.0.0 / 2014-05-12
==================
* Return `false` for unknown types
* Set charset=utf-8 for `application/json`
0.1.0 / 2014-05-02
==================
* Initial release

23
node_modules/socket.io/node_modules/mime-types/LICENSE generated vendored Normal file
View File

@ -0,0 +1,23 @@
(The MIT License)
Copyright (c) 2014 Jonathan Ong <me@jongleberry.com>
Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com>
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

113
node_modules/socket.io/node_modules/mime-types/README.md generated vendored Normal file
View File

@ -0,0 +1,113 @@
# mime-types
[![NPM Version][npm-version-image]][npm-url]
[![NPM Downloads][npm-downloads-image]][npm-url]
[![Node.js Version][node-version-image]][node-version-url]
[![Build Status][ci-image]][ci-url]
[![Test Coverage][coveralls-image]][coveralls-url]
The ultimate javascript content-type utility.
Similar to [the `mime@1.x` module](https://www.npmjs.com/package/mime), except:
- __No fallbacks.__ Instead of naively returning the first available type,
`mime-types` simply returns `false`, so do
`var type = mime.lookup('unrecognized') || 'application/octet-stream'`.
- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`.
- No `.define()` functionality
- Bug fixes for `.lookup(path)`
Otherwise, the API is compatible with `mime` 1.x.
## Install
This is a [Node.js](https://nodejs.org/en/) module available through the
[npm registry](https://www.npmjs.com/). Installation is done using the
[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
```sh
$ npm install mime-types
```
## Adding Types
All mime types are based on [mime-db](https://www.npmjs.com/package/mime-db),
so open a PR there if you'd like to add mime types.
## API
```js
var mime = require('mime-types')
```
All functions return `false` if input is invalid or not found.
### mime.lookup(path)
Lookup the content-type associated with a file.
```js
mime.lookup('json') // 'application/json'
mime.lookup('.md') // 'text/markdown'
mime.lookup('file.html') // 'text/html'
mime.lookup('folder/file.js') // 'application/javascript'
mime.lookup('folder/.htaccess') // false
mime.lookup('cats') // false
```
### mime.contentType(type)
Create a full content-type header given a content-type or extension.
When given an extension, `mime.lookup` is used to get the matching
content-type, otherwise the given content-type is used. Then if the
content-type does not already have a `charset` parameter, `mime.charset`
is used to get the default charset and add to the returned content-type.
```js
mime.contentType('markdown') // 'text/x-markdown; charset=utf-8'
mime.contentType('file.json') // 'application/json; charset=utf-8'
mime.contentType('text/html') // 'text/html; charset=utf-8'
mime.contentType('text/html; charset=iso-8859-1') // 'text/html; charset=iso-8859-1'
// from a full path
mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8'
```
### mime.extension(type)
Get the default extension for a content-type.
```js
mime.extension('application/octet-stream') // 'bin'
```
### mime.charset(type)
Lookup the implied default charset of a content-type.
```js
mime.charset('text/markdown') // 'UTF-8'
```
### var type = mime.types[extension]
A map of content-types by extension.
### [extensions...] = mime.extensions[type]
A map of extensions by content-type.
## License
[MIT](LICENSE)
[ci-image]: https://badgen.net/github/checks/jshttp/mime-types/master?label=ci
[ci-url]: https://github.com/jshttp/mime-types/actions/workflows/ci.yml
[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-types/master
[coveralls-url]: https://coveralls.io/r/jshttp/mime-types?branch=master
[node-version-image]: https://badgen.net/npm/node/mime-types
[node-version-url]: https://nodejs.org/en/download
[npm-downloads-image]: https://badgen.net/npm/dm/mime-types
[npm-url]: https://npmjs.org/package/mime-types
[npm-version-image]: https://badgen.net/npm/v/mime-types

188
node_modules/socket.io/node_modules/mime-types/index.js generated vendored Normal file
View File

@ -0,0 +1,188 @@
/*!
* mime-types
* Copyright(c) 2014 Jonathan Ong
* Copyright(c) 2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict'
/**
* Module dependencies.
* @private
*/
var db = require('mime-db')
var extname = require('path').extname
/**
* Module variables.
* @private
*/
var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/
var TEXT_TYPE_REGEXP = /^text\//i
/**
* Module exports.
* @public
*/
exports.charset = charset
exports.charsets = { lookup: charset }
exports.contentType = contentType
exports.extension = extension
exports.extensions = Object.create(null)
exports.lookup = lookup
exports.types = Object.create(null)
// Populate the extensions/types maps
populateMaps(exports.extensions, exports.types)
/**
* Get the default charset for a MIME type.
*
* @param {string} type
* @return {boolean|string}
*/
function charset (type) {
if (!type || typeof type !== 'string') {
return false
}
// TODO: use media-typer
var match = EXTRACT_TYPE_REGEXP.exec(type)
var mime = match && db[match[1].toLowerCase()]
if (mime && mime.charset) {
return mime.charset
}
// default text/* to utf-8
if (match && TEXT_TYPE_REGEXP.test(match[1])) {
return 'UTF-8'
}
return false
}
/**
* Create a full Content-Type header given a MIME type or extension.
*
* @param {string} str
* @return {boolean|string}
*/
function contentType (str) {
// TODO: should this even be in this module?
if (!str || typeof str !== 'string') {
return false
}
var mime = str.indexOf('/') === -1
? exports.lookup(str)
: str
if (!mime) {
return false
}
// TODO: use content-type or other module
if (mime.indexOf('charset') === -1) {
var charset = exports.charset(mime)
if (charset) mime += '; charset=' + charset.toLowerCase()
}
return mime
}
/**
* Get the default extension for a MIME type.
*
* @param {string} type
* @return {boolean|string}
*/
function extension (type) {
if (!type || typeof type !== 'string') {
return false
}
// TODO: use media-typer
var match = EXTRACT_TYPE_REGEXP.exec(type)
// get extensions
var exts = match && exports.extensions[match[1].toLowerCase()]
if (!exts || !exts.length) {
return false
}
return exts[0]
}
/**
* Lookup the MIME type for a file path/extension.
*
* @param {string} path
* @return {boolean|string}
*/
function lookup (path) {
if (!path || typeof path !== 'string') {
return false
}
// get the extension ("ext" or ".ext" or full path)
var extension = extname('x.' + path)
.toLowerCase()
.substr(1)
if (!extension) {
return false
}
return exports.types[extension] || false
}
/**
* Populate the extensions and types maps.
* @private
*/
function populateMaps (extensions, types) {
// source preference (least -> most)
var preference = ['nginx', 'apache', undefined, 'iana']
Object.keys(db).forEach(function forEachMimeType (type) {
var mime = db[type]
var exts = mime.extensions
if (!exts || !exts.length) {
return
}
// mime -> extensions
extensions[type] = exts
// extension -> mime
for (var i = 0; i < exts.length; i++) {
var extension = exts[i]
if (types[extension]) {
var from = preference.indexOf(db[types[extension]].source)
var to = preference.indexOf(mime.source)
if (types[extension] !== 'application/octet-stream' &&
(from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) {
// skip the remapping
continue
}
}
// set the extension -> mime
types[extension] = type
}
})
}

44
node_modules/socket.io/node_modules/mime-types/package.json generated vendored Normal file
View File

@ -0,0 +1,44 @@
{
"name": "mime-types",
"description": "The ultimate javascript content-type utility.",
"version": "2.1.35",
"contributors": [
"Douglas Christopher Wilson <doug@somethingdoug.com>",
"Jeremiah Senkpiel <fishrock123@rocketmail.com> (https://searchbeam.jit.su)",
"Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)"
],
"license": "MIT",
"keywords": [
"mime",
"types"
],
"repository": "jshttp/mime-types",
"dependencies": {
"mime-db": "1.52.0"
},
"devDependencies": {
"eslint": "7.32.0",
"eslint-config-standard": "14.1.1",
"eslint-plugin-import": "2.25.4",
"eslint-plugin-markdown": "2.2.1",
"eslint-plugin-node": "11.1.0",
"eslint-plugin-promise": "5.2.0",
"eslint-plugin-standard": "4.1.0",
"mocha": "9.2.2",
"nyc": "15.1.0"
},
"files": [
"HISTORY.md",
"LICENSE",
"index.js"
],
"engines": {
"node": ">= 0.6"
},
"scripts": {
"lint": "eslint .",
"test": "mocha --reporter spec test/test.js",
"test-ci": "nyc --reporter=lcov --reporter=text npm test",
"test-cov": "nyc --reporter=html --reporter=text npm test"
}
}

108
node_modules/socket.io/node_modules/negotiator/HISTORY.md generated vendored Normal file
View File

@ -0,0 +1,108 @@
0.6.3 / 2022-01-22
==================
* Revert "Lazy-load modules from main entry point"
0.6.2 / 2019-04-29
==================
* Fix sorting charset, encoding, and language with extra parameters
0.6.1 / 2016-05-02
==================
* perf: improve `Accept` parsing speed
* perf: improve `Accept-Charset` parsing speed
* perf: improve `Accept-Encoding` parsing speed
* perf: improve `Accept-Language` parsing speed
0.6.0 / 2015-09-29
==================
* Fix including type extensions in parameters in `Accept` parsing
* Fix parsing `Accept` parameters with quoted equals
* Fix parsing `Accept` parameters with quoted semicolons
* Lazy-load modules from main entry point
* perf: delay type concatenation until needed
* perf: enable strict mode
* perf: hoist regular expressions
* perf: remove closures getting spec properties
* perf: remove a closure from media type parsing
* perf: remove property delete from media type parsing
0.5.3 / 2015-05-10
==================
* Fix media type parameter matching to be case-insensitive
0.5.2 / 2015-05-06
==================
* Fix comparing media types with quoted values
* Fix splitting media types with quoted commas
0.5.1 / 2015-02-14
==================
* Fix preference sorting to be stable for long acceptable lists
0.5.0 / 2014-12-18
==================
* Fix list return order when large accepted list
* Fix missing identity encoding when q=0 exists
* Remove dynamic building of Negotiator class
0.4.9 / 2014-10-14
==================
* Fix error when media type has invalid parameter
0.4.8 / 2014-09-28
==================
* Fix all negotiations to be case-insensitive
* Stable sort preferences of same quality according to client order
* Support Node.js 0.6
0.4.7 / 2014-06-24
==================
* Handle invalid provided languages
* Handle invalid provided media types
0.4.6 / 2014-06-11
==================
* Order by specificity when quality is the same
0.4.5 / 2014-05-29
==================
* Fix regression in empty header handling
0.4.4 / 2014-05-29
==================
* Fix behaviors when headers are not present
0.4.3 / 2014-04-16
==================
* Handle slashes on media params correctly
0.4.2 / 2014-02-28
==================
* Fix media type sorting
* Handle media types params strictly
0.4.1 / 2014-01-16
==================
* Use most specific matches
0.4.0 / 2014-01-09
==================
* Remove preferred prefix from methods

24
node_modules/socket.io/node_modules/negotiator/LICENSE generated vendored Normal file
View File

@ -0,0 +1,24 @@
(The MIT License)
Copyright (c) 2012-2014 Federico Romero
Copyright (c) 2012-2014 Isaac Z. Schlueter
Copyright (c) 2014-2015 Douglas Christopher Wilson
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

203
node_modules/socket.io/node_modules/negotiator/README.md generated vendored Normal file
View File

@ -0,0 +1,203 @@
# negotiator
[![NPM Version][npm-image]][npm-url]
[![NPM Downloads][downloads-image]][downloads-url]
[![Node.js Version][node-version-image]][node-version-url]
[![Build Status][github-actions-ci-image]][github-actions-ci-url]
[![Test Coverage][coveralls-image]][coveralls-url]
An HTTP content negotiator for Node.js
## Installation
```sh
$ npm install negotiator
```
## API
```js
var Negotiator = require('negotiator')
```
### Accept Negotiation
```js
availableMediaTypes = ['text/html', 'text/plain', 'application/json']
// The negotiator constructor receives a request object
negotiator = new Negotiator(request)
// Let's say Accept header is 'text/html, application/*;q=0.2, image/jpeg;q=0.8'
negotiator.mediaTypes()
// -> ['text/html', 'image/jpeg', 'application/*']
negotiator.mediaTypes(availableMediaTypes)
// -> ['text/html', 'application/json']
negotiator.mediaType(availableMediaTypes)
// -> 'text/html'
```
You can check a working example at `examples/accept.js`.
#### Methods
##### mediaType()
Returns the most preferred media type from the client.
##### mediaType(availableMediaType)
Returns the most preferred media type from a list of available media types.
##### mediaTypes()
Returns an array of preferred media types ordered by the client preference.
##### mediaTypes(availableMediaTypes)
Returns an array of preferred media types ordered by priority from a list of
available media types.
### Accept-Language Negotiation
```js
negotiator = new Negotiator(request)
availableLanguages = ['en', 'es', 'fr']
// Let's say Accept-Language header is 'en;q=0.8, es, pt'
negotiator.languages()
// -> ['es', 'pt', 'en']
negotiator.languages(availableLanguages)
// -> ['es', 'en']
language = negotiator.language(availableLanguages)
// -> 'es'
```
You can check a working example at `examples/language.js`.
#### Methods
##### language()
Returns the most preferred language from the client.
##### language(availableLanguages)
Returns the most preferred language from a list of available languages.
##### languages()
Returns an array of preferred languages ordered by the client preference.
##### languages(availableLanguages)
Returns an array of preferred languages ordered by priority from a list of
available languages.
### Accept-Charset Negotiation
```js
availableCharsets = ['utf-8', 'iso-8859-1', 'iso-8859-5']
negotiator = new Negotiator(request)
// Let's say Accept-Charset header is 'utf-8, iso-8859-1;q=0.8, utf-7;q=0.2'
negotiator.charsets()
// -> ['utf-8', 'iso-8859-1', 'utf-7']
negotiator.charsets(availableCharsets)
// -> ['utf-8', 'iso-8859-1']
negotiator.charset(availableCharsets)
// -> 'utf-8'
```
You can check a working example at `examples/charset.js`.
#### Methods
##### charset()
Returns the most preferred charset from the client.
##### charset(availableCharsets)
Returns the most preferred charset from a list of available charsets.
##### charsets()
Returns an array of preferred charsets ordered by the client preference.
##### charsets(availableCharsets)
Returns an array of preferred charsets ordered by priority from a list of
available charsets.
### Accept-Encoding Negotiation
```js
availableEncodings = ['identity', 'gzip']
negotiator = new Negotiator(request)
// Let's say Accept-Encoding header is 'gzip, compress;q=0.2, identity;q=0.5'
negotiator.encodings()
// -> ['gzip', 'identity', 'compress']
negotiator.encodings(availableEncodings)
// -> ['gzip', 'identity']
negotiator.encoding(availableEncodings)
// -> 'gzip'
```
You can check a working example at `examples/encoding.js`.
#### Methods
##### encoding()
Returns the most preferred encoding from the client.
##### encoding(availableEncodings)
Returns the most preferred encoding from a list of available encodings.
##### encodings()
Returns an array of preferred encodings ordered by the client preference.
##### encodings(availableEncodings)
Returns an array of preferred encodings ordered by priority from a list of
available encodings.
## See Also
The [accepts](https://npmjs.org/package/accepts#readme) module builds on
this module and provides an alternative interface, mime type validation,
and more.
## License
[MIT](LICENSE)
[npm-image]: https://img.shields.io/npm/v/negotiator.svg
[npm-url]: https://npmjs.org/package/negotiator
[node-version-image]: https://img.shields.io/node/v/negotiator.svg
[node-version-url]: https://nodejs.org/en/download/
[coveralls-image]: https://img.shields.io/coveralls/jshttp/negotiator/master.svg
[coveralls-url]: https://coveralls.io/r/jshttp/negotiator?branch=master
[downloads-image]: https://img.shields.io/npm/dm/negotiator.svg
[downloads-url]: https://npmjs.org/package/negotiator
[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/negotiator/ci/master?label=ci
[github-actions-ci-url]: https://github.com/jshttp/negotiator/actions/workflows/ci.yml

82
node_modules/socket.io/node_modules/negotiator/index.js generated vendored Normal file
View File

@ -0,0 +1,82 @@
/*!
* negotiator
* Copyright(c) 2012 Federico Romero
* Copyright(c) 2012-2014 Isaac Z. Schlueter
* Copyright(c) 2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict';
var preferredCharsets = require('./lib/charset')
var preferredEncodings = require('./lib/encoding')
var preferredLanguages = require('./lib/language')
var preferredMediaTypes = require('./lib/mediaType')
/**
* Module exports.
* @public
*/
module.exports = Negotiator;
module.exports.Negotiator = Negotiator;
/**
* Create a Negotiator instance from a request.
* @param {object} request
* @public
*/
function Negotiator(request) {
if (!(this instanceof Negotiator)) {
return new Negotiator(request);
}
this.request = request;
}
Negotiator.prototype.charset = function charset(available) {
var set = this.charsets(available);
return set && set[0];
};
Negotiator.prototype.charsets = function charsets(available) {
return preferredCharsets(this.request.headers['accept-charset'], available);
};
Negotiator.prototype.encoding = function encoding(available) {
var set = this.encodings(available);
return set && set[0];
};
Negotiator.prototype.encodings = function encodings(available) {
return preferredEncodings(this.request.headers['accept-encoding'], available);
};
Negotiator.prototype.language = function language(available) {
var set = this.languages(available);
return set && set[0];
};
Negotiator.prototype.languages = function languages(available) {
return preferredLanguages(this.request.headers['accept-language'], available);
};
Negotiator.prototype.mediaType = function mediaType(available) {
var set = this.mediaTypes(available);
return set && set[0];
};
Negotiator.prototype.mediaTypes = function mediaTypes(available) {
return preferredMediaTypes(this.request.headers.accept, available);
};
// Backwards compatibility
Negotiator.prototype.preferredCharset = Negotiator.prototype.charset;
Negotiator.prototype.preferredCharsets = Negotiator.prototype.charsets;
Negotiator.prototype.preferredEncoding = Negotiator.prototype.encoding;
Negotiator.prototype.preferredEncodings = Negotiator.prototype.encodings;
Negotiator.prototype.preferredLanguage = Negotiator.prototype.language;
Negotiator.prototype.preferredLanguages = Negotiator.prototype.languages;
Negotiator.prototype.preferredMediaType = Negotiator.prototype.mediaType;
Negotiator.prototype.preferredMediaTypes = Negotiator.prototype.mediaTypes;

169
node_modules/socket.io/node_modules/negotiator/lib/charset.js generated vendored Normal file
View File

@ -0,0 +1,169 @@
/**
* negotiator
* Copyright(c) 2012 Isaac Z. Schlueter
* Copyright(c) 2014 Federico Romero
* Copyright(c) 2014-2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict';
/**
* Module exports.
* @public
*/
module.exports = preferredCharsets;
module.exports.preferredCharsets = preferredCharsets;
/**
* Module variables.
* @private
*/
var simpleCharsetRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/;
/**
* Parse the Accept-Charset header.
* @private
*/
function parseAcceptCharset(accept) {
var accepts = accept.split(',');
for (var i = 0, j = 0; i < accepts.length; i++) {
var charset = parseCharset(accepts[i].trim(), i);
if (charset) {
accepts[j++] = charset;
}
}
// trim accepts
accepts.length = j;
return accepts;
}
/**
* Parse a charset from the Accept-Charset header.
* @private
*/
function parseCharset(str, i) {
var match = simpleCharsetRegExp.exec(str);
if (!match) return null;
var charset = match[1];
var q = 1;
if (match[2]) {
var params = match[2].split(';')
for (var j = 0; j < params.length; j++) {
var p = params[j].trim().split('=');
if (p[0] === 'q') {
q = parseFloat(p[1]);
break;
}
}
}
return {
charset: charset,
q: q,
i: i
};
}
/**
* Get the priority of a charset.
* @private
*/
function getCharsetPriority(charset, accepted, index) {
var priority = {o: -1, q: 0, s: 0};
for (var i = 0; i < accepted.length; i++) {
var spec = specify(charset, accepted[i], index);
if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) {
priority = spec;
}
}
return priority;
}
/**
* Get the specificity of the charset.
* @private
*/
function specify(charset, spec, index) {
var s = 0;
if(spec.charset.toLowerCase() === charset.toLowerCase()){
s |= 1;
} else if (spec.charset !== '*' ) {
return null
}
return {
i: index,
o: spec.i,
q: spec.q,
s: s
}
}
/**
* Get the preferred charsets from an Accept-Charset header.
* @public
*/
function preferredCharsets(accept, provided) {
// RFC 2616 sec 14.2: no header = *
var accepts = parseAcceptCharset(accept === undefined ? '*' : accept || '');
if (!provided) {
// sorted list of all charsets
return accepts
.filter(isQuality)
.sort(compareSpecs)
.map(getFullCharset);
}
var priorities = provided.map(function getPriority(type, index) {
return getCharsetPriority(type, accepts, index);
});
// sorted list of accepted charsets
return priorities.filter(isQuality).sort(compareSpecs).map(function getCharset(priority) {
return provided[priorities.indexOf(priority)];
});
}
/**
* Compare two specs.
* @private
*/
function compareSpecs(a, b) {
return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0;
}
/**
* Get full charset string.
* @private
*/
function getFullCharset(spec) {
return spec.charset;
}
/**
* Check if a spec has any quality.
* @private
*/
function isQuality(spec) {
return spec.q > 0;
}

184
node_modules/socket.io/node_modules/negotiator/lib/encoding.js generated vendored Normal file
View File

@ -0,0 +1,184 @@
/**
* negotiator
* Copyright(c) 2012 Isaac Z. Schlueter
* Copyright(c) 2014 Federico Romero
* Copyright(c) 2014-2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict';
/**
* Module exports.
* @public
*/
module.exports = preferredEncodings;
module.exports.preferredEncodings = preferredEncodings;
/**
* Module variables.
* @private
*/
var simpleEncodingRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/;
/**
* Parse the Accept-Encoding header.
* @private
*/
function parseAcceptEncoding(accept) {
var accepts = accept.split(',');
var hasIdentity = false;
var minQuality = 1;
for (var i = 0, j = 0; i < accepts.length; i++) {
var encoding = parseEncoding(accepts[i].trim(), i);
if (encoding) {
accepts[j++] = encoding;
hasIdentity = hasIdentity || specify('identity', encoding);
minQuality = Math.min(minQuality, encoding.q || 1);
}
}
if (!hasIdentity) {
/*
* If identity doesn't explicitly appear in the accept-encoding header,
* it's added to the list of acceptable encoding with the lowest q
*/
accepts[j++] = {
encoding: 'identity',
q: minQuality,
i: i
};
}
// trim accepts
accepts.length = j;
return accepts;
}
/**
* Parse an encoding from the Accept-Encoding header.
* @private
*/
function parseEncoding(str, i) {
var match = simpleEncodingRegExp.exec(str);
if (!match) return null;
var encoding = match[1];
var q = 1;
if (match[2]) {
var params = match[2].split(';');
for (var j = 0; j < params.length; j++) {
var p = params[j].trim().split('=');
if (p[0] === 'q') {
q = parseFloat(p[1]);
break;
}
}
}
return {
encoding: encoding,
q: q,
i: i
};
}
/**
* Get the priority of an encoding.
* @private
*/
function getEncodingPriority(encoding, accepted, index) {
var priority = {o: -1, q: 0, s: 0};
for (var i = 0; i < accepted.length; i++) {
var spec = specify(encoding, accepted[i], index);
if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) {
priority = spec;
}
}
return priority;
}
/**
* Get the specificity of the encoding.
* @private
*/
function specify(encoding, spec, index) {
var s = 0;
if(spec.encoding.toLowerCase() === encoding.toLowerCase()){
s |= 1;
} else if (spec.encoding !== '*' ) {
return null
}
return {
i: index,
o: spec.i,
q: spec.q,
s: s
}
};
/**
* Get the preferred encodings from an Accept-Encoding header.
* @public
*/
function preferredEncodings(accept, provided) {
var accepts = parseAcceptEncoding(accept || '');
if (!provided) {
// sorted list of all encodings
return accepts
.filter(isQuality)
.sort(compareSpecs)
.map(getFullEncoding);
}
var priorities = provided.map(function getPriority(type, index) {
return getEncodingPriority(type, accepts, index);
});
// sorted list of accepted encodings
return priorities.filter(isQuality).sort(compareSpecs).map(function getEncoding(priority) {
return provided[priorities.indexOf(priority)];
});
}
/**
* Compare two specs.
* @private
*/
function compareSpecs(a, b) {
return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0;
}
/**
* Get full encoding string.
* @private
*/
function getFullEncoding(spec) {
return spec.encoding;
}
/**
* Check if a spec has any quality.
* @private
*/
function isQuality(spec) {
return spec.q > 0;
}

179
node_modules/socket.io/node_modules/negotiator/lib/language.js generated vendored Normal file
View File

@ -0,0 +1,179 @@
/**
* negotiator
* Copyright(c) 2012 Isaac Z. Schlueter
* Copyright(c) 2014 Federico Romero
* Copyright(c) 2014-2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict';
/**
* Module exports.
* @public
*/
module.exports = preferredLanguages;
module.exports.preferredLanguages = preferredLanguages;
/**
* Module variables.
* @private
*/
var simpleLanguageRegExp = /^\s*([^\s\-;]+)(?:-([^\s;]+))?\s*(?:;(.*))?$/;
/**
* Parse the Accept-Language header.
* @private
*/
function parseAcceptLanguage(accept) {
var accepts = accept.split(',');
for (var i = 0, j = 0; i < accepts.length; i++) {
var language = parseLanguage(accepts[i].trim(), i);
if (language) {
accepts[j++] = language;
}
}
// trim accepts
accepts.length = j;
return accepts;
}
/**
* Parse a language from the Accept-Language header.
* @private
*/
function parseLanguage(str, i) {
var match = simpleLanguageRegExp.exec(str);
if (!match) return null;
var prefix = match[1]
var suffix = match[2]
var full = prefix
if (suffix) full += "-" + suffix;
var q = 1;
if (match[3]) {
var params = match[3].split(';')
for (var j = 0; j < params.length; j++) {
var p = params[j].split('=');
if (p[0] === 'q') q = parseFloat(p[1]);
}
}
return {
prefix: prefix,
suffix: suffix,
q: q,
i: i,
full: full
};
}
/**
* Get the priority of a language.
* @private
*/
function getLanguagePriority(language, accepted, index) {
var priority = {o: -1, q: 0, s: 0};
for (var i = 0; i < accepted.length; i++) {
var spec = specify(language, accepted[i], index);
if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) {
priority = spec;
}
}
return priority;
}
/**
* Get the specificity of the language.
* @private
*/
function specify(language, spec, index) {
var p = parseLanguage(language)
if (!p) return null;
var s = 0;
if(spec.full.toLowerCase() === p.full.toLowerCase()){
s |= 4;
} else if (spec.prefix.toLowerCase() === p.full.toLowerCase()) {
s |= 2;
} else if (spec.full.toLowerCase() === p.prefix.toLowerCase()) {
s |= 1;
} else if (spec.full !== '*' ) {
return null
}
return {
i: index,
o: spec.i,
q: spec.q,
s: s
}
};
/**
* Get the preferred languages from an Accept-Language header.
* @public
*/
function preferredLanguages(accept, provided) {
// RFC 2616 sec 14.4: no header = *
var accepts = parseAcceptLanguage(accept === undefined ? '*' : accept || '');
if (!provided) {
// sorted list of all languages
return accepts
.filter(isQuality)
.sort(compareSpecs)
.map(getFullLanguage);
}
var priorities = provided.map(function getPriority(type, index) {
return getLanguagePriority(type, accepts, index);
});
// sorted list of accepted languages
return priorities.filter(isQuality).sort(compareSpecs).map(function getLanguage(priority) {
return provided[priorities.indexOf(priority)];
});
}
/**
* Compare two specs.
* @private
*/
function compareSpecs(a, b) {
return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0;
}
/**
* Get full language string.
* @private
*/
function getFullLanguage(spec) {
return spec.full;
}
/**
* Check if a spec has any quality.
* @private
*/
function isQuality(spec) {
return spec.q > 0;
}

294
node_modules/socket.io/node_modules/negotiator/lib/mediaType.js generated vendored Normal file
View File

@ -0,0 +1,294 @@
/**
* negotiator
* Copyright(c) 2012 Isaac Z. Schlueter
* Copyright(c) 2014 Federico Romero
* Copyright(c) 2014-2015 Douglas Christopher Wilson
* MIT Licensed
*/
'use strict';
/**
* Module exports.
* @public
*/
module.exports = preferredMediaTypes;
module.exports.preferredMediaTypes = preferredMediaTypes;
/**
* Module variables.
* @private
*/
var simpleMediaTypeRegExp = /^\s*([^\s\/;]+)\/([^;\s]+)\s*(?:;(.*))?$/;
/**
* Parse the Accept header.
* @private
*/
function parseAccept(accept) {
var accepts = splitMediaTypes(accept);
for (var i = 0, j = 0; i < accepts.length; i++) {
var mediaType = parseMediaType(accepts[i].trim(), i);
if (mediaType) {
accepts[j++] = mediaType;
}
}
// trim accepts
accepts.length = j;
return accepts;
}
/**
* Parse a media type from the Accept header.
* @private
*/
function parseMediaType(str, i) {
var match = simpleMediaTypeRegExp.exec(str);
if (!match) return null;
var params = Object.create(null);
var q = 1;
var subtype = match[2];
var type = match[1];
if (match[3]) {
var kvps = splitParameters(match[3]).map(splitKeyValuePair);
for (var j = 0; j < kvps.length; j++) {
var pair = kvps[j];
var key = pair[0].toLowerCase();
var val = pair[1];
// get the value, unwrapping quotes
var value = val && val[0] === '"' && val[val.length - 1] === '"'
? val.substr(1, val.length - 2)
: val;
if (key === 'q') {
q = parseFloat(value);
break;
}
// store parameter
params[key] = value;
}
}
return {
type: type,
subtype: subtype,
params: params,
q: q,
i: i
};
}
/**
* Get the priority of a media type.
* @private
*/
function getMediaTypePriority(type, accepted, index) {
var priority = {o: -1, q: 0, s: 0};
for (var i = 0; i < accepted.length; i++) {
var spec = specify(type, accepted[i], index);
if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) {
priority = spec;
}
}
return priority;
}
/**
* Get the specificity of the media type.
* @private
*/
function specify(type, spec, index) {
var p = parseMediaType(type);
var s = 0;
if (!p) {
return null;
}
if(spec.type.toLowerCase() == p.type.toLowerCase()) {
s |= 4
} else if(spec.type != '*') {
return null;
}
if(spec.subtype.toLowerCase() == p.subtype.toLowerCase()) {
s |= 2
} else if(spec.subtype != '*') {
return null;
}
var keys = Object.keys(spec.params);
if (keys.length > 0) {
if (keys.every(function (k) {
return spec.params[k] == '*' || (spec.params[k] || '').toLowerCase() == (p.params[k] || '').toLowerCase();
})) {
s |= 1
} else {
return null
}
}
return {
i: index,
o: spec.i,
q: spec.q,
s: s,
}
}
/**
* Get the preferred media types from an Accept header.
* @public
*/
function preferredMediaTypes(accept, provided) {
// RFC 2616 sec 14.2: no header = */*
var accepts = parseAccept(accept === undefined ? '*/*' : accept || '');
if (!provided) {
// sorted list of all types
return accepts
.filter(isQuality)
.sort(compareSpecs)
.map(getFullType);
}
var priorities = provided.map(function getPriority(type, index) {
return getMediaTypePriority(type, accepts, index);
});
// sorted list of accepted types
return priorities.filter(isQuality).sort(compareSpecs).map(function getType(priority) {
return provided[priorities.indexOf(priority)];
});
}
/**
* Compare two specs.
* @private
*/
function compareSpecs(a, b) {
return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0;
}
/**
* Get full type string.
* @private
*/
function getFullType(spec) {
return spec.type + '/' + spec.subtype;
}
/**
* Check if a spec has any quality.
* @private
*/
function isQuality(spec) {
return spec.q > 0;
}
/**
* Count the number of quotes in a string.
* @private
*/
function quoteCount(string) {
var count = 0;
var index = 0;
while ((index = string.indexOf('"', index)) !== -1) {
count++;
index++;
}
return count;
}
/**
* Split a key value pair.
* @private
*/
function splitKeyValuePair(str) {
var index = str.indexOf('=');
var key;
var val;
if (index === -1) {
key = str;
} else {
key = str.substr(0, index);
val = str.substr(index + 1);
}
return [key, val];
}
/**
* Split an Accept header into media types.
* @private
*/
function splitMediaTypes(accept) {
var accepts = accept.split(',');
for (var i = 1, j = 0; i < accepts.length; i++) {
if (quoteCount(accepts[j]) % 2 == 0) {
accepts[++j] = accepts[i];
} else {
accepts[j] += ',' + accepts[i];
}
}
// trim accepts
accepts.length = j + 1;
return accepts;
}
/**
* Split a string of parameters.
* @private
*/
function splitParameters(str) {
var parameters = str.split(';');
for (var i = 1, j = 0; i < parameters.length; i++) {
if (quoteCount(parameters[j]) % 2 == 0) {
parameters[++j] = parameters[i];
} else {
parameters[j] += ';' + parameters[i];
}
}
// trim parameters
parameters.length = j + 1;
for (var i = 0; i < parameters.length; i++) {
parameters[i] = parameters[i].trim();
}
return parameters;
}

42
node_modules/socket.io/node_modules/negotiator/package.json generated vendored Normal file
View File

@ -0,0 +1,42 @@
{
"name": "negotiator",
"description": "HTTP content negotiation",
"version": "0.6.3",
"contributors": [
"Douglas Christopher Wilson <doug@somethingdoug.com>",
"Federico Romero <federico.romero@outboxlabs.com>",
"Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me/)"
],
"license": "MIT",
"keywords": [
"http",
"content negotiation",
"accept",
"accept-language",
"accept-encoding",
"accept-charset"
],
"repository": "jshttp/negotiator",
"devDependencies": {
"eslint": "7.32.0",
"eslint-plugin-markdown": "2.2.1",
"mocha": "9.1.3",
"nyc": "15.1.0"
},
"files": [
"lib/",
"HISTORY.md",
"LICENSE",
"index.js",
"README.md"
],
"engines": {
"node": ">= 0.6"
},
"scripts": {
"lint": "eslint .",
"test": "mocha --reporter spec --check-leaks --bail test/",
"test-ci": "nyc --reporter=lcov --reporter=text npm test",
"test-cov": "nyc --reporter=html --reporter=text npm test"
}
}

85
node_modules/socket.io/package.json generated vendored Normal file
View File

@ -0,0 +1,85 @@
{
"name": "socket.io",
"version": "4.8.1",
"description": "node.js realtime framework server",
"keywords": [
"realtime",
"framework",
"websocket",
"tcp",
"events",
"socket",
"io"
],
"files": [
"dist/",
"client-dist/",
"wrapper.mjs",
"!**/*.tsbuildinfo"
],
"directories": {
"doc": "docs/",
"example": "example/",
"lib": "lib/",
"test": "test/"
},
"type": "commonjs",
"main": "./dist/index.js",
"exports": {
"types": "./dist/index.d.ts",
"import": "./wrapper.mjs",
"require": "./dist/index.js"
},
"types": "./dist/index.d.ts",
"license": "MIT",
"homepage": "https://github.com/socketio/socket.io/tree/main/packages/socket.io#readme",
"repository": {
"type": "git",
"url": "git+https://github.com/socketio/socket.io.git"
},
"bugs": {
"url": "https://github.com/socketio/socket.io/issues"
},
"scripts": {
"compile": "rimraf ./dist && tsc",
"test": "npm run format:check && npm run compile && npm run test:types && npm run test:unit",
"test:types": "tsd",
"test:unit": "nyc mocha --require ts-node/register --reporter spec --slow 200 --bail --timeout 10000 test/index.ts",
"format:check": "prettier --check \"lib/**/*.ts\" \"test/**/*.ts\"",
"format:fix": "prettier --write \"lib/**/*.ts\" \"test/**/*.ts\"",
"prepack": "npm run compile"
},
"dependencies": {
"accepts": "~1.3.4",
"base64id": "~2.0.0",
"cors": "~2.8.5",
"debug": "~4.3.2",
"engine.io": "~6.6.0",
"socket.io-adapter": "~2.5.2",
"socket.io-parser": "~4.2.4"
},
"contributors": [
{
"name": "Guillermo Rauch",
"email": "rauchg@gmail.com"
},
{
"name": "Arnout Kazemier",
"email": "info@3rd-eden.com"
},
{
"name": "Vladimir Dronnikov",
"email": "dronnikov@gmail.com"
},
{
"name": "Einar Otto Stangvik",
"email": "einaros@gmail.com"
}
],
"engines": {
"node": ">=10.2.0"
},
"tsd": {
"directory": "test"
}
}

3
node_modules/socket.io/wrapper.mjs generated vendored Normal file
View File

@ -0,0 +1,3 @@
import io from "./dist/index.js";
export const {Server, Namespace, Socket} = io;